2013A&A...550A.108V


Query : 2013A&A...550A.108V

2013A&A...550A.108V - Astronomy and Astrophysics, volume 550A, 108-108 (2013/2-1)

The VLT-FLAMES Tarantula Survey. IX. The interstellar medium seen through diffuse interstellar bands and neutral sodium.

VAN LOON J.T., BAILEY M., TATTON B.L., MAIZ-APELLANIZ J., CROWTHER P.A., DE KOTER A., EVANS C.J., HENAULT-BRUNET V., HOWARTH I.D., RICHTER P., SANA H., SIMON-DIAZ S., TAYLOR W. and WALBORN N.R.

Abstract (from CDS):

The Tarantula Nebula (a.k.a. 30 Dor) is a spectacular star-forming region in the Large Magellanic Cloud (LMC), seen through gas in the Galactic disc and halo. Diffuse interstellar bands (DIBs) offer a unique probe of the diffuse, cool-warm gas in these regions. The aim is to use DIBs as diagnostics of the local interstellar conditions, whilst at the same time deriving properties of the yet-unknown carriers of these enigmatic spectral features. Spectra of over 800 early-type stars from the Very Large Telescope Flames Tarantula Survey (VFTS) were analysed. Maps were created, separately, for the Galactic and LMC absorption in the DIBs at 4428 and 6614Å and - in a smaller region near the central cluster R136 - neutral sodium (the Na iD doublet); we also measured the DIBs at 5780 and 5797Å. The maps show strong 4428 and 6614Å DIBs in the quiescent cloud complex to the south of 30Dor but weak absorption in the harsher environments to the north (bubbles) and near the OB associations. The Na maps show at least five kinematic components in the LMC and a shell-like structure surrounding R136, and small-scale structure in the Milky Way. The strengths of the 4428, 5780, 5797 and 6614Å DIBs are correlated, also with Na absorption and visual extinction. The strong 4428Å DIB is present already at low Na column density but the 6614, 5780 and 5797Å DIBs start to be detectable at subsequently larger Na column densities. The carriers of the 4428, 6614, 5780 and 5797Å DIBs are increasingly prone to removal from irradiated gas. The relative strength of the 5780 and 5797Å DIBs clearly confirm the Tarantula Nebula as well as Galactic high-latitude gas to represent a harsh radiation environment. The resilience of the 4428Å DIB suggests its carrier is large, compact and neutral. Structure is detected in the distribution of cool-warm gas on scales between one and >100pc in the LMC and as little as 0.01pc in the Sun's vicinity. Stellar winds from the central cluster R136 have created an expanding shell; some infalling gas is also detected, reminiscent of a galactic ``fountain''.

Abstract Copyright:

Journal keyword(s): ISM: individual objects: Tarantula Nebula (30 Doradus Nebula) - ISM: molecules - ISM: kinematics and dynamics - ISM: lines and bands - ISM: structure - local insterstellar matter

VizieR on-line data: <Available at CDS (J/A+A/550/A108): tablea2.dat tablea3.dat tablea4.dat>

Simbad objects: 864

goto Full paper

goto View the references in ADS

Number of rows : 864
N Identifier Otype ICRS (J2000)
RA
ICRS (J2000)
DEC
Mag U Mag B Mag V Mag R Mag I Sp type #ref
1850 - 2024
#notes
1 NAME SMC G 00 52 38.0 -72 48 01   2.79 2.2     ~ 11178 1
2 NAME Magellanic Clouds GrG 03 00 -71.0           ~ 7084 0
3 NAME LMC G 05 23 34.6 -69 45 22     0.4     ~ 17478 0
4 LHA 120-N 51D HII 05 25 17.3 -67 22 47           ~ 114 0
5 VFTS 1 * 05 36 53.3887349904 -69 08 18.314785824   16.98 16.93     B1.5:V 6 0
6 HD 38029A WR* 05 36 54.633 -69 11 38.08           WC4 55 1
7 HD 38029 ** 05 36 55.16856 -69 11 37.6584 14.523     11.91 11.680 ~ 61 0
8 HD 38029B s*b 05 36 55.1865323232 -69 11 37.582606608           B1Ia+ 56 1
9 VFTS 4 * 05 36 58.450 -69 06 47.26   17.03 16.87     B2V 7 0
10 VFTS 5 * 05 37 01.7369136528 -69 08 16.283803596   16.27 16.25     B2V(n) 7 0
11 VFTS 7 * 05 37 02.960 -69 02 04.17   16.77 16.74     B1-2V 7 0
12 VFTS 8 * 05 37 03.1003184136 -69 08 22.606001520   16.99 16.92     B0.5:V(n) 8 0
13 VFTS 9 * 05 37 04.2549483072 -69 08 05.713967580   16.29 16.18     B1-1.5V 7 0
14 VFTS 10 * 05 37 04.7155944408 -69 08 56.699266524   16.83 16.79     B2V 7 0
15 VFTS 12 * 05 37 05.6365126608 -69 09 12.434725692   15.98 15.83     O9.5IIIn 6 0
16 VFTS 13 * 05 37 06.2899918416 -69 04 41.366979876   16.49 16.36     B1.5V 6 0
17 2MASS J05370761-6905062 SB* 05 37 07.619 -69 05 06.22           O8.5Vz 8 0
18 VFTS 15 * 05 37 08.5513463232 -69 05 10.024389780   16.24 16.20     B0.5V 6 0
19 NAME 30 Dor 016 * 05 37 08.8778548584 -69 07 20.375080464 12.623 13.584 13.546   13.816 O2IIIf* 44 0
20 2MASS J05371136-6905041 SB* 05 37 11.365 -69 05 04.19           B0V 6 0
21 VFTS 18 * 05 37 11.4522977160 -69 10 30.925595316   16.79 16.62     B1.5V 6 0
22 Brey 69 WR* 05 37 11.4810561480 -69 07 38.183877948 15.959 16.427 16.301   15.936 WN3o 25 0
23 VFTS 20 * 05 37 14.1011731488 -69 04 02.721690912   16.76 16.70     B2.5:V(n) 6 0
24 VFTS 21 * 05 37 14.3725083216 -69 06 32.514286140   15.66 15.57     O9.5IV 7 0
25 2MASS J05371503-6908428 LP* 05 37 15.032 -69 08 42.81   17.22 16.67 15.534   B0-0.5V-IIIe 6 0
26 VFTS 24 * 05 37 16.6757586120 -69 08 50.336175552   16.39 16.02     B0.2III-II 6 0
27 VFTS 25 * 05 37 16.9640705208 -69 07 54.404569560   16.24 16.18     B1-1.5V 5 0
28 VFTS 27 EB* 05 37 17.3637263472 -69 07 48.060672600   14.8 14.71   14.639 B1III-II 10 0
29 BI 250 s*b 05 37 17.8521060696 -69 09 46.206231516 13.00 13.72 13.48     B0.7IaNwk 11 0
30 VFTS 29 * 05 37 18.2880461760 -69 03 04.579956720   16.71 16.73     B1V 7 0
31 VFTS 30 * 05 37 18.7977973176 -69 02 13.031387520   16.44 16.34     B3-5e_sh 4 0
32 VFTS 31 * 05 37 20.4864091464 -68 59 52.219248792   16.41 16.41     B1.5V 6 0
33 VFTS 33 * 05 37 22.0440109800 -69 07 55.151263632   16.27 16.20     B1-1.5V 6 0
34 VFTS 34 * 05 37 22.3060575384 -69 07 16.091380236   16.27 16.14     B1.5Ve 7 0
35 VFTS 35 * 05 37 22.7522397384 -69 12 09.795051108   17.08 16.91     O9.5IIIn 7 0
36 VFTS 36 * 05 37 23.6157230616 -69 04 29.744335488   16.71 16.61     B1:Vn 6 0
37 VFTS 37 * 05 37 23.9368354800 -69 12 21.200402916   15.85 15.79     B2III: 6 0
38 VFTS 38 * 05 37 24.3314737992 -69 07 17.116779864   16.6 16.54     B1.5V 6 0
39 AL 367 Em* 05 37 24.6408302760 -69 09 52.873369956   14.548 14.27 14.38   B0:e 6 0
40 [ST92] 1-2 * 05 37 24.76 -69 08 28.9   16.95 17.0     B1V 8 0
41 VFTS 41 * 05 37 24.8791622424 -69 04 15.724309764   17.08 16.94     B2:V 6 0
42 2MASS J05372494-6907427 SB* 05 37 25.1169701784 -69 07 42.609047808   14.54 14.66     O9.5III((n)) 6 0
43 VFTS 43 * 05 37 25.840 -69 07 28.49   16.43 16.49     B2V(n) 5 0
44 VFTS 44 * 05 37 26.060 -69 07 29.29   16.55 16.62     B2V 6 0
45 [M2002] LMC 168287 * 05 37 26.1759211680 -69 09 53.015651676   14.78 14.9     O9.7II((n)) 10 0
46 UCAC2 1803179 SB* 05 37 26.1800988408 -69 08 56.514970536   15.68 15.5 15.48   O9.7Ib-IINwk 6 0
47 IRSF J05372654-6910406 SB* 05 37 26.5401366264 -69 10 40.671717600   17.19 16.91     O9V+O9.5V 6 0
48 VFTS 48 * 05 37 26.5522166016 -69 07 01.766169012   16.86 16.72     B1V 6 0
49 2MASS J05372687-6903444 SB* 05 37 26.9083389648 -69 03 44.118029880   16.18 16.07     O9.7V:+B 4 0
50 VFTS 50 * 05 37 27.430 -69 10 40.15   16.95 16.77     B0V 6 0
51 UCAC2 1803186 * 05 37 27.8242229208 -69 08 02.849917848 15.043 15.982 15.718 16.06 14.976 B1: 10 0
52 VFTS 52 * 05 37 28.8624420120 -69 07 06.453404472   14.48 14.55     B0.2III-II 7 0
53 VFTS 53 * 05 37 28.9080279024 -69 06 52.799448276   15.37 15.28     B1III 7 0
54 VFTS 54 * 05 37 29.0648572416 -69 13 03.882476064   16.81 16.60     B0V 5 0
55 2MASS J05372905-6903445 SB* 05 37 29.0671981968 -69 03 44.474463468   15.79 15.56     O8.5V+O9.5IV 6 0
56 2MASS J05372909-6908414 SB* 05 37 29.10 -69 08 41.4 15.786 16.517 16.238   15.519 O6.5V+O6.5V 6 0
57 UCAC2 1803197 SB* 05 37 30.0899641056 -69 09 50.927482908 14.946 15.692 15.578 16.09 15.403 O8.5:V+B 6 0
58 2MASS J05373039-6910004 SB* 05 37 30.3859090320 -69 10 00.469916940 15.681 16.443 16.333   16.191 O9.5III: 6 0
59 VFTS 60 * 05 37 30.610 -69 09 12.94   16.74 16.12     B1.5II-Ib((n)) 6 0
60 [M2002] LMC 168477 SB* 05 37 30.7455556488 -69 05 17.472184188   15.49 15.35 15.30 15.28 O8.5V+O9V 13 0
61 VFTS 62 * 05 37 30.8127771312 -69 03 21.862322388   16.42 16.27     B3III 5 0
62 OGLE LMC-ECL-20909 SB* 05 37 30.8750285400 -69 11 48.474490488   14.23 14.4 14.16 14.022 O5III(n)(fc)+sec 12 0
63 [ST92] 1-12 SB* 05 37 30.9164613960 -69 11 06.996589512 14.193 14.840 14.621 14.49 13.915 O7.5II(f) 13 0
64 VFTS 65 * 05 37 32.6135457336 -69 06 40.690202328   16.05 15.99     O8V(n) 9 0
65 2MASS J05373309-6904343 SB* 05 37 33.0871994376 -69 04 34.689561744   15.64 15.54     O9.5III(n) 12 0
66 VFTS 67 * 05 37 33.3460280640 -69 02 47.539689720   16.99 16.83     O9.5Vz 8 0
67 2MASS J05373352-6907140 LP* 05 37 33.5134646443 -69 07 14.051373437   16.42 16.114 13.999 13.960 B1-1.5e 9 0
68 [ST92] 1-17 * 05 37 33.7546954104 -69 08 13.185864312 13.069 13.832 13.616 13.52 12.990 B0.7Ib-Iab 10 0
69 VFTS 70 * 05 37 33.8839916640 -69 08 58.252499340   17.13 16.85     O9.7II 10 0
70 VFTS 71 * 05 37 34.2027186408 -69 06 39.237936192   16.68 16.65     B1:V 6 0
71 2MASS J05373447-6909095 SB* 05 37 34.4580100848 -69 09 09.407171268   16.52 16.3     O9.5III 8 0
72 BI 253 * 05 37 34.4595697440 -69 01 10.178659452 12.765 13.650 13.669   13.742 O2V(f*) 46 0
73 [M2002] LMC 168648 * 05 37 34.5467612016 -69 10 10.198572132 15.788 16.563 16.386   16.255 O9Vn 10 0
74 VFTS 75 * 05 37 34.6787081592 -69 07 13.286817372   16.96 16.93     B1V 7 0
75 UCAC2 1803216 * 05 37 34.7984254896 -69 08 01.272592572   15.43 15.4 15.50   O9.2III 9 0
76 2MASS6X J05373512-6909411 * 05 37 35.1305103288 -69 09 41.197258188 16.016 16.729 16.635   16.552 O9.5:IIIn 11 0
77 VFTS 78 * 05 37 35.4288891120 -69 07 57.088185348   16.84 16.63     B1V 6 0
78 Brey 70a WR* 05 37 35.7045940032 -69 08 40.251941520 17.387 17.957 16.924   16.324 WN4b/WCE 29 0
79 [ST92] 1-23 * 05 37 35.7366260592 -69 08 07.470126744 15.739 16.528 16.297   15.927 O9.7II-III((n)) 13 0
80 RM 1-703 s*r 05 37 35.9786637816 -69 12 29.804546160   15.68 13.732   11.695 K4Iab-Ib 20 0
81 VFTS 82 * 05 37 36.0828923664 -69 06 44.940578724   13.55 13.61     B0.5Ib-Iab 8 0
82 VFTS 83 * 05 37 36.3293476464 -69 05 01.108207428   16.01 15.91     B1.5V 6 0
83 VFTS 84 * 05 37 36.5074900416 -69 09 59.274059040   17.02 16.84     B1.5V 6 0
84 VFTS 85 * 05 37 36.5135291736 -69 01 41.310125328   16.4 16.48     B1.5V 6 0
85 2MASS J05373664-6907318 SB* 05 37 36.6560452584 -69 07 31.823879304   13.44 13.58     O9.7Ib-II 10 0
86 SSTISAGE1C J053736.75-690633.4 * 05 37 36.8142318840 -69 06 33.181769340   15.18 15.24     B 7 0
87 [ST92] 1-25 * 05 37 36.8661772008 -69 08 22.750483488 15.542 16.367 16.193   15.842 O6.5V((f))zNstr 12 0
88 2MASS J05373714-6910181 SB* 05 37 37.1420500124 -69 10 18.088475333 15.240 15.965 16.044   15.485 O9.5V 6 0
89 [ST92] 1-27 * 05 37 37.5250901184 -69 08 20.448772908 15.424 16.202 16.068   15.692 O9.5IIIn 12 0
90 2MASS J05373778-6905455 SB* 05 37 37.7976799560 -69 05 45.490683768   15.13 15.03     O8.5V+B0.2:V 10 0
91 [ST92] 1-28 LP* 05 37 37.9620597480 -69 10 14.736356688 13.515 14.211 14.161   13.713 O3.5Inf*p+sec? 15 0
92 2MASS J05373854-6910199 SB* 05 37 38.5076245200 -69 10 19.862759784 12.875 13.744 13.710   13.555 O6V((n))((fc))z 9 0
93 VFTS 95 * 05 37 38.5130215104 -69 06 04.424553252   16.04 16.06     B0.2V 8 0
94 [ST92] 1-31 * 05 37 38.7407975712 -69 10 27.582929544   16.37 16.4     B0IV 9 0
95 OGLE LMC-ECL-20975 SB* 05 37 38.7755677248 -69 08 08.607728940   15.22 15.4 15.18 14.853 O9III(n) 8 0
96 VFTS 99 * 05 37 38.7959639400 -68 58 31.797448464   16.75 16.78     B2-2.5V 4 0
97 VFTS 100 * 05 37 38.9109200640 -69 10 08.246615268   16.9 16.68     B1.5V 6 0
98 [ST92] 1-33 * 05 37 39.19 -69 08 40.9 16.025 16.832 16.528   15.907 B1V 8 0
99 UCAC2 1803231 * 05 37 39.2300701008 -69 09 51.026810616 15.220 16.099 15.806 16.07 15.118 O9:Vnnne+ 27 0
100 VFTS 103 * 05 37 39.2380021560 -69 11 34.344680064   16.67 16.20     O8.5III((f)) 8 0
101 IRSF J05373989-6905468 * 05 37 40.036 -69 05 47.41   16.19 16.20     O9.7II-III((n)) 10 0
102 VFTS 106 * 05 37 40.2053172336 -69 04 12.048970872   16.48 16.43     B0.2V 6 0
103 OGLE LMC-ECL-20987 SB* 05 37 40.248 -69 10 46.35 14.544 14.845 15.227   14.641 O8:Vz+O9-B0 9 0
104 VFTS 107 * 05 37 40.3961960520 -69 05 54.047971536   16.74 16.68     B1:V 5 0
105 HD 269883 WR* 05 37 40.4906298216 -69 07 57.672227892 13.454 14.184 14.077 14.03 13.492 WN7h 47 0
106 VFTS 109 * 05 37 40.6000 -69 07 59.993   16.53 16.6     O9.7II:n 12 0
107 VFTS 111 * 05 37 40.8636093408 -69 00 04.139322264   14.32 14.40     B2III 7 0
108 VFTS 110 * 05 37 40.870 -69 10 48.44   15.76 15.7     O6V((n))z 9 0
109 OGLE LMC-ECL-20994 EB* 05 37 40.8760898976 -69 04 41.458905588   16.27 16.19 16.18 15.905 B+B 10 0
110 2MASS J05374092-6908442 SB* 05 37 40.8984219744 -69 08 44.195706816 16.052 16.829 16.633   16.491 O9/B0 13 0
111 2MASS J05374112-6910378 SB* 05 37 41.13 -69 10 37.8 14.871 15.761 15.368   15.383 O8.5IV+sec 8 0
112 2MASS J05374144-6909191 SB* 05 37 41.4429166704 -69 09 19.129320828 15.904 16.542 16.534   16.165 O9.7:V:+B0:V: 8 0
113 VFTS 117 * 05 37 41.470 -69 10 46.96   16.82 16.64     O6:Vz 8 0
114 VFTS 118 * 05 37 41.5905819480 -69 08 08.651784048   16.41 16.21     B1IV 5 0
115 VFTS 119 * 05 37 41.7168067752 -69 07 28.140003156   16.43 16.36     B0.7V 8 0
116 OGLE LMC517.01.010105 SB* 05 37 41.9535967224 -69 08 33.392113548 14.195 14.985 14.917 15.09 14.749 (O9.2IV+B)+(O9.5V+O9.5V) 10 0
117 VFTS 121 * 05 37 42.2249912952 -69 07 14.317645296   16.02 15.96     B1IV 7 0
118 VFTS 123 * 05 37 42.4417713360 -69 12 21.454617888   15.88 15.78     O6.5Vz 9 0
119 [ST92] 1-46 * 05 37 42.59 -69 09 18.9 16.253 16.778 16.634   16.375 B2.5III 8 0
120 VFTS 122 Y*O 05 37 42.63 -69 09 43.6   16.77 16.53     B1.5V 9 0
121 VFTS 126 * 05 37 42.9468480888 -69 01 05.269337796   16.71 16.78     B1V 7 0
122 VFTS 125 * 05 37 42.950 -69 10 35.12   16.87 16.6     F5 10 0
123 VFTS 127 * 05 37 43.370 -69 10 45.91   17 16.93     B2:V(n) 5 0
124 [M2002] LMC 169061 * 05 37 43.4022516600 -69 09 58.995832716   16.32 16.5     O9.5III:((n)) 12 0
125 VFTS 130 * 05 37 43.6719086184 -69 10 50.403827568   16.83 16.67     O8.5V((n)) 8 0
126 VFTS 131 * 05 37 43.7448634800 -69 10 22.134748908   16.88 16.77     O9.7 9 0
127 [M2002] LMC 169093 * 05 37 43.9494523152 -69 09 39.019047516 14.784 15.983 15.780   15.890 O9.5Vz 10 0
128 VFTS 133 * 05 37 43.980 -69 06 34.41   16.01 16.03     B0.5V 5 0
129 VFTS 134 * 05 37 44.0707528152 -69 05 26.982443184   16.87 16.85     B1V(n) 6 0
130 VFTS 135 * 05 37 44.2046960256 -69 06 37.239549984   16.02 16.01     B1:V-IIIne 6 0
131 HD 269888 WR* 05 37 44.6348625936 -69 14 25.673976456 14.413 14.772 14.628 14.81 14.761 WR 46 0
132 [ST92] 1-55 * 05 37 44.7106026840 -69 09 18.236420784   16.96 17.1     B1V 8 0
133 VFTS 138 * 05 37 45.0373402296 -69 02 29.573819376   15.54 15.63     O9Vn 10 0
134 [M2002] LMC 169159 SB* 05 37 45.2423368512 -69 10 13.619941428 15.506 16.145 15.898   15.762 O8.5Vz 8 0
135 [ST92] 1-60 SB* 05 37 45.4999 -69 11 09.507   15.55 15.6     O3.5V((fc)) 6 0
136 VFTS 141 * 05 37 45.740 -69 09 13.33   15.36 15.32     O9.5II-III((n)) 12 0
137 [ST92] 1-58 * 05 37 45.8916437712 -69 10 21.982628208 15.790 16.327 16.167   15.944 O6:V 10 0
138 VFTS 144 * 05 37 46.080 -69 09 14.37   16.81 16.81     B0.7:V 6 0
139 VFTS 145 SB* 05 37 46.080 -69 09 08.85   14.49 14.30     O8fp 8 0
140 IRSF J05374609-6906349 * 05 37 46.089 -69 06 34.79   16.49 16.24     B2:V 6 0
141 VFTS 148 SB* 05 37 46.2776170224 -69 00 06.215586480   16 16.04     O9.7II-III(n) 6 0
142 [M2002] LMC 169203 * 05 37 46.3028428008 -69 08 20.685187824 15.863 16.667 16.570   16.316 O9.5V 11 0
143 Brey 73 WR* 05 37 46.3440 -69 09 09.360   12.222 12.11     WN6(h) 38 1
144 IRSF J05374638-6909120 SB* 05 37 46.410 -69 09 12.15   15.42 15.30     O9.5III 4 0
145 VFTS 151 SB* 05 37 46.520 -69 09 08.79           O6.5II(f)p 11 0
146 VFTS 152 * 05 37 46.6907186304 -69 06 19.531745532   15.57 15.32     B2IIIe 8 0
147 IRSF J05374670-6909112 ** 05 37 46.710 -69 09 11.27   15.36 15.30     O9III((n)) 8 0
148 VFTS 154 SB* 05 37 47.090 -69 09 07.70   14.99 14.94     O8.5V 9 0
149 VFTS 155 * 05 37 47.1686683296 -69 13 13.494158148   17.03 16.95     B0.7:V 6 0
150 [ST92] 1-64 * 05 37 47.187 -69 09 03.11 16.026 16.714 16.517   18.408 B1-1.5V-IIIe+ 7 0
151 OGLE LMC-ECL-21035 EB* 05 37 47.2298481168 -68 58 49.178631504   16.61 16.69   16.897 B2V 9 0
152 VFTS 158 * 05 37 47.4236846640 -69 04 12.669944664   15.53 15.33     B1-1.5Ve+ 6 0
153 VFTS 159 * 05 37 47.6644300608 -69 00 35.017993080   15.58 15.61     B2.5III 5 0
154 [ST92] 1-65 SB* 05 37 47.800 -69 09 14.86   14.2 14.3     O9.5III((n)) 9 0
155 VFTS 161 * 05 37 47.910 -69 10 41.13   16.93 16.69     B1V 6 0
156 VFTS 163 * 05 37 48.0572679792 -69 09 26.307512892   16.74 16.21     O8.5IV 6 0
157 VFTS 162 * 05 37 48.060 -69 09 59.88   16.56 16.49     B0.7V 6 0
158 [ST92] 1-67 * 05 37 48.1970422416 -69 09 31.481880912 16.419 17.330 16.931   15.845 B1: 8 0
159 [M2002] LMC 169297 s*b 05 37 48.330 -69 09 15.22   13.79 13.8     O9.7Iab 7 0
160 IRSF J05374838-6902376 * 05 37 48.3639336024 -69 02 37.596301368   17.09 16.93     B 6 0
161 VFTS 167 * 05 37 48.810 -69 09 15.88   16.08 16.07     B1V 7 0
162 VFTS 168 * 05 37 49.5088071792 -69 12 33.066475524   15.54 15.46     O8.5Vz 9 0
163 [M2002] LMC 169366 * 05 37 49.9179515328 -69 10 27.881673348 13.649 14.619 14.437   14.224 O2.5V(n)((f*)) 13 0
164 VFTS 170 * 05 37 49.9931174880 -69 07 42.084863184   16.18 16.03     B1IV 7 0
165 UCAC2 1803283 SB* 05 37 50.0080933152 -69 09 59.844759264 13.096 13.699 13.840 14.11 13.900 O7-8III((f)) 13 0
166 VFTS 172 SB* 05 37 50.130 -69 10 01.58           O9III((f)) 8 0
167 OGLE LMC-ECL-21065 SB* 05 37 50.3796811632 -69 08 54.320723196 15.945 16.541 16.499   15.698 B0V 9 0
168 2MASS J05375064-6908483 SB* 05 37 50.6498186520 -69 08 48.337452204   15.75 15.7     O8V+B0:V: 8 0
169 UCAC2 1803287 * 05 37 50.7792080760 -69 11 35.489519772   16.3 16.2 16.34   ~ 4 0
170 [ST92] 1-77 SB* 05 37 50.9567494224 -69 11 00.205458504   14.81 15.0   14.570 O6V:((f))+O9.5:V: 16 0
171 VFTS 177 * 05 37 51.0242378448 -69 06 10.523965860   14.87 14.63     O7n(f)p 8 0
172 TYC 9163-983-1 s*b 05 37 51.0380396088 -69 09 33.877581660   12.46 12.77 12.89   O9.7Iab 16 0
173 VFTS 179 * 05 37 51.180 -69 09 37.44   17.02 16.93     B1V 6 0
174 Brey 74a WR* 05 37 51.3386549880 -69 09 46.690186716 12.483 13.474 13.446 13.62 13.278 O3If* 36 0
175 VFTS 181 * 05 37 51.3820126800 -69 12 40.706699076   16.39 16.24     B0.5V 6 0
176 NGC 2060 SNR 05 37 51.4466169456 -69 10 23.947092084   9.69 9.59     ~ 360 2
177 VFTS 183 * 05 37 51.4956464784 -69 11 25.475373096   16.89 16.51     B0IV 8 0
178 2MASS J05375180-6904248 SB* 05 37 51.8212746648 -69 04 24.742740252   15.29 15.38     O6.5Vnz 6 0
179 [M2002] LMC 169451 * 05 37 51.9317264280 -69 09 20.752986060   14.52 14.7     O7.5III((f)) 10 0
180 VFTS 186 * 05 37 52.0288467648 -69 04 39.795502512   15.9 15.79     B1IV 6 0
181 UCAC2 1803297 SB* 05 37 52.1789378904 -69 11 31.277610384   16.03 16.0 15.87   O9IV:+B0:V: 8 0
182 VFTS 188 * 05 37 52.4000607504 -69 10 51.207128148   17.12 16.82     O9.7:III: 10 0
183 [ST92] 1-82 EB* 05 37 52.8461307480 -69 09 45.742922784   16.41 16.5 16.31 16.082 B2V 13 0
184 VFTS 190 * 05 37 53.2935364584 -69 12 57.234700512   14.63 14.67     O7Vnn((f))p 7 0
185 UCAC2 1803301 SB* 05 37 53.4138643128 -69 10 23.412117396   15.86 14.1 16.10   O9.5V 7 0
186 [ST92] 1-85 * 05 37 53.6407 -69 10 12.488   16.22 16.3     O9/B0 12 0
187 VFTS 194 * 05 37 54.1890607944 -69 05 46.108845456   16.2 16.08     B2V-IIIe+ 6 0
188 VFTS 195 * 05 37 54.2147858232 -69 05 17.800137492   16.92 16.86     B0.5V 6 0
189 VFTS 196 * 05 37 54.2673889992 -69 01 44.553678492   15.63 15.58     B2IIIe+ 5 0
190 UCAC2 1803303 SB* 05 37 54.4522145808 -69 09 41.528128392 12.897 13.591 13.702 13.92 13.631 O9III 10 0
191 VFTS 199 * 05 37 54.780 -69 00 24.99   16.9 16.91     B+B 5 0
192 [ST92] 1-89 * 05 37 54.9506040696 -69 10 12.502177356 14.265 14.944 14.634 15.00 14.599 B1/1.5IIIe+ 8 0
193 VFTS 203 * 05 37 55.010 -69 04 00.52   16.75 16.77     B1-1.5V 6 0
194 IRSF J05375503-6907022 * 05 37 55.043 -69 07 02.23   16.44 16.13     B2III 6 0
195 2MASS J05375504-6911323 SB* 05 37 55.047 -69 11 32.31   16.59 16.43     O9.7V+sec 7 0
196 2MASS J05375509-6908549 * 05 37 55.10 -69 08 55.0   16.29 16.4     B2V 9 0
197 [M2002] LMC 169602 * 05 37 55.3905740928 -69 10 20.796762936   15.9 16.1     O9/B0 12 0
198 OGLE LMC-DPV-105 EB* 05 37 55.4370019560 -68 57 06.896003616   15.14 15.019   14.841 B3III: 9 0
199 [M2002] LMC 169636 * 05 37 56.0835089160 -69 10 38.928487044   16.31 16.4     O9.7II((n)) 12 0
200 [ST92] 1-93 SB* 05 37 56.2196557176 -69 11 50.770677732 14.388 15.069 14.798 14.72 14.239 O6Iafnp 13 0
201 VFTS 209 * 05 37 56.5913287992 -69 03 48.568296708   16.27 16.33     B1V 7 0
202 UCAC2 1803310 * 05 37 56.9571850848 -69 08 21.159271104   15.6 15.8 15.95   O9.7II-III((n)) 11 0
203 VFTS 211 * 05 37 57.3344071992 -68 58 41.762517024   16.44 16.56     B1V 6 0
204 OGLE LMC517.01.010101 EB* 05 37 57.8861608800 -69 08 48.770830140 14.469 15.276 15.288 15.73 15.310 B1III 9 0
205 UCAC2 1803313 * 05 37 57.9546918576 -69 09 54.001830564 14.442 15.385 15.182 15.98 15.422 B2V 9 0
206 VFTS 214 * 05 37 58.0064935488 -69 13 09.484140720   16.11 15.84     B0IV-III 8 0
207 OGLE LMC-ECL-21128 EB* 05 37 58.0423205952 -69 02 23.428009212   16.55 16.58   16.612 B1.5V 10 0
208 UCAC2 1803316 * 05 37 59.0526663864 -69 11 56.710162752 13.935 14.655 14.389 14.49 14.035 O4V((fc)) 11 0
209 [ST92] 1-98 SB* 05 37 59.4838149312 -69 09 01.664931960   13.68 13.744 13.90 13.711 O4V((fc)):+O5V((fc)): 18 0
210 UCAC2 1803321 * 05 37 59.7137535144 -69 11 14.202662964   16.01 15.8 16.01   B1.5V 7 0
211 VFTS 219 * 05 37 59.8092973272 -69 03 35.406008496   16.97 16.93     B3-5V-III 7 0
212 NAME 30 Dor Region reg 05 38.0 -69 06           ~ 236 0
213 VFTS 220 * 05 38 00.3900894432 -69 08 27.780844128   16.69 16.66     B0.7V 6 0
214 VFTS 221 * 05 38 00.4174273824 -69 03 45.692362404   16.19 16.27     B1V 6 0
215 UCAC2 1803324 SB* 05 38 00.6042085320 -69 08 41.807071032   14.72 14.8 15.15   O9.5IV 10 0
216 VFTS 224 * 05 38 00.8260249440 -69 03 59.693939712   16.13 16.02     B1-2V-IIIe+ 5 0
217 2MASS J05380096-6857229 SB* 05 38 00.9591156384 -68 57 23.170474116   15.06 15.07     B0.7III 8 0
218 VFTS 226 * 05 38 00.9962944176 -69 14 21.675036768   15.89 15.92     O9.7III 11 0
219 VFTS 227 * 05 38 01.310 -69 03 13.91   16.42 16.51     B2V 6 0
220 VFTS 228 * 05 38 01.6947648336 -69 01 34.764665304   16.42 16.46     B0.7V 6 0
221 VFTS 229 * 05 38 02.9499036264 -69 02 19.109899788   16.48 16.48     B1.5Vn 6 0
222 VFTS 230 * 05 38 04.4221359072 -69 07 57.826863588   17.03 16.59     B1.5III 5 0
223 2MASS J05380470-6908530 SB* 05 38 04.7037336024 -69 08 52.884701448   16.29 16.4     O9.7V+B1.5:V 8 0
224 [ST92] 1-104 s*b 05 38 04.7673520584 -69 09 05.433701724 14.473 14.945 14.598 14.55 13.882 B3Ia 9 0
225 VFTS 233 * 05 38 04.8187902672 -69 11 22.388956872   16.63 16.40     B1-2V-IIIe 7 0
226 VFTS 234 * 05 38 06.2866250328 -69 06 52.892779716   16.33 16.22     B1.5V 6 0
227 VFTS 235 * 05 38 06.3511926552 -69 05 14.263478160   15.42 15.48     O9.7III 7 0
228 IRSF J05380673-6909324 * 05 38 06.539 -69 09 32.75   16.43 16.41     B1V 6 0
229 VFTS 237 * 05 38 06.630 -69 14 06.96   15.99 15.93     B1-1.5V-IVe 7 0
230 VFTS 238 * 05 38 06.6713579760 -69 03 59.168849724   16.83 16.84     B2.5V 5 0
231 OGLE LMC-ECL-21179 EB* 05 38 06.773 -69 06 08.62   15.86 15.85   16.208 B1-2V(SB2) 9 0
232 VFTS 241 * 05 38 07.0837970928 -69 04 14.659385844   16.62 16.65     B0IV 8 0
233 VFTS 242 * 05 38 07.8308612520 -69 00 57.006463392   16.86 16.82     B0IV 8 0
234 2MASS J05380840-6909190 SB* 05 38 08.4066684408 -69 09 18.975749724   15.47 15.26     O7V(n)((f)) 19 0
235 2MASS J05380840-6905446 SB* 05 38 08.4091730688 -69 05 44.487386376   13.94 14.04     O5III(n)(fc) 8 0
236 VFTS 246 * 05 38 08.8550623056 -69 10 39.926815464   17.28 16.83     B1III 6 0
237 VFTS 247 * 05 38 08.8970611800 -69 08 16.835168220   16.9 16.88     B2V 6 0
238 OGLE LMC-ECL-21192 EB* 05 38 09.3074914536 -69 10 14.199297780   16.49 16.49   16.406 B2:V 9 0
239 VFTS 249 * 05 38 09.5612541480 -69 06 53.958104460   15.49 15.52     O8Vn 9 0
240 2MASS J05380995-6902310 * 05 38 09.957 -69 02 31.06   15.33 15.46     O8.5Vz 9 0
241 VFTS 251 * 05 38 10.2345758376 -69 05 04.688601900   15.57 15.62     O9.5IV 7 0
242 VFTS 250 * 05 38 10.2366624600 -69 08 56.388055200   15.76 15.74     O9.2V((n)) 8 0
243 VFTS 253 * 05 38 10.3768374360 -69 14 33.697674348   15.22 15.18     O9.5II 7 0
244 VFTS 254 * 05 38 10.4240729544 -69 05 17.617187904   16.93 16.90     B1-2Ve 6 0
245 OGLE LMC-ECL-21204 EB* 05 38 11.05 -69 07 19.6   16.7 16.68   16.345 B2:V 9 0
246 2MASS J05381132-6904492 SB* 05 38 11.3076355656 -69 04 49.214979948   14.92 15.02     O7.5-8V((n))z 6 0
247 VFTS 257 * 05 38 11.3943590760 -69 14 24.567809064   16.66 16.70     B0.7-1.5V 6 0
248 VFTS 258 * 05 38 11.5680769224 -69 11 42.337341132   16.44 16.34     B1.5V 6 0
249 VFTS 259 s*b 05 38 12.0226241304 -69 06 34.169386572   13.86 13.65     O6Iaf 10 0
250 TYC 9163-958-1 s*b 05 38 12.3336915120 -69 00 57.321760932   12.32 12.52     B5Ia 7 0
251 VFTS 263 * 05 38 12.5490743832 -69 03 51.780260340   16.85 16.80     B 5 0
252 VFTS 265 * 05 38 12.9281018688 -69 05 14.686578528   16.23 16.05     ~ 2 0
253 VFTS 266 * 05 38 13.2874135776 -69 11 18.911454360   15.5 15.38     O8V((f))z 8 0
254 2MASS J05381396-6907477 SB* 05 38 13.9613816664 -69 07 47.728274376   13.44 13.49     O3III-I(n)f* 15 0
255 OGLE LMC-LPV-76162 LP* 05 38 14.733 -69 03 29.51   16.76 17.122   15.408 B1.5Ve+ 9 0
256 RMC 132 s*b 05 38 14.8983550488 -69 03 48.518049456   12.95 12.90 13.00 12.66 B0.5Ia 21 1
257 [HBC93] 256 * 05 38 15.140 -69 04 01.18   14.28 14.35     B3Ib 11 0
258 VFTS 272 Be* 05 38 15.590 -69 04 02.22   15.99 16.00     B3:IIIe+_sh? 6 0
259 VFTS 273 * 05 38 15.6098074512 -69 12 12.077937432   16.77 16.74     B2.5V 7 0
260 VFTS 274 * 05 38 15.8586346416 -69 09 31.477327776   16.93 16.94     B1V(n) 6 0
261 H88 301 Cl* 05 38 16 -69 04.0   11.18 10.89     ~ 74 0
262 VFTS 276 Be* 05 38 16.000 -69 03 54.72   15.71 15.84     B1.5V 6 0
263 2MASS J05381611-6909168 SB* 05 38 16.0997305224 -69 09 16.669625616   15.05 15.04     O9V 6 0
264 VFTS 278 * 05 38 16.210 -69 04 04.01   16.75 16.82     B2.5V 6 0
265 VFTS 279 Be* 05 38 16.440 -69 03 51.15   16.78 16.73     B2:Ve+ 7 0
266 VFTS 280 * 05 38 16.5491532984 -69 04 53.193397620   15.4 15.40     O9V((n)) 8 0
267 [GC2000] Be7 Be* 05 38 16.840 -69 03 57.17   16.05 16.11     B3-5III(n)e 7 0
268 VFTS 283 Be* 05 38 16.9995 -69 03 49.010   15.3 15.31     B1.5V-III(n)e 13 0
269 IRSF J05381724-6909110 * 05 38 17.195 -69 09 11.82   16.82 16.84     B1V 7 0
270 VFTS 285 * 05 38 17.3293080024 -69 05 42.046651680   15.57 15.63     O7.5Vnnn 18 0
271 IRSF J05381734-6904479 * 05 38 17.333 -69 04 47.81   15.75 15.83     B0.7V 6 0
272 VFTS 287 Be* 05 38 17.350 -69 03 56.48   16.5 16.58     B2.5Vne 7 0
273 VFTS 288 * 05 38 17.5834874280 -69 07 24.152363472   16.71 16.58     B2.5III:n 6 0
274 VFTS 290 * 05 38 17.7079072776 -69 05 45.805759872   15.71 15.67     O9.5IV 8 0
275 [HBC93] 275 * 05 38 17.7214649592 -69 03 38.550007728   14.97 14.85     B5II-Ib 13 0
276 VFTS 292 * 05 38 17.780 -69 03 55.90   16.33 16.47     B2.5V(n) 5 0
277 [HBC93] 250 Be* 05 38 17.9993 -69 04 07.989   14.91 14.731   14.488 B2III-II(n)e 13 0
278 VFTS 295 * 05 38 18.2432869512 -68 57 26.184207564   16.26 16.33     B0-0.5V 6 0
279 VFTS 296 * 05 38 18.2696419104 -69 11 06.342572508   15.44 15.45     B2III 5 0
280 IRSF J05381841-6903517 * 05 38 18.370 -69 03 52.03   16.68 16.64     B1.5V 7 0
281 VFTS 298 * 05 38 18.4798996392 -69 09 20.405444076   16.92 16.68     B1-2V-IIIe+ 8 0
282 VFTS 299 * 05 38 18.5114887416 -69 12 28.014118668   16.31 16.36     B0.5V 6 0
283 VFTS 300 * 05 38 18.5763632256 -69 01 51.905116848   16.38 16.41     B1-2Vn 6 0
284 VFTS 301 Be* 05 38 18.840 -69 03 59.64           B2:Ve+ 7 0
285 VFTS 302 * 05 38 18.9940553448 -69 11 12.708596796   15.85 15.53     B1.5Ib 7 0
286 2MASS J05381905-6906346 ** 05 38 19.058 -69 06 34.68   15.39 15.39     O9.5IV 7 0
287 VFTS 304 * 05 38 19.1159873280 -69 04 58.121868252   15.86 15.94     O9.7III 7 0
288 VFTS 305 * 05 38 19.2145501848 -68 57 37.383193944   16.49 16.59     B2:V 6 0
289 Cl* NGC 2070 MEL 80 * 05 38 19.2539956920 -69 06 00.530661852   14.11 14.08     O8.5II((f)) 13 0
290 SK -68 136 * 05 38 19.2964363824 -68 57 15.697546776   13.5 13.6     B1II-Ib 8 0
291 VFTS 308 * 05 38 19.4123355672 -69 04 03.086366376   15.87 15.88     B2V 7 0
292 2MASS J05381969-6904104 * 05 38 19.7616290040 -69 04 10.424488008   16.19 16.19     B2V-III 7 0
293 VFTS 310 * 05 38 19.8433562592 -69 03 52.359988104   16.94 16.91     O9.7V: 8 0
294 VFTS 313 * 05 38 20.3765630928 -69 06 22.759874712   16.39 16.32     B0IV 9 0
295 OGLE LMC-ECL-21259 SB* 05 38 20.4178484496 -69 03 10.351201464   16.09 16.06   15.972 O9.7V(n)+B 10 0
296 VFTS 315 * 05 38 20.5973701080 -69 15 37.808867340   14.84 14.81     B1Ib 9 0
297 VFTS 316 * 05 38 20.870 -69 06 17.24   16.05 15.97     O9.7V: 7 0
298 IRSF J05382093-6912001 SB* 05 38 20.9278392408 -69 12 00.113313240   16.49 16.56     O9.5V+O9.2V 6 0
299 2MASS J05382113-6906169 * 05 38 21.131 -69 06 17.00   16.34 16.11     B1-2V-IIIe+ 7 0
300 VFTS 321 * 05 38 21.3283092984 -69 07 51.173061132   16.86 16.89     B1:V 6 0
301 [P93] 6 * 05 38 21.605 -69 03 14.27   16.93 16.76     B1.5-2Ve+ 6 0
302 VFTS 324 * 05 38 21.8848842576 -69 12 48.006130068   15.4 15.53     B0.2V 6 0
303 OGLE LMC-ECL-21273 EB* 05 38 21.9705770832 -69 06 00.006744276   16.81 16.84   16.772 B1V 9 0
304 VFTS 326 * 05 38 22.2689710800 -69 08 07.861723656   16.47 16.53     B1-2Vn 6 0
305 2MASS J05382227-6907508 SB* 05 38 22.2707420160 -69 07 50.815159752   15.34 15.33     O8.5V(n)+sec 11 0
306 VFTS 328 * 05 38 22.3263877824 -69 13 15.224179152   15.79 15.90     O9.5III(n) 12 0
307 2MASS J05382240-6905216 SB* 05 38 22.4298085176 -69 05 21.309089388   15.55 15.55     O9.7II-III(n) 6 0
308 VFTS 330 * 05 38 22.7044050072 -69 09 41.802273000   16.32 16.14     B2III(n)e 5 0
309 VFTS 331 * 05 38 23.2791994800 -69 12 54.018144396   16.65 16.71     B1.5V 7 0
310 Cl* NGC 2070 MEL 70 SB* 05 38 23.3085155424 -69 07 16.083034932 13.332 14.261 14.169   14.051 O9III+O9.2V 17 0
311 RMC 133 SB* 05 38 23.7090122184 -69 05 03.562237032   12.43 12.49     O7/8II 29 0
312 VFTS 334 * 05 38 24.0315345240 -69 05 23.998867944   16.2 16.26     B0.7V 6 0
313 VFTS 335 * 05 38 24.2998912560 -69 06 28.105203060   16.47 16.29     B2.5III 5 0
314 OGLE LMC-ECL-21300 EB* 05 38 25.5877814064 -69 06 09.243945288   15.92 15.92   15.882 B1V 9 0
315 [P93] 76 * 05 38 25.6084915440 -69 06 04.312612476 15.263 16.167 16.142   15.750 O9?V: 8 0
316 VFTS 338 * 05 38 26.2021544784 -69 03 38.779441200   17.3 16.82     ~ 2 0
317 2MASS J05382624-6905019 * 05 38 26.2236311952 -69 05 01.819277844 13.996 14.810 14.826   14.992 O9.5IV(n) 9 0
318 VFTS 340 * 05 38 26.5679451360 -69 05 31.618293576   17.13 16.89     B0.7V 6 0
319 VFTS 342 * 05 38 26.8745568624 -69 04 17.847481512   16.9 16.94     B1V 7 0
320 Dor IRS 27 * 05 38 27.0448844328 -69 04 46.593366384   16.49 16.45     B1-1.5V 7 0
321 2MASS J05382742-6908094 SB* 05 38 27.4126577928 -69 08 09.396207960   15.54 15.57     O9.7III(n) 6 0
322 VFTS 346 * 05 38 27.7594157040 -69 06 06.720873876   16.37 16.30     O9.7III 10 0
323 VFTS 347 * 05 38 27.8044188000 -69 05 27.231624204   16.69 16.68     B0V 8 0
324 [P93] 118 * 05 38 27.8206841952 -69 03 36.601598556   16.31 16.27     B0.7V 6 0
325 VFTS 349 * 05 38 27.9987740904 -69 04 09.390802728   16.47 16.50     B1V 6 0
326 2MASS J05382805-6906290 SB* 05 38 28.0597550112 -69 06 29.059975296   15.07 14.95     O8V 13 0
327 VFTS 351 * 05 38 28.4024386440 -69 06 40.905284256   16.06 15.98     B0.5V 6 0
328 OGLE BRIGHT-LMC-ECL-9 SB* 05 38 28.4561494056 -69 11 19.130738892   14.28 14.485   14.385 O4.5V(n)((fc)):z:+O5.5V(n)((fc)):z: 36 0
329 VFTS 353 * 05 38 28.5414144168 -69 07 51.192863904   16.73 16.60     B2V-III 7 0
330 VFTS 354 * 05 38 28.550 -69 04 32.52   15.91 15.91     B0.5:Vn 5 0
331 2MASS J05382913-6857393 SB* 05 38 29.1463260480 -68 57 39.327666624   13.93 14.12     O4V((n))((fc))z 9 0
332 VFTS 356 * 05 38 29.2080602160 -69 09 13.771421856   16.03 15.87     O6:V(n)z 10 0
333 [P93] 158 * 05 38 29.3787707760 -69 08 50.456769180   16.87 16.87     B0.5:V 8 0
334 VFTS 359 * 05 38 29.390 -69 05 59.19   16.33 16.30     B0.5V 6 0
335 Cl* NGC 2070 SMB 107 * 05 38 29.4292054848 -69 05 21.207909696   14.99 14.80     O9.7 11 0
336 Cl* NGC 2070 SMB 216 * 05 38 29.4837727104 -69 06 20.564087256   15.84 15.82     O8.5V 13 0
337 VFTS 362 * 05 38 29.540 -69 05 30.88   17.42 16.98     B1-3V-III 3 0
338 2MASS J05382998-6859331 Y*? 05 38 29.99 -68 59 33.2   16.22 16.24     B2V 7 0
339 Cl* NGC 2070 MEL 60 * 05 38 29.9917123464 -69 05 05.218516212   14.81 14.88     B0.2III-II 12 0
340 OGLE LMC-ECL-21330 EB* 05 38 30.08 -69 08 27.6   16.85 16.82   16.702 B2.5:V 9 0
341 VFTS 366 * 05 38 30.110 -69 04 44.55   16.81 16.83     B1-1.5V 6 0
342 [P93] 207 * 05 38 30.2789999496 -69 03 52.788203064   15.88 15.92     B1-2Vn 7 0
343 OGLE LMC-ECL-21335 EB* 05 38 30.4068992808 -69 05 29.553064656   16.69 16.68   16.495 B1-3V 9 0
344 VFTS 369 * 05 38 30.610 -69 08 24.44   16.81 16.66     O9.7V 9 0
345 [P93] 222 * 05 38 30.740 -69 08 27.13   15.69 15.74     O9.7III 13 0
346 2MASS J05383107-6904271 SB* 05 38 31.0497510360 -69 04 27.120265716   15.44 15.47     O9.5V(n)+sec 5 0
347 [PVL2015] 5 * 05 38 31.2271810656 -69 05 53.040271128   15.34 15.25     O9.5n 12 0
348 OGLE LMC553.25.029379 EB* 05 38 31.26 -69 05 57.0   16.55 16.36   15.991 B0V(n) 7 0
349 Cl* NGC 2070 SMB 275 * 05 38 31.6318961496 -69 05 27.031712388   16.22 16.20   16.32 B0.5:V 7 0
350 Cl* NGC 2070 SMB 297 * 05 38 31.660 -69 05 48.99   16.37 16.33   16.40 B1:V 10 0
351 Cl* NGC 2070 SMB 418 * 05 38 31.780 -69 05 56.73   16.94 16.83   16.87 B0-0.5V 7 0
352 VFTS 378 * 05 38 31.9064823480 -69 05 32.744621760   17.24 16.98     B1.5:V 3 0
353 IRSF J05383202-6902525 * 05 38 32.0134317528 -69 02 52.570734504   16.22 16.18     O6-7Vz 8 0
354 [P93] 280 * 05 38 32.120 -69 04 31.83   16.18 16.11     B1.5V 6 0
355 Cl* NGC 2070 SMB 226 * 05 38 32.280 -69 05 44.57   16.02 15.88   15.74 O4-5V((fc))z 10 0
356 [P93] 284 * 05 38 32.3212256520 -69 07 32.230115940   16.3 16.10     B0.5:V 7 0
357 [P93] 287 * 05 38 32.3255277144 -69 07 35.924055924   17.21 16.72     B0V-III 8 0
358 Cl* NGC 2070 SMB 84 SB* 05 38 32.34 -69 05 23.7   14.65 14.65   14.79 O4-5V((n))((fc)) 15 0
359 Cl* NGC 2070 MEL 58b SB* 05 38 32.540 -69 04 32.02   14.95 14.75     O9IV(n) 10 0
360 IRSF J05383262-6857140 * 05 38 32.600 -68 57 13.86   15.68 15.58     B1-2IIIe+ 5 0
361 Cl* NGC 2070 MEL 58 * 05 38 32.600 -69 04 32.27 12.123 13.084 12.916   13.727 O9.5IV 14 0
362 IRSF J05383263-6903559 El* 05 38 32.6376412536 -69 03 55.980293580   16.48 16.42   16.610 B0.5V 10 0
363 2MASS J05383279-6903195 SB* 05 38 32.7931547640 -69 03 19.551742452   15.63 15.49     O5-6V(n)((fc))z 10 0
364 Cl* NGC 2070 SMB 287 * 05 38 32.800 -69 05 24.92   16.3 16.32   16.48 B0.5:V 8 0
365 Cl* NGC 2070 SMB 268 * 05 38 32.8125834864 -69 05 44.633917968   16.23 16.10   15.91 O6-7V((f))z 11 0
366 Cl* NGC 2070 SMB 131 * 05 38 33.0028187424 -69 05 13.113134844   15.2 15.26   15.47 O9.5(n) 12 0
367 VFTS 394 * 05 38 33.0326239992 -69 02 43.137096000   16.9 16.93     B0.7V 6 0
368 VFTS 395 * 05 38 33.200 -69 04 51.36   16.77 16.95     B1:e 4 0
369 VFTS 396 * 05 38 33.2734909776 -69 10 23.964017916   16.43 16.32     B0.5V 6 0
370 [P93] 338 * 05 38 33.3535638504 -69 04 17.069069244   16.69 16.68     B1-2V 7 0
371 Cl* NGC 2070 MEL 59a SB* 05 38 33.3929037648 -69 04 38.358902208   14.37 14.40     O5.5V((n))((f))z 11 0
372 VFTS 399 * 05 38 33.4086616272 -69 11 59.023230396   15.91 15.83     O9IIIn 14 0
373 OGLE LMC553.25.029400 EB* 05 38 33.54 -69 05 21.7   15.99 16.03   15.915 O9.7 13 0
374 VFTS 401 * 05 38 33.5938437360 -68 56 05.788158324   15.65 15.48     B1-2IIIe+ 5 0
375 RMC 135 WR* 05 38 33.6193296576 -69 04 50.510501688   12.63 13.48     WN7h+OB 59 0
376 Cl* NGC 2070 SMB 401 * 05 38 33.8195370624 -69 05 51.867311892   16.87 16.74   16.63 O9.5:n 11 0
377 VFTS 403 * 05 38 33.820 -69 04 36.17   17.31 17.12     B1-2V 5 0
378 2MASS J05383381-6909569 SB* 05 38 33.8293150320 -69 09 57.071648844   14.16 14.14     O3.5V(n)((fc)) 7 0
379 Cl* NGC 2070 MEL 55 * 05 38 33.9752868864 -69 04 21.233349732 13.198 14.245 14.274   13.858 O6Vnn 13 0
380 Cl* NGC 2070 SMB 466 * 05 38 34.460 -69 06 14.49   17.05 16.97   16.33 B0.5:V 6 0
381 VFTS 408 * 05 38 34.4716301232 -69 01 39.711716364   16.34 16.32     B 6 0
382 Cl* NGC 2070 SMB 228 SB* 05 38 34.5683827800 -69 06 52.776564948   16.34 15.75   15.23 O4V((f))z 9 0
383 2MASS J05383469-6906061 Y*O 05 38 34.5944689488 -69 06 05.909627448   16.79 16.03   15.49 O7-8V 16 0
384 OGLE LMC-LPV-76549 LP* 05 38 34.76 -69 04 50.3   16.93 17.039   15.316 O9.7 12 0
385 VFTS 411 * 05 38 34.7833189944 -69 05 00.559069188   16.84 16.93     B1-3V-III 3 0
386 VFTS 413 * 05 38 34.9004158752 -68 58 45.409420272   16.5 16.48     B2V 6 0
387 Cl* NGC 2070 SMB 430 * 05 38 35.2348121664 -69 05 12.175969164   16.92 16.89   16.97 B1-3V-III 7 0
388 [P93] 466 SB* 05 38 35.4826020288 -69 04 57.701868312   15.38 15.48     O9.5V 6 0
389 Cl* NGC 2070 SMB 93 * 05 38 35.590 -69 06 06.58   14.77 14.67   14.29 ~ 4 0
390 Cl* NGC 2070 SMB 204 * 05 38 35.6590587360 -69 06 17.495570196   15.85 15.51   14.82 B2Ib 7 0
391 [P93] 473 * 05 38 35.7404391000 -69 08 19.741896312   16.33 16.12     O5V((n))((fc))z 10 0
392 Cl* NGC 2070 SMB 158 * 05 38 35.9099696424 -69 05 34.995461100   15.49 15.40   15.44 O9:V(n) 16 0
393 Cl* NGC 2070 MEL 54 s*b 05 38 35.9491 -69 06 09.195   13.27 13.02   12.60 B0.5IaNwk 15 0
394 Cl* NGC 2070 SMB 140 SB* 05 38 35.9954763336 -69 06 16.948926828   15.38 15.14   14.58 O4III(f) 9 0
395 VFTS 421 * 05 38 35.9982965472 -69 04 20.709175440   16.38 16.42     B2:V 6 0
396 NAME 30 Dor Nebula SFR 05 38 36.0 -69 05 11           ~ 1190 2
397 Cl* NGC 2070 MEL 52 * 05 38 36.0550753608 -69 06 46.549165104   13.94 13.51   12.95 B1Ia:Nwk 14 0
398 RMC 138 sg* 05 38 36.1321603320 -69 05 57.971373360   12.07 11.74   11.45 A0Ia 30 0
399 OGLE LMC553.25.029502 EB* 05 38 36.18 -69 06 05.8   16.56 16.50   16.165 B0.5:V 9 0
400 [P93] 511 * 05 38 36.3322901520 -69 04 48.666267156   17.1 17.04     B1.5V 6 0
401 Brey 81 WR* 05 38 36.4071127800 -69 06 57.534295248   14.02 13.76   12.80 WN8 34 0
402 2MASS J05383650-6903509 * 05 38 36.5097147624 -69 03 51.199131528   16.2 16.19     B0.5V 7 0
403 Cl* NGC 2070 MEL 57 SB* 05 38 36.8560614720 -69 04 58.321196184   14.58 14.69     O7.5-8V 14 0
404 [P93] 538 s*b 05 38 36.8574625728 -69 06 46.152663408   15.75 15.11   14.19 B0.5Ia+((n))Nwk 12 0
405 RMC 137 s*b 05 38 36.9624548664 -69 05 07.874900232   12.12 12.02   12.05 B1Ia 31 0
406 Cl* NGC 2070 SMB 214 * 05 38 37.0318681272 -69 06 50.756238972   15.9 15.65   15.21 O8-9V(n)((f)) 11 0
407 VFTS 433 * 05 38 37.090 -69 05 48.84   16.92 16.87     B1-3V-III 3 0
408 [P93] 566 * 05 38 37.115 -69 07 05.22   17.39 16.86     O7-8V 6 0
409 VFTS 434 * 05 38 37.2321308136 -69 04 26.087081772   16.29 16.13     B1.5:V 5 0
410 Cl* NGC 2070 SMB 209 * 05 38 37.360 -69 05 21.23   15.87 15.92   16.30 O7-8V 9 0
411 [P93] 591 * 05 38 37.5728568072 -69 04 37.491567708   17.06 16.99     B1-3V 3 0
412 Cl* NGC 2070 MEL 47 SB* 05 38 37.718 -69 05 20.97 11.913 12.764 12.046   12.344 O6-6.5II(f) 20 0
413 IRSF J05383782-6903290 SB* 05 38 37.810 -69 03 28.93   15 15.07     O9.5V 11 0
414 VFTS 442 * 05 38 37.890 -69 03 36.76   16.74 16.66     B1-2V 5 0
415 Cl* NGC 2070 SMB 97 SB* 05 38 37.93 -69 05 42.9   14.85 14.75   14.69 O3-4V:((fc)):+O4-7V:((fc)): 13 0
416 Cl* NGC 2070 SMB 208 SB* 05 38 37.9834 -69 06 15.183   15.89 15.71   15.17 O7:V(n):+O7:V(n): 8 0
417 Cl* NGC 2070 SMB 233 * 05 38 38.020 -69 05 08.58   16.04 16.13   16.41 O9.7 12 0
418 Cl* NGC 2070 SMB 194 * 05 38 38.260 -69 06 17.29   15.82 15.47   15.00 OV((f))nn 9 0
419 IRSF J05383834-6902275 * 05 38 38.287 -69 02 27.85   15.64 15.79     B2V 7 0
420 Cl* NGC 2070 SMB 886 * 05 38 38.340 -69 06 44.96   17.18 16.85   16.74 B1-3V 6 0
421 Cl* NGC 2070 SMB 428 * 05 38 38.360 -69 05 08.07   16.94 16.91   17.22 B1-2V 8 0
422 Cl* NGC 2070 MEL 50 SB* 05 38 38.4788632824 -69 06 22.016378160   13.80 13.655   13.314 O9.7III:+O7:: 26 0
423 Cl* NGC 2070 SMB 346 * 05 38 38.520 -69 06 29.92   16.62 16.25   15.54 O9:III:(n) 12 0
424 VFTS 452 * 05 38 38.7305916456 -69 12 32.723634852   16.4 16.44     B1-2V 6 0
425 OGLE LMC175.3 24041 SB* 05 38 38.75 -69 06 13.1   14.99 14.84   14.549 O5:V:n 17 0
426 [P93] 668 * 05 38 38.7646538568 -69 04 12.398247120   15.28 15.31     B0.5V 10 0
427 OGLE LMC175.4 54 EB* 05 38 38.82 -69 05 25.5   15.59 15.46   15.123 Onn 14 0
428 BAT99 97 WR* 05 38 38.8401788208 -69 06 49.549699584   14.23 13.74   13.20 O3.5If*/WN7 29 0
429 HTR 13 s*b 05 38 38.8639050936 -69 08 14.584145604 12.623 13.114 12.516 12.10 10.440 BN6Iap 18 0
430 [P93] 684 * 05 38 38.9566589472 -69 03 12.178792656   16.4 16.39     B2V 8 0
431 Cl* NGC 2070 SMB 278 SB* 05 38 38.9890769376 -69 06 58.953615192   16.3 15.86   15.11 O7.5V+O7.5V 10 0
432 Cl* NGC 2070 SMB 303 * 05 38 39.150 -69 05 05.75   16.25 16.83   16.79 B1.5V 7 0
433 OGLE LMC-ECL-21405 EB* 05 38 39.229 -69 01 40.69   15.75 16.27 16.20 16.048 B0.5/0.7V 9 0
434 Cl* NGC 2070 MH 13 * 05 38 39.250 -69 06 01.13   16.89 16.92   16.66 B0.7-1.5V 7 0
435 Cl* NGC 2070 SMB 365 * 05 38 39.2702170272 -69 06 39.020203332   16.92 16.38   15.36 O5:Vn 14 0
436 [P93] 702 * 05 38 39.280 -69 05 52.69   16.78 16.80     O9.5: 8 0
437 [P93] 696 * 05 38 39.2824305168 -69 07 52.995365580 15.253 15.843 15.567   15.039 O9III 11 0
438 OGLE LMC-RRLYR-20781 RR* 05 38 39.33 -69 15 35.0   17.29 16.971   16.376 B1-2Ve+ 9 0
439 Cl* NGC 2070 MH 17 * 05 38 39.3750 -69 06 06.312   14.63 14.59   13.92 O2V((f*))+OB 21 0
440 VFTS 469 * 05 38 39.4166227056 -69 03 07.722409968   16.09 16.09     B0V 7 0
441 VFTS 471 * 05 38 39.490 -69 02 30.84   16.26 16.36     B1V 6 0
442 2MASS J05383950-6904383 * 05 38 39.5051889648 -69 04 38.702155080   15.38 15.46     O6:V((f))z 12 0
443 [P93] 712 * 05 38 39.5565001728 -69 07 05.363061960   16.65 16.39     O6Vz 10 0
444 VFTS 473 * 05 38 39.5892168360 -69 04 56.737722288   16.83 16.85     B2:V 6 0
445 VFTS 474 * 05 38 39.7087760064 -69 09 27.778969260   16.74 16.67     B0.5:V(n) 6 0
446 IRSF J05383974-6907560 SB* 05 38 39.7366935336 -69 07 56.094871260   16.8 16.43     O9.7III 7 0
447 Cl* NGC 2070 SMB 455 * 05 38 39.750 -69 05 50.55   17.15 16.95     O((n)) 9 0
448 Cl* NGC 2070 SMB 206 * 05 38 39.750 -69 05 39.21 15.104 15.88 15.67   15.42 O((n)) 14 0
449 2MASS J05383981-6903413 SB* 05 38 39.82 -69 03 41.3   16.04 15.90     O4-5V((fc))z 10 0
450 [P93] 738 * 05 38 39.8245035816 -69 07 10.950647916   17.04 16.72     B0.7V-III 8 0
451 Cl* NGC 2070 SMB 340 * 05 38 40.150 -69 05 13.41   17.37 16.94   17.03 B0.5:V 6 0
452 2MASS J05384016-6901122 SB* 05 38 40.1819730912 -69 01 12.359442828 12.901 14.010 13.905   14.010 O8.5III 9 0
453 Cl* NGC 2070 MH 57 * 05 38 40.2160044288 -69 05 59.915264352   12.97 13.0   12.91 O3If*/WN6-A 37 1
454 Cl* NGC 2070 SMB 309 * 05 38 40.240 -69 05 30.78   16.5 16.38     O9V 9 0
455 Cl* NGC 2070 SMB 124 * 05 38 40.360 -69 05 43.76   15.21 15.07   15.00 O6-7V((n)) 13 0
456 Brey 75 WR* 05 38 40.53 -69 05 57.2   12.84 12.75   12.34 WN6h 62 0
457 VFTS 485 * 05 38 40.580 -69 05 11.28   16.85 16.90     B1.5V 6 0
458 VFTS 486 * 05 38 40.600 -69 04 56.03   15.76 15.48     B1-2ne+ 6 0
459 Cl* NGC 2070 MH 77 * 05 38 40.646 -69 06 05.73   16.54 16.40   16.56 O9.5III/V 6 0
460 Cl* NGC 2070 SMB 441 SB* 05 38 40.7152081798 -69 05 25.995880253   16.207 16.88     O6.5:IV:((f)):+O6.5:IV:((f)): 7 0
461 2MASS J05384074-6908249 * 05 38 40.7229658680 -69 08 24.931087044 15.347 16.015 15.808   15.458 O6V((f))z 13 0
462 VFTS 489 * 05 38 40.750 -69 01 48.87   16.47 16.54     B1Vn 6 0
463 Cl* NGC 2070 MH 85 Be? 05 38 40.779 -69 06 03.37   16.33 16.10   16.10 B[e]? 7 0
464 Cl* NGC 2070 MH 95 * 05 38 40.848 -69 06 04.51   15.77 15.38   16.53 O9.5III/V 6 0
465 Cl* NGC 2070 SMB 213 * 05 38 40.86 -69 06 57.5   15.91 15.62   15.10 O6V((fc)) 14 0
466 Cl* NGC 2070 SMB 330 * 05 38 40.977 -69 06 08.33   16.6 16.48   16.38 ~ 4 0
467 IRSF J05384106-6906599 * 05 38 41.040 -69 06 59.90   17.15 16.73   16.13 O8V(n) 11 0
468 Cl* NGC 2070 MH 123 * 05 38 41.040 -69 06 16.71   17.07 16.74   17.53 O9V 12 0
469 Cl* NGC 2070 MEL 21 SB* 05 38 41.0467204872 -69 04 24.872481480   14.05 14.16     O8V+O9.5:V 9 0
470 Cl* NGC 2070 MH 127 * 05 38 41.066 -69 06 15.16   17.17 16.11   15.47 O6.5III/V 7 0
471 Cl* NGC 2070 MH 129 * 05 38 41.077 -69 06 01.74   14.85 14.68   14.85 O6.5III/V 9 0
472 2MASS J05384109-6901458 * 05 38 41.093 -69 01 45.88 14.684 15.333 15.556   15.477 O9.7II-IIIn 11 0
473 OGLE LMC175.3 24178 EB* 05 38 41.0979595704 -69 06 51.597923364   16.88 16.66   16.244 B0Vn 10 0
474 Cl* NGC 2070 SMB 347 * 05 38 41.098 -69 06 35.01   16.64 16.45   16.10 O9.5V 13 0
475 Cl* NGC 2070 MH 134 * 05 38 41.108 -69 05 58.33   15.78 14.63   16.46 ON6.5I/II 5 0
476 Cl* NGC 2070 SMB 81 * 05 38 41.130 -69 05 13.14   14.6 14.66   14.96 O3.5V((f))z+OB 8 0
477 Cl* NGC 2070 MH 141 * 05 38 41.163 -69 06 02.83   15.48 15.44   16.63 O6.5III/V 5 0
478 [P93] 848 * 05 38 41.2013639280 -69 04 06.367056528   16.83 16.77     B0.7V 7 0
479 [M2002] LMC 171520 SB* 05 38 41.2138983552 -69 02 58.361078184   14.11 14.19 14.28 13.941 O6.5IV((fc))+O6.5V((fc)) 17 0
480 [P93] 849 * 05 38 41.2401107040 -69 04 14.298429684   15.82 15.74     B0.5V 7 0
481 Cl* NGC 2070 MH 156 * 05 38 41.268 -69 06 16.94   15.74 15.53   15.16 O7III/V 6 0
482 Cl* NGC 2070 MEL 27 SB* 05 38 41.2976 -69 05 32.391   13.83 13.76   13.56 O9.7II 16 0
483 Cl* NGC 2070 MH 166 * 05 38 41.355 -69 06 13.96   15.7 15.35   14.85 ~ 5 0
484 Cl* NGC 2070 MEL 27b SB* 05 38 41.380 -69 05 32.54   14.87 14.87     O9III 9 0
485 Cl* NGC 2070 MH 178 * 05 38 41.386 -69 06 02.49   16.2 16.06     O9III/V 4 0
486 VFTS 504 * 05 38 41.390 -69 03 00.89   16.88 16.27     B0.7V 9 0
487 Cl* NGC 2070 MH 181 * 05 38 41.417 -69 06 09.34   16.68 16.36   16.63 ~ 5 0
488 Cl* NGC 2070 SMB 265 * 05 38 41.490 -69 05 34.52   16.22 16.24   16.51 O9.5V/III 11 0
489 Cl* NGC 2070 MH 203 * 05 38 41.515 -69 06 00.83   14.28 13.67     O3V 11 0
490 Cl* NGC 2070 MEL 25 SB* 05 38 41.5495267078 -69 05 19.506347564   13.33 13.31   13.36 ON2V((n))((f*)) 25 0
491 RMC 140a WR* 05 38 41.5967462055 -69 05 13.457120148   12.18 12.12   12.40 WN4+WC5 35 0
492 [P93] 872 SB* 05 38 41.600 -69 07 02.40   16.15 15.98     O9.5V 9 0
493 RMC 140b WR* 05 38 41.6202115352 -69 05 15.192382434   12.61 12.66   12.54 WN6 31 0
494 Cl* NGC 2070 SMB 187 * 05 38 41.650 -69 06 03.17   15.8 15.38   16.21 ~ 4 0
495 VFTS 510 SB* 05 38 41.680 -69 06 18.48   16.55 16.28     O8.5V 4 0
496 Cl* NGC 2070 SMB 143 SB* 05 38 41.730 -69 06 28.06   15.4 15.28   15.05 O5V((n))((fc))z 14 0
497 Cl* NGC 2070 SMB 68 SB* 05 38 41.750 -69 06 24.94   14.48 14.28   13.89 O2V-III((f*)) 17 0
498 Cl* NGC 2070 SMB 154 * 05 38 41.766 -69 06 18.98   15.5 15.30   14.61 ~ 5 0
499 IRSF J05384189-6909229 * 05 38 41.784 -69 09 23.35   16.64 16.61     B1.5V 6 0
500 Cl* NGC 2070 SMB 266 * 05 38 41.810 -69 05 31.91   16.26 16.20     O6-7II(f) 9 0
501 Cl* NGC 2070 SMB 434 * 05 38 41.860 -69 05 32.40   17.02 16.94   15.70 O8-9p 9 0
502 2MASS J05384185-6901590 SB* 05 38 41.8615179240 -69 01 58.895150988 14.912 15.675 15.759   15.943 O9.7III 8 0
503 Cl* NGC 2070 SMB 88 * 05 38 41.88 -69 06 14.4   14.77 14.50   14.82 ~ 18 1
504 Cl* NGC 2070 MH 290 * 05 38 41.887 -69 06 12.45   14.62 14.34   14.15 O2-4.5 11 0
505 Cl* NGC 2070 MEL 29 * 05 38 41.9333563008 -69 04 38.813563056   14.64 14.72   14.467 O9.5V-III((n)) 11 0
506 Cl* NGC 2070 SMB 138 SB* 05 38 41.940 -69 06 29.62   15.38 15.11   14.69 O3.5III(f*) 16 0
507 Cl* NGC 2070 SMB 55 SB* 05 38 41.940 -69 05 13.00   14.14 14.11   14.55 O3-4((f))+OB+WN 10 0
508 Cl* NGC 2070 SMB 397 * 05 38 41.990 -69 06 53.46   16.77 16.69   16.52 B1:V(SB2?) 9 0
509 VFTS 521 ** 05 38 42.0154 -69 07 04.979   15.51 15.34     O9V(n) 14 0
510 Cl* NGC 2070 MH 320 * 05 38 42.016 -69 06 07.51   14.56 14.34   14.19 ~ 8 0
511 Cl* NGC 2070 MH 314 * 05 38 42.023 -69 06 16.75   15.66 15.51   15.42 O3-4 8 0
512 Cl* NGC 2070 SMB 25 * 05 38 42.068 -69 06 14.19   13.52 13.31   13.09 ~ 7 0
513 [P93] 921 SB* 05 38 42.09 -69 05 45.5   15.3 15.22   14.938 O6II-Iab(fc)+O5.5V((fc)): 13 0
514 VFTS 523 * 05 38 42.120 -69 04 32.93   17.06 17.05     B1-3V-III 6 0
515 [P93] 930 s*b 05 38 42.2168 -69 06 25.538   13.92 13.76   13.62 B0Ia 19 0
516 [P93] 925 s*b 05 38 42.2378711352 -69 08 32.357063400 15.124 15.572 15.185   14.128 O8.5I((n))fp 8 0
517 RMC 139 WR* 05 38 42.3537501576 -69 04 58.196699796   12.04 11.94     O6.5Iafc+O6Iaf 93 0
518 [P93] 956 * 05 38 42.3750173856 -69 04 24.769342092   15.58 15.58     O9.7(n) 14 0
519 OGLE LMC-ECL-21435 EB* 05 38 42.38 -69 04 43.1   16.01 15.94   15.889 O9.5(n) 15 0
520 RMC 136 Cl* 05 38 42.396 -69 06 03.36   5.81 5.40     ~ 2019 2
521 2MASS J05384240-6903041 SB* 05 38 42.402 -69 03 04.19   16.26 16.28     O9.5III:nn 5 0
522 Cl* NGC 2070 MH 493 * 05 38 42.407 -69 06 15.01   13.69 13.44   13.07 ~ 7 0
523 Cl* NGC 2070 MH 591 * 05 38 42.631 -69 06 10.91   15.41 15.26   15.30 O8III/V 7 0
524 OGLE LMC-ECL-21439 SB* 05 38 42.65 -69 04 13.5   14.39 14.50   14.568 O9.5III:nn 13 0
525 OGLE LMC-ECL-21440 SB* 05 38 42.66 -69 06 35.8   14.96 14.76   14.447 O3V(n)((f*))z+OB 19 0
526 Cl* NGC 2070 MH 623 * 05 38 42.685 -69 06 07.03   15.5 15.20   15.36 O8.5III/V 6 0
527 RMC 142 s*b 05 38 42.7360833048 -69 05 42.617961852   12.11 11.82   11.59 B0Ia 32 0
528 VFTS 534 * 05 38 42.7922981736 -69 15 40.271964516   15.87 15.66     B0IV 6 0
529 VFTS 535 * 05 38 42.800 -69 04 31.50   16.87 16.53     B1-2V-III 7 0
530 Cl* NGC 2070 SMB 295 * 05 38 42.8142404328 -69 06 32.569582176   16.44 16.21   15.87 O6Vz 11 0
531 VFTS 1025 * 05 38 42.935 -69 06 04.98           ~ 11 0
532 MH 12 SB* 05 38 43.026 -69 04 13.15   13.96 13.99     ON9Ia:+O7.5:I:(f): 18 0
533 2MASS J05384305-6903447 * 05 38 43.0359744336 -69 03 44.880387876   16.06 15.99     O5V((fc))z 12 0
534 Cl* NGC 2070 MH 716 * 05 38 43.0737 -69 06 11.255   14.40 14.26   14.10 O2-4.5 22 0
535 Cl* NGC 2070 SMB 372 * 05 38 43.080 -69 06 36.88   16.78 16.55   16.42 B0V 11 0
536 [P93] 9024 s*b 05 38 43.0825629552 -69 01 32.557775304 12.393 13.284 13.246   12.424 B0.5Ia 7 0
537 [P93] 1012 * 05 38 43.1030 -69 07 02.095   16.28 16.14     O9.5(n) 12 0
538 BAT99 113 WR* 05 38 43.12 -69 05 46.8   13.56 13.47   13.44 O2If*/WN5 44 0
539 BAT99 114 WR* 05 38 43.20 -69 06 14.6   13.52 13.40   13.31 O2If*/WN5 37 0
540 Cl* NGC 2070 SMB 152 SB* 05 38 43.200 -69 05 27.46   15.43 15.41   15.60 O9IV+O9.7:V 13 0
541 Cl* NGC 2070 MH 748 * 05 38 43.210 -69 05 42.46   14.74 14.74   15.03 ~ 7 0
542 Cl* NGC 2070 MH 749 * 05 38 43.2715 -69 06 16.529   13.86 13.82   13.78 O3.5-4.5 21 0
543 Cl* NGC 2070 MH 764 * 05 38 43.351 -69 05 47.47   14.71 14.68   15.61 ~ 6 0
544 [P93] 1052 * 05 38 43.3816894056 -69 04 46.464971124   15.4 15.36     O8-9III:((n)) 12 0
545 VFTS 1030 * 05 38 43.427 -69 05 41.95   16.55 16.45     ~ 2 0
546 [P93] 9026 * 05 38 43.5562399800 -69 01 58.885508712   16.82 16.79     B3-5V-III 5 0
547 Cl* NGC 2070 SMB 240 * 05 38 43.560 -69 05 29.31   16.11 16.13   16.19 B0-0.5V 7 0
548 2MASS J05384358-6907516 * 05 38 43.5869910648 -69 07 51.926774124   16.86 16.51     O6.5Vz 11 0
549 [P93] 1077 * 05 38 43.600 -69 04 42.46   15.34 15.25     O5V((fc))z 8 0
550 Cl* NGC 2070 SMB 416 * 05 38 43.660 -69 06 18.86   16.95 16.82   16.88 B1V 7 0
551 Cl* NGC 2070 MH 815 * 05 38 43.6890 -69 05 47.855   13.89 13.89   13.99 O3.5 11 0
552 Cl* NGC 2070 MH 804 SB* 05 38 43.690 -69 06 16.57   16.47 16.16   16.65 O8.5III:+B 7 0
553 Cl* NGC 2070 SMB 450 * 05 38 43.730 -69 06 27.18   17.06 17.00   16.87 B1V 7 0
554 Cl* NGC 2070 SMB 343 * 05 38 43.790 -69 05 38.70   16.65 16.61   16.72 O9.7V 12 0
555 2MASS J05384388-6903164 SB* 05 38 43.9082129880 -69 03 16.379656344   15.96 15.88     O9.5Vz 9 0
556 VFTS 556 * 05 38 44.000 -69 04 48.25   16.92 16.88     B1.5-2V 6 0
557 OGLE LMC-ECL-21453 SB* 05 38 44.06 -69 04 59.5   16.69 16.57   16.046 On 7 0
558 Cl* NGC 2070 MH 863 * 05 38 44.076 -69 05 44.77   14.96 14.67   14.76 ~ 6 0
559 OGLE LMC553.25.008126 EB* 05 38 44.16 -69 05 42.2   14.85 14.53   14.422 ~ 11 0
560 Cl* NGC 2070 MH 878 * 05 38 44.2200 -69 05 46.976   13.48 13.36   13.17 O8II 15 1
561 2MASS J05384423-6900274 * 05 38 44.237 -69 00 27.49 15.650 16.602 16.051   16.202 B3III 4 0
562 [P93] 1133 * 05 38 44.2874173296 -69 07 16.631010156   16.71 16.49     O9.7(n) 11 0
563 Cl* NGC 2070 MH 888 * 05 38 44.321 -69 05 45.05   15.62 15.53   20.22 O8.5I/II 8 0
564 Cl* NGC 2070 SMB 350 * 05 38 44.350 -69 06 40.73   16.64 16.59   16.57 O9.5V 16 0
565 Cl* NGC 2070 SMB 168 SB* 05 38 44.370 -69 05 14.34   15.53 15.46   15.53 O9:(n) 9 0
566 Cl* NGC 2070 MEL 26 * 05 38 44.4177 -69 05 36.154   13.75 13.66   13.59 O4III(f) 16 0
567 Cl* NGC 2070 SMB 237 SB* 05 38 44.540 -69 06 28.73   16.1 15.91   15.77 O9.7III:+B0:V: 14 0
568 Cl* NGC 2070 SMB 253 * 05 38 44.560 -69 05 12.31   16.19 16.02   16.16 O6-8V((f)) 8 0
569 VFTS 565 * 05 38 44.560 -69 04 55.09   16.6 16.55     O9.5: 10 0
570 MH 31 * 05 38 44.5650276384 -69 04 51.259890828   14.11 14.05     O3III(f*) 23 0
571 OGLE LMC-ECL-21458 EB* 05 38 44.6118875904 -69 07 56.707855536   16.53 16.29   15.928 B1V(n) 9 0
572 OGLE LMC553.25.008565 EB* 05 38 44.6728021992 -69 04 24.977555760   16.94 16.79   16.594 B0.5:V 8 0
573 Cl* NGC 2070 SMB 259 * 05 38 44.6850 -69 05 13.907   16.16 16.09   16.52 O9.2III: 15 0
574 Cl* NGC 2070 MH 916 SB* 05 38 44.700 -69 05 45.13   15.73 15.42   14.64 O9.5ne+ 8 0
575 Cl* NGC 2070 MH 917 * 05 38 44.700 -69 05 41.01   17.1 16.92   17.09 O9.5II-III(n) 12 0
576 2MASS J05384477-6908569 * 05 38 44.7277264104 -69 08 57.158809368   16.53 16.38     B1V 8 0
577 Cl* NGC 2070 SMB 440 * 05 38 44.770 -69 06 57.55   16.97 16.94   16.92 B0-0.5V 6 0
578 Cl* NGC 2070 MH 920 * 05 38 44.820 -69 05 43.62   16.53 16.41   17.92 ~ 4 0
579 VFTS 574 * 05 38 44.8253582232 -68 57 34.597835640   15.77 15.89     O9.5IIIn 11 0
580 Cl* NGC 2070 SMB 128 * 05 38 44.910 -69 05 33.10   15.13 15.11   15.17 B0.7III 12 0
581 VFTS 576 s*b 05 38 44.9364456216 -69 15 11.394173880   16.45 15.67     B1IaNwk 6 0
582 IRSF J05384494-6907046 * 05 38 44.9420673240 -69 07 04.638220176   17.04 16.64     O6V((fc))z 9 0
583 W61 7-5 s*b 05 38 44.9624958096 -69 08 06.768240252 14.203 14.657 14.205   13.773 B1Ia 10 0
584 Cl* NGC 2070 SMB 171 * 05 38 44.970 -69 05 07.69   15.51 15.51   15.61 O9:((n)) 16 0
585 [P93] 1217 * 05 38 45.030 -69 03 19.32   16.67 16.62     B0-0.5Vn 7 0
586 Cl* NGC 2070 MH 935 * 05 38 45.095 -69 05 42.81   16.65 16.51   16.76 ~ 4 0
587 2MASS J05384509-6904157 * 05 38 45.095 -69 04 15.76   16.25 16.07     O4-5V((fc)) 12 0
588 Cl* NGC 2070 SMB 414 * 05 38 45.190 -69 05 37.43   16.99 16.83   17.71 O9.5V((n)) 10 0
589 Cl* NGC 2070 MH 939 SB* 05 38 45.220 -69 05 48.39   14.99 14.93   15.33 O8V+O8.5V 6 0
590 Cl* NGC 2070 SMB 443 * 05 38 45.250 -69 06 54.84   17 16.95   16.71 B1.5V 6 0
591 Cl* NGC 2070 MH 943 SB* 05 38 45.280 -69 05 46.47   13.77 13.65   13.78 O7V(n) 11 0
592 Cl* NGC 2070 SMB 293 * 05 38 45.380 -69 05 24.44   16.38 16.38   16.55 O9.7: 13 0
593 2MASS J05384539-6902514 pA? 05 38 45.3901880400 -69 02 51.448462044 13.564 14.574 14.491 13.97 14.826 O4V((n))((fc))z 16 0
594 Cl* NGC 2070 SMB 356 SB* 05 38 45.400 -69 05 39.76   16.67 16.53   17.61 O9.5 6 0
595 RMC 141 s*b 05 38 45.5859 -69 05 47.772   12.71 12.49   12.36 BN0.5Ia 31 0
596 [P93] 1247 * 05 38 45.5910727320 -69 07 34.932550872   15.98 15.83     B0.5V(SB2?) 12 0
597 Cl* NGC 2070 SMB 318 * 05 38 45.690 -69 06 15.33   16.54 16.40   16.39 O9.5Vn 11 0
598 CPD-69 457 s*b 05 38 45.706536 -69 06 22.48020 11.233 12.094 11.996 12.419 10.066 B0.5Ia 20 0
599 VFTS 593 * 05 38 45.7083868032 -69 09 40.159551420   16.93 16.84     B2.5V 7 0
600 Cl* NGC 2070 SMB 267 * 05 38 45.760 -69 05 13.29   16.23 16.16   16.25 O9.7 9 0
601 Cl* NGC 2070 SMB 175 ** 05 38 46.0635652536 -69 06 56.254094388   15.59 15.56   15.62 O8-9V(n) 14 0
602 Cl* NGC 2070 SMB 137 SB* 05 38 46.070 -69 06 15.51   15.26 15.23   15.02 O7-8V((n)) 8 0
603 VFTS 598 * 05 38 46.130 -69 06 23.51   17.28 16.94     B0.2V 7 0
604 W61 7-7 SB* 05 38 46.1994 -69 06 16.007   13.88 13.80   13.73 O3III(f*) 23 0
605 VFTS 600 * 05 38 46.2519028680 -69 10 14.754851580   16.36 16.40     B0.5V(n) 6 0
606 Cl* NGC 2070 MH 986 * 05 38 46.2817811664 -69 05 59.409391128   14.78 14.69   14.62 O5-6V((n))z 23 0
607 VFTS 602 * 05 38 46.3559661288 -69 04 33.554660916   16.8 16.71     B0.7V 6 0
608 Cl* NGC 2070 MEL 10 SB* 05 38 46.5347000352 -69 04 28.044565608   14.03 13.99     O4III(fc) 16 0
609 Cl* NGC 2070 SMB 110 * 05 38 46.5839 -69 05 37.116   14.98 14.94   15.06 O8.5V 10 0
610 Cl* NGC 2070 SMB 357 * 05 38 46.710 -69 05 38.78   16.66 16.60   16.90 B0-0.5V(n) 9 0
611 OGLE LMC-ECL-21479 EB* 05 38 46.72 -69 02 40.5   16.72 16.85   16.824 B1-2V 11 0
612 Cl* NGC 2070 SMB 294 * 05 38 46.760 -69 05 48.75   16.42 16.34   16.40 O9.7III 14 0
613 Cl* NGC 2070 MH 999 SB* 05 38 46.7865227544 -69 06 03.188070828   14.38 14.22   14.03 O4III(f) 24 0
614 Cl* NGC 2070 SMB 408 * 05 38 46.800 -69 06 26.31   16.9 16.73   15.83 B0Vn 9 0
615 Cl* NGC 2070 SMB 384 * 05 38 46.870 -69 05 20.07   16.75 16.76   16.64 O9-9.5V-III 9 0
616 Cl* NGC 2070 MH 1003 * 05 38 46.900 -69 05 58.71   16.29 16.16   16.16 O8V(n) 13 0
617 Cl* NGC 2070 SMB 362 * 05 38 47.150 -69 06 35.81   16.73 16.53   16.35 B0.5-0.7V 7 0
618 Cl* NGC 2070 SMB 219 SB* 05 38 47.170 -69 05 54.40   15.94 15.78   15.67 O8.5Vz 11 0
619 Cl* NGC 2070 SMB 218 * 05 38 47.330 -69 06 17.70   15.91 15.89   15.89 O9.5IIInn 13 0
620 [P93] 1389 * 05 38 47.4637391208 -69 07 13.482208848   16.57 16.48     B0.5:V 10 0
621 HD 269926 WR* 05 38 47.5179121824 -69 00 25.287752196 11.953 12.974 13.116 13.16 12.926 WN4+OB 69 0
622 VFTS 618 * 05 38 47.6017516248 -69 07 05.954004444   17.08 16.70     B1-3V 4 0
623 Cl* NGC 2070 SMB 234 SB* 05 38 47.7180228072 -69 06 45.042662880   16.1 15.98   15.92 O7-8V(n) 11 0
624 [P93] 1416 * 05 38 47.9180870232 -69 05 32.988586632   16.64 16.61   16.90 O9.7III(n) 13 0
625 Cl* NGC 2070 SMB 333 SB* 05 38 48.024 -69 06 12.27   16.61 16.56   16.63 O9.7III 13 0
626 NAME Walborn 2 ** 05 38 48.1018 -69 04 42.239   15.66 15.39     O2V((f*))z 27 0
627 Cl* NGC 2070 SMB 453 * 05 38 48.1258239648 -69 06 04.946417928   17.09 16.98   16.74 B0.2-0.5Vn 8 0
628 2MASS J05384814-6907415 * 05 38 48.1367289456 -69 07 41.600938944 15.250 15.874 15.516   15.772 B0.2V 12 0
629 VFTS 625 * 05 38 48.1746764520 -69 08 34.152222876   17.02 16.91     B1.5V 7 0
630 W61 7-9 * 05 38 48.1964871552 -69 08 10.916344176 14.384 15.051 15.197   14.490 O5-6n(f)p 14 0
631 [P93] 9034 * 05 38 48.4032393744 -68 59 49.916028984 14.379 15.246 15.339   15.591 O9.7V 11 0
632 Cl* NGC 2070 SMB 378 * 05 38 48.458 -69 06 36.44   16.73 16.64   16.58 B0.5:V 7 0
633 Cl* NGC 2070 SMB 404 * 05 38 48.510 -69 05 40.32   16.85 16.78   16.21 B1-2Ve+ 7 0
634 [P93] 1455 * 05 38 48.650 -69 04 58.89   16.38 16.21     O9.7V-III 6 0
635 2MASS J05384889-6908279 SB* 05 38 48.8703949800 -69 08 28.118310180 15.549 16.260 16.281   15.802 O9.7III(n) 12 0
636 OGLE LMC553.25.008162 EB* 05 38 48.8888836488 -69 08 55.352931648   16.09 15.97   15.855 B2Vn 10 0
637 VFTS 633 * 05 38 48.9482534352 -69 08 12.473003544   16.69 16.50     B1V 6 0
638 VFTS 634 ** 05 38 49.0230004920 -69 04 10.549785972   16.81 16.50     OV 6 0
639 Cl* NGC 2070 SMB 174 SB* 05 38 49.0412352408 -69 06 19.664990568   15.59 15.52   15.54 O9.5IV 13 0
640 [P93] 10008 * 05 38 49.1932054632 -69 10 04.472504220   16.59 16.53     B0Vn 8 0
641 Cl* NGC 2070 SMB 359 * 05 38 49.400 -69 06 15.28   16.65 16.61   16.73 B1-2V+B 8 0
642 VFTS 638 * 05 38 49.5109412328 -69 02 30.332563836   15.49 15.63     O8.5Vz 8 0
643 [P93] 10002 * 05 38 49.6310355888 -69 09 24.104295684   15.4 15.41     O9.7V 11 0
644 VFTS 640 * 05 38 49.6601286552 -69 08 54.848075388   16.98 16.82     B2V 6 0
645 W61 7-10 Y*? 05 38 49.7234755368 -69 06 43.060485816   13.25 13.09   12.97 B0.5:I 18 0
646 2MASS J05384990-6910428 SB* 05 38 49.8973407912 -69 10 42.849109812   16.41 16.03     O5Vz:+O8Vz: 8 0
647 VFTS 643 * 05 38 49.970 -69 07 05.34   16.54 16.41     B1.5V 5 0
648 Cl* NGC 2070 SMB 391 * 05 38 50.0243244360 -69 06 51.991551792   16.77 16.62   16.16 B1-2Ve 7 0
649 2MASS J05385022-6907450 SB* 05 38 50.2021490232 -69 07 45.280590492   16.45 16.29     O9.5V((n)) 7 0
650 W61 7-11 * 05 38 50.2642882728 -69 06 04.470988464 14.370 14.988 15.182   14.536 B0.5III(n) 14 0
651 VFTS 647 * 05 38 50.3408478744 -69 05 02.783588100   16.39 16.29     O8:V: 7 0
652 W61 7-12 SB* 05 38 50.4026954184 -69 05 38.266265256   14.24 14.16   14.17 O5.5IV(f) 20 0
653 Cl* NGC 2070 SMB 239 SB* 05 38 50.620 -69 05 54.56   16.12 16.07   16.12 O9.5V 11 0
654 VFTS 650 * 05 38 50.690 -68 57 55.47   16.88 16.98     B1.5V 7 0
655 W61 7-13 SB* 05 38 51.00 -69 05 54.7   14.78 14.70   14.71 O7V(n)z 16 0
656 W61 7-14 SB* 05 38 51.0432314808 -69 06 20.499375204 13.350 14.202 13.835   13.633 B2Ip+O9III: 25 0
657 OGLE LMC175.3 24231 EB* 05 38 51.0888191760 -69 06 48.798198612   16.85 16.63   16.078 B0-0.5V 10 0
658 Cl* NGC 2070 SMB 200 SB* 05 38 51.1616826432 -69 05 41.908199388   15.76 15.71   15.77 O9Vnn 8 0
659 W61 7-16 * 05 38 51.2007715584 -69 05 59.386365744   14.3 14.24   14.30 O7.5III(n)((f))p 19 0
660 2MASS J05385131-6904084 SB* 05 38 51.3265560168 -69 04 08.573905884 14.264 15.263 14.368   14.376 O7-8II(f) 7 0
661 Cl* NGC 2070 SMB 229 * 05 38 51.7590385248 -69 06 01.238651568   16 15.96   16.03 B0-0.5V(n) 12 0
662 Cl* NGC 2070 SMB 224 * 05 38 51.8140287480 -69 05 46.937542524   15.95 15.92   15.96 O9.5Vnn 15 0
663 OGLE LMC175.4 95 SB* 05 38 52.0517214552 -69 05 33.884155680   15.21 15.13   15.017 O6.5V(n)+O9.7:V: 15 0
664 VFTS 662 * 05 38 52.5574581072 -69 02 20.371714656   16.2 16.12     B3-5III: 7 0
665 VFTS 663 * 05 38 52.7115283344 -69 10 14.840478984   16.75 16.52     O8.5V 8 0
666 W61 7-19 * 05 38 52.7246801448 -69 06 43.267945464 13.481 14.132 13.937   13.702 O7II(f) 22 0
667 2MASS J05385270-6907286 * 05 38 52.7395741032 -69 07 28.762078440   16.54 16.43     B0.5V 9 0
668 VFTS 666 * 05 38 52.7984152944 -69 01 38.138423592   16.34 16.42     B0.5V 7 0
669 Cl* NGC 2070 SMB 118 * 05 38 52.8331888920 -69 06 12.120967908   15.1 15.03   15.09 O6V((f)) 12 0
670 VFTS 668 * 05 38 52.8629713752 -69 07 36.086327976   16.7 16.60     B0.7V 7 0
671 W61 7-18 SB* 05 38 52.9704587472 -69 07 45.406012188 13.795 14.467 14.242   13.848 O8Ib(f) 16 0
672 2MASS J05385308-6908248 * 05 38 53.0558935056 -69 08 24.909133344 15.687 16.376 16.516   15.908 B0.7V 9 0
673 VFTS 671 * 05 38 53.2232631792 -69 02 40.963653060   16.32 16.43     B0.7V 6 0
674 W61 7-21 * 05 38 54.0954791232 -69 08 07.720087812 14.032 14.713 14.579   14.020 B0.7IINwk? 12 0
675 VFTS 673 * 05 38 54.1275058224 -69 06 53.059653396   17.01 16.98     B1V 7 0
676 W61 7-20 s*b 05 38 54.4345933344 -69 08 00.529791036 14.144 14.861 14.660   14.027 B1IabNwk 10 0
677 VFTS 676 * 05 38 54.6293274360 -69 04 54.855177996   16.59 16.52     B0.7V 7 0
678 [P93] 1696 ** 05 38 54.730 -69 03 48.85   17.08 16.68     O9.5V 7 0
679 [P93] 1689 * 05 38 54.8257091424 -69 07 50.313681696   17.36 16.95     B1:V 6 0
680 VFTS 679 * 05 38 54.850 -69 03 50.22   16.98 16.73     O9.5V 9 0
681 VFTS 681 * 05 38 55.220 -69 05 56.70   16.61 16.55     B0.7V 7 0
682 UCAC4 105-014417 WR* 05 38 55.5222410976 -69 04 26.809579344   16.66 16.08   14.89 WN5h 61 0
683 VFTS 683 * 05 38 55.5559585848 -68 58 56.188519572   16.23 16.33     B2Ve 6 0
684 [P93] 10004 * 05 38 55.5588432504 -69 09 37.832071932   16.85 16.64     B1-3V-IIIe+ 8 0
685 [P93] 1722 * 05 38 55.570 -69 08 28.67   17.04 16.91     B1-1.5V 6 0
686 [P93] 1729 * 05 38 55.6332136920 -69 07 23.839980384 14.514 15.112 15.022   14.717 B0.7III 12 0
687 W61 7-24 * 05 38 55.841 -69 08 22.32 13.930 14.529 14.398   13.908 B1.5Ib((n))Nwk 12 0
688 2MASS J05385604-6905540 SB* 05 38 56.0600161128 -69 05 54.142276164   15.71 15.60     O9.7III 6 0
689 VFTS 689 * 05 38 56.380 -69 08 22.62   16.59 16.51     B3:e_sh 4 0
690 VFTS 690 * 05 38 56.6261647488 -69 07 19.718640300   16.55 16.46     B0.2V 6 0
691 [P93] 1786 * 05 38 56.859 -69 06 38.47   16.22 16.17     B0.2V 9 0
692 HD 269928 WR* 05 38 57.0667692816 -69 06 05.660419140   12.02 11.94 12.00 11.58 WN6/7 133 0
693 [P93] 1799 * 05 38 57.162 -69 03 42.12   16.73 16.55     B1-2Ve 7 0
694 SK -68 140 Em* 05 38 57.1713887928 -68 56 53.151615708   12.81 12.71 12.89   B0.7Ib-IabNwk 37 0
695 W61 7-27 s*b 05 38 57.3146752272 -69 07 09.773354676 14.514 13.891 14.134 13.98 12.884 B3Ia 20 0
696 VFTS 699 * 05 38 57.4913582160 -69 03 48.503031696   16.14 16.19     B0.2-0.5Vn 6 0
697 [P93] 1820 * 05 38 58.183 -69 04 58.50   16.86 16.60     B0.7V 6 0
698 2MASS J05385838-6904350 Y*O 05 38 58.3919775600 -69 04 35.209309944   16.64 16.31   15.768 O8V(n) 15 0
699 2MASS J05385855-6907524 SB* 05 38 58.5590495472 -69 07 52.597314480   17.21 16.91     O7:V:+O8:V: 7 0
700 VFTS 704 * 05 38 58.700 -69 02 44.74   16.69 16.76     O9.2V(n) 9 0
701 VFTS 705 * 05 38 58.710 -69 06 47.10   16.5 16.43     B0.7V 7 0
702 [P93] 1838 * 05 38 58.7691907104 -69 05 23.987496228   15.91 15.77     O6-7Vnnz 12 0
703 OGLE LMC-ECL-21573 EB* 05 38 58.9082571720 -69 06 42.177142584   15.66 15.59   15.459 B0.5V 13 0
704 VFTS 709 * 05 38 59.0279363040 -69 00 20.534911632   16.51 16.58     B2.5:V 6 0
705 VFTS 710 * 05 38 59.1397190856 -69 06 24.324273756   16.12 16.14     O9.5IV 8 0
706 VFTS 711 * 05 38 59.2771482336 -69 08 12.371270892   16.79 16.48     O9.7III 9 0
707 VFTS 712 * 05 38 59.4572140512 -69 05 49.593525036   16.34 16.13     B1V 8 0
708 VFTS 713 * 05 38 59.8948794168 -69 08 14.788941324   16.93 16.68     B2:V 5 0
709 [P93] 1875 * 05 38 59.9410100496 -69 05 41.997595452 14.987 15.559 14.835   14.758 B1Ia:Nwk 7 0
710 VFTS 715 * 05 39 00.0269896992 -69 01 39.871303608   16.54 16.64     B1V 6 0
711 2MASS J05390040-6903305 SB* 05 39 00.3946900848 -69 03 30.574795536   15.97 15.91     O9.5IV 8 0
712 2MASS J05390080-6907132 * 05 39 00.804 -69 07 13.22 15.301 15.945 15.709   15.314 O9IV 10 0
713 VFTS 718 * 05 39 00.8953528992 -68 57 29.734337772   15.93 15.99     B2.5III 6 0
714 [P93] 1898 * 05 39 00.9216224688 -69 06 29.200614048   17.08 17.00     B1V 6 0
715 VFTS 720 * 05 39 01.0572054504 -68 59 05.883282096   16.68 16.74     B2V 6 0
716 VFTS 722 * 05 39 02.7929333280 -68 57 07.870733460   14.91 15.04     O7Vnnz 11 0
717 VFTS 723 * 05 39 02.8622422560 -69 05 26.414126664   16.35 16.19     B0.5V 6 0
718 VFTS 724 * 05 39 02.950 -69 15 00.08   17.23 16.80     O7Vnnz 9 0
719 VFTS 725 * 05 39 03.2214054552 -69 08 18.353598288   15.95 15.84     B0.7III 12 0
720 VFTS 726 * 05 39 03.3037806936 -69 09 31.999195260   16.43 16.40     B1-2V 6 0
721 VFTS 727 * 05 39 03.3253029528 -69 10 39.724563504   16.92 16.74     B3III 6 0
722 2MASS J05390342-6906345 SB* 05 39 03.4301254200 -69 06 34.667305236 14.824 15.549 15.522   15.624 O9.7II-III((n)) 9 0
723 [P93] 1969 * 05 39 03.5968259712 -69 07 16.957645212 14.531 15.268 15.088   14.618 B0.2III 11 0
724 SSTISAGEMC J053903.63-690019.2 * 05 39 03.6194103912 -69 00 19.062690264 14.607 15.394 15.510   15.468 B1.5V 7 0
725 Brey 90a WR* 05 39 03.7764480936 -69 03 46.565761680 16.190 15.895 15.834   15.533 WC5 26 0
726 W61 7-29 s*b 05 39 04.7719738776 -69 04 09.915616344 12.403 13.154 12.756     B1Ia 18 0
727 W61 7-28 SB* 05 39 04.8729238776 -69 05 40.477886412 13.507 14.355 14.240   13.891 B0.5V 15 0
728 OGLE LMC-ECL-21604 EB* 05 39 04.9307574360 -69 05 35.397039696   16.46 16.31   15.972 B0.7V 9 0
729 VFTS 735 * 05 39 05.0252521512 -69 13 29.693530452   16.73 16.30     B1-2IIIe+ 6 0
730 2MASS J05390529-6904161 SB* 05 39 05.3053822536 -69 04 16.176249300   15.9 15.85     O9.5V 8 0
731 [P93] 2000 * 05 39 05.3879593440 -69 04 31.157663808   15.83 15.70     O9V 8 0
732 VFTS 738 * 05 39 05.4236292216 -68 57 37.361334816   14.57 14.55     B0.5IIIe+ 5 0
733 SK -69 250 * 05 39 05.9299770984 -69 16 26.771983896   12.53 12.14     B7I 13 0
734 VFTS 740 * 05 39 06.0206068920 -69 15 41.638501620   16.85 16.50     B0.7III 7 0
735 VFTS 741 * 05 39 06.0330947928 -69 09 58.517335692   17.26 16.97     B2V 6 0
736 VFTS 742 * 05 39 06.410 -68 56 58.70   16.91 16.93     B2V 5 0
737 2MASS J05390692-6900165 SB* 05 39 06.9189983928 -69 00 16.533676800   14.87 15.04     O9.5V((n)) 6 0
738 VFTS 746 * 05 39 07.3238729856 -69 07 46.078350312   15.5 15.38     O6Vnn 9 0
739 VFTS 745 * 05 39 07.3262602920 -69 02 36.563624052   16.87 16.59     B2.5II-Ib 5 0
740 [P93] 2022 * 05 39 07.6298636160 -69 06 24.975157392 14.568 15.288 15.132   14.794 B0.5V 6 0
741 VFTS 748 * 05 39 07.9498916184 -69 06 02.696372748   16.94 16.78     B0.7V 7 0
742 OGLE LMC553.25.008476 EB* 05 39 08.1624645984 -69 05 55.956696576   16.89 16.76   16.548 B0.7V 8 0
743 2MASS J05390833-6900575 SB* 05 39 08.3610253728 -69 00 57.581264088   15.32 15.43     O9.5IV 6 0
744 2MASS J05390900-6901291 * 05 39 08.9938358352 -69 01 29.327436228   16.47 16.32     O7-8Vnnz 11 0
745 VFTS 752 * 05 39 09.1320772512 -68 57 47.367881892   16.36 16.48     B2V 6 0
746 IRSF J05390915-6912104 * 05 39 09.1415423616 -69 12 10.373947668   16.88 16.46     O9.7II-III 11 0
747 VFTS 754 * 05 39 10.0592215248 -69 06 21.510968148   16.81 16.55     B1.5V 6 0
748 SSTISAGEMC J053910.91-690613.2 * 05 39 10.9163642088 -69 06 13.739103756 14.314 15.101 15.011   14.676 O3Vn((f*)) 12 0
749 AL 382 Em* 05 39 10.9428092016 -68 56 46.838209524   14.74 14.58 14.69   B0.5IIIe+ 9 0
750 VFTS 757 * 05 39 11.1455397072 -69 02 59.119414944   17.04 16.78     B3III(n) 5 0
751 HD 38344 WR* 05 39 11.3190030600 -69 02 01.571056044 12.323 13.04 12.993 13.07 12.574 WN5h 73 0
752 VFTS 761 * 05 39 12.7300824672 -68 58 47.423390556   15.22 15.35     O6.5V((n))((f))zNstr 10 0
753 VFTS 762 * 05 39 13.2757608360 -69 09 27.579881880   16.68 16.46     B1.5V 6 0
754 CPD-69 470 s*b 05 39 14.5231705512 -69 16 42.471499440   12.35 12.26     O9.7IaNstr 16 0
755 VFTS 766 * 05 39 15.2042999472 -68 58 51.601369044   15.27 15.34     B5-8e 4 0
756 VFTS 768 * 05 39 16.2305510064 -69 01 20.388275256   16.3 16.10     O8Vn 9 0
757 2MASS J05391668-6907030 SB* 05 39 16.6944038376 -69 07 03.116176680   15.91 15.83     O9.7V 6 0
758 IRSF J05391675-6903276 * 05 39 16.872 -69 03 27.69   15.87 15.79     O7Vnn 9 0
759 2MASS J05391738-6906098 SB* 05 39 17.3879793744 -69 06 09.911940084 15.087 15.721 15.603   15.338 O9.7III:(n) 7 0
760 VFTS 772 * 05 39 17.8125147720 -68 57 33.772447908   16.88 16.89     B3-5V-III 6 0
761 2MASS J05391867-6907472 SB* 05 39 18.6750040392 -69 07 47.358374448   17.38 16.89     O7.5IVp+O8.5:V: 5 0
762 VFTS 775 * 05 39 18.8731386768 -69 14 19.467538692   17.14 16.85     O9.2V 8 0
763 VFTS 777 * 05 39 19.8942828888 -69 01 12.871039620   15.68 15.30     O9.2II 8 0
764 IRSF J05392077-6902118 * 05 39 20.782 -69 02 11.73   16.78 16.64     O9.5V 8 0
765 VFTS 779 SB* 05 39 21.5356775592 -69 03 18.460220724   15.65 15.46     B1II-Ib 9 0
766 VFTS 780 * 05 39 21.6631587960 -68 57 01.640137680   16.62 16.73     B1.5V 6 0
767 VFTS 781 * 05 39 22.4423307912 -69 15 18.436214700   15.98 15.66     B 6 0
768 VFTS 782 * 05 39 23.8017720096 -69 10 54.525389988   15.83 15.47     O8.5III 8 0
769 [P93] 2151 * 05 39 24.222 -69 06 11.45   17.02 16.83     B1:V 6 0
770 VFTS 786 * 05 39 24.7104320784 -69 12 39.581899632   16.8 16.53     B1-2IIIe+ 5 0
771 VFTS 787 SB* 05 39 24.7893271032 -69 05 51.612840888   16.68 16.53     O9.7III 9 0
772 VFTS 788 * 05 39 25.1060264568 -69 01 30.798554664   16.24 16.15     B1III 6 0
773 VFTS 789 * 05 39 25.6708590840 -69 12 45.465878880   17.09 16.88     B0.5-2V 6 0
774 VFTS 792 * 05 39 28.0902689448 -68 56 58.952263524   15.9 15.96     B2V 6 0
775 VFTS 794 * 05 39 29.1623343312 -68 58 05.061735480   15.84 15.80     B1-2V-IIIe+ 6 0
776 VFTS 795 * 05 39 29.4494982408 -69 09 22.908530808   16.76 16.35     B1III 5 0
777 [RP2006] 268 Em* 05 39 30.0944561544 -68 58 57.777543192 16.23 16.92 16.90     B1-2Ve+ 12 0
778 VFTS 797 * 05 39 30.6375593832 -69 09 26.350501068   14.73 14.68     O3.5V((n))((fc)) 10 0
779 VFTS 798 * 05 39 30.8802658200 -69 13 17.728507524   17.15 16.71     B1V 6 0
780 VFTS 799 * 05 39 31.1316746592 -69 04 36.866220960   16.96 16.86     B0.5-0.7V 7 0
781 VFTS 800 * 05 39 31.450 -69 12 11.41   16.13 15.89     B1-2IIIe+ 5 0
782 VFTS 801 * 05 39 31.6551330792 -68 59 47.469536268   15.87 15.94     B1.5V 7 0
783 BI 258 SB* 05 39 32.5796990664 -69 00 02.549396700 12.94 13.95 14.14     O7.5Vz 9 0
784 VFTS 804 * 05 39 33.7686176016 -69 01 01.989576408   17.08 17.03     B2:V 6 0
785 BI 259 SB* 05 39 34.8741279576 -68 59 48.645058272 12.88 13.89 14.06     O5.5V((fc)):z+O7Vz: 9 0
786 VFTS 807 * 05 39 35.1323140392 -69 10 30.741949668   16.93 16.37     O9.5IIINstr 9 0
787 2MASS J05393576-6907081 SB* 05 39 35.7996780912 -69 07 08.158745712   16.43 16.36     O9.7V+B1:V: 7 0
788 VFTS 811 * 05 39 35.8591612752 -68 59 02.801896908   16.48 16.56     B2V 6 0
789 2MASS J05393611-6904591 SB* 05 39 36.1197168480 -69 04 59.133589536 13.618 14.469 14.319   14.326 O4-5V((fc)) 7 0
790 VFTS 813 * 05 39 36.2066473632 -68 57 29.641949820   16.48 16.54     B2.5Ve 6 0
791 VFTS 814 * 05 39 36.4039454208 -69 01 07.822715412   16.86 16.81     B2.5V 6 0
792 VFTS 815 * 05 39 36.4868548752 -69 12 00.347746824   16.87 16.68     B1.5V 6 0
793 [P93] 2252 * 05 39 37.2089 -69 04 04.254   15.7 15.53     B1II/III 7 0
794 VFTS 819 * 05 39 37.8337763520 -69 13 33.031348968   17.19 16.79     ON8III((f)) 9 0
795 VFTS 821 * 05 39 38.4373596552 -68 58 36.079923000   15.89 16.03     B0V-IV 5 0
796 2MASS J05393847-6909004 Y*? 05 39 38.4779313600 -69 09 00.524329488 15.395 16.028 15.433   14.926 B[e] 6 0
797 [SL63] 639 As* 05 39 39 -69 12.1   12.13 11.53     ~ 28 0
798 VFTS 823 * 05 39 39.060 -69 11 51.61   16.23 16.06     B2-3III:e 5 0
799 VFTS 824 * 05 39 39.170 -69 11 55.29   16.72 16.36     B1.5-2Ve 7 0
800 VFTS 825 * 05 39 39.210 -69 11 41.72   16.53 16.20     B1.5-2V-IIIe 5 0
801 VFTS 826 * 05 39 39.250 -69 11 45.95   15.02 14.85     B1IIn 6 0
802 VFTS 827 SB* 05 39 39.270 -69 11 44.20   15.65 15.34     B1.5Ib 8 0
803 VFTS 829 SB* 05 39 39.6391649088 -69 12 01.376333784   15.54 15.13     B1.5-2II 7 0
804 2MASS J05393973-6904302 SB* 05 39 39.7461072840 -69 04 30.306077508   15.36 15.39     O5-6V(n)((f)) 7 0
805 VFTS 831 s*b 05 39 39.8654630880 -69 12 04.336538364   13.33 13.04     B5Ia 7 0
806 VFTS 832 * 05 39 39.9575900904 -69 11 55.563961812   16.87 16.50     B1V 5 0
807 VFTS 833 * 05 39 40.1596574232 -69 09 02.228124672   17.18 16.96     B1-3V 5 0
808 VFTS 834 * 05 39 40.3184183712 -69 11 43.871117964   15.52 15.19     B1.5III 5 0
809 VFTS 835 * 05 39 40.840 -69 11 52.41           B1Ve 7 0
810 VFTS 836 * 05 39 40.940 -69 11 53.62   15.89 15.71     B1.5IIIe 5 0
811 VFTS 837 * 05 39 41.2544305248 -68 59 37.971987252   15.98 16.07     B1V 6 0
812 VFTS 838 * 05 39 41.7542378616 -69 09 32.450917824   16.09 15.81     B1:II(n) 7 0
813 VFTS 840 * 05 39 42.170 -69 11 48.87   16.98 16.74     B1.5:Ve 6 0
814 VFTS 841 s*b 05 39 42.2474431608 -69 13 28.427050920   16.72 15.83     B2.5Ia 5 0
815 2MASS J05394267-6911512 Y*? 05 39 42.6909103464 -69 11 51.425129724   16.62 16.29     B1-2IIIe+ 6 0
816 VFTS 843 * 05 39 43.3796613720 -69 01 22.370590128   15.83 15.88     O9.5IIIn 10 0
817 [P93] 2305 * 05 39 43.7986684584 -69 05 49.698429720 14.765 15.340 15.196   14.888 B1III 8 0
818 VFTS 846 * 05 39 44.6266858080 -69 14 19.477003380   16.89 16.78     B2.5V 6 0
819 [P93] 2313 * 05 39 45.5830494648 -69 04 26.244846048 14.780 15.474 15.387   15.376 B0.7-1IIIne 8 0
820 2MASS J05394565-6912082 Y*? 05 39 45.6688405272 -69 12 08.255304792   15.79 16.193   15.685 B1.5IIIe+ 6 0
821 VFTS 849 * 05 39 47.3675905752 -68 59 22.027854696   15.06 15.14     O7Vz 9 0
822 VFTS 850 * 05 39 51.1600609632 -69 11 53.611453068   16.33 16.15     B1III 6 0
823 IRSF J05395154-6902226 * 05 39 51.533 -69 02 22.66   15.74 15.83     B2III 7 0
824 IRSF J05395251-6907387 * 05 39 52.5033285288 -69 07 38.685726192   17.11 16.78     B1-2Ve+ 6 0
825 VFTS 854 * 05 39 52.6426992312 -69 00 19.868133492   16.38 16.28     B1-3V-IIIe+ 5 0
826 VFTS 855 * 05 39 53.5480494072 -69 11 31.063787736   15.61 15.34     B3Ib 5 0
827 OGLE LMC-ECL-21898 EB* 05 39 53.7253903872 -69 11 02.282489664   16.43 16.26   16.060 B1.5V 9 0
828 VFTS 859 SB* 05 39 54.5915632224 -69 06 40.153131612   15.69 15.66     O9.5IV+sec 3 0
829 VFTS 860 * 05 39 55.1230235712 -69 11 22.128880344   16.8 16.67     B1.5V 7 0
830 VFTS 864 * 05 39 56.8158773688 -69 01 23.082294036   16.59 16.64     B1.5V 7 0
831 VFTS 866 * 05 40 00.4107779784 -69 01 16.311487116   16.12 16.24     B1.5V 6 0
832 BI 261 * 05 40 01.3303227384 -69 07 59.545637364 13.74 14.76 14.63     B1IbNwk 10 0
833 VFTS 868 * 05 40 04.2951140640 -69 11 02.946628572   16.92 16.65     B2V 6 0
834 VFTS 869 * 05 40 05.5381677072 -69 02 44.984676300   16.81 16.76     B1-1.5V 6 0
835 VFTS 872 * 05 40 07.6250748720 -69 03 23.973697152   16.02 16.09     B0V-IV 7 0
836 VFTS 873 * 05 40 07.6569335592 -69 06 43.946164764   15.28 15.07     ~ 3 0
837 2MASS J05401032-6903050 V* 05 40 10.3314607560 -69 03 04.965498396   15.39 15.37     B1.5IIIe+ 8 0
838 VFTS 875 * 05 40 11.7560972208 -69 00 37.852306452   16.44 16.46     B2V 6 0
839 IRSF J05401249-6903582 * 05 40 12.4823128776 -69 03 58.134329892   16.3 16.30     B3-5III(n)e 7 0
840 VFTS 877 * 05 40 12.8002320504 -69 09 10.286345916   16.54 16.36     B1-3V-IIIe+ 7 0
841 VFTS 879 * 05 40 13.6910236896 -69 05 09.761910936   16.84 16.73     B3V-III 6 0
842 IRSF J05401479-6901044 * 05 40 14.842 -69 01 04.49   16.72 16.66     B1-2Ve_sh 6 0
843 VFTS 881 * 05 40 17.2449275952 -69 06 27.073400508   15.6 15.66     B0.5III 7 0
844 IRSF J05401796-6904171 * 05 40 17.9595441480 -69 04 17.015635848   15.86 15.96     B0V(n) 6 0
845 OGLE LMC-ECL-22070 EB* 05 40 18.0224713032 -69 08 36.027193056   16.62 16.49   16.280 B0.5V 9 0
846 IRSF J05402029-6903119 * 05 40 20.279 -69 03 12.01   15.91 15.90     B1.5V 7 0
847 VFTS 886 * 05 40 21.1904027592 -69 03 29.586666708   16.78 16.82     B1V 6 0
848 2MASS J05402153-6904237 SB* 05 40 21.5346848472 -69 04 23.679500736   14.9 14.96     O9.7:V:+O9.5:V 6 0
849 VFTS 888 * 05 40 22.6206971592 -69 04 06.073010724   16.11 16.18     B0.5V 6 0
850 VFTS 889 * 05 40 23.6621220696 -69 05 14.344674864   16.93 16.56     B1-2Ve 6 0
851 VFTS 890 * 05 40 24.8558225664 -69 09 44.108719812   16.15 16.13     B2V 6 0
852 IRSF J05402573-6906308 * 05 40 25.7226277200 -69 06 30.747142944   16.55 16.48     B2V 6 0
853 VFTS 892 * 05 40 25.9844555088 -69 07 58.147653540   15.74 15.69     O9V 8 0
854 HD 62542 * 07 42 37.2147724128 -42 13 47.831717064   8.21 8.03     B3V 152 0
855 GUM 29 HII 10 24 14.6 -57 46 58           ~ 210 0
856 Cl Trumpler 16 OpC 10 45 00.7 -59 42 00           ~ 484 0
857 * eta Car Em* 10 45 03.545808 -59 41 03.95124 6.37 7.03 6.48 6.123 4.41 LBV 2442 0
858 NGC 3603 OpC 11 15 10.8 -61 15 32           ~ 1068 1
859 NGC 5139 GlC 13 26 47.28 -47 28 46.1           ~ 3433 0
860 NAME Upper Sco Association As* 16 12 -23.4           ~ 1369 1
861 NAME Ophiuchus Molecular Cloud SFR 16 28 06 -24 32.5           ~ 3636 1
862 NAME Cepheus Bubble PoC 21 44 +61.7           ~ 38 0
863 NAME Local Bubble ISM ~ ~           ~ 900 0
864 NAME Local Group GrG ~ ~           ~ 8415 0

To bookmark this query, right click on this link: simbad:objects in 2013A&A...550A.108V and select 'bookmark this link' or equivalent in the popup menu