
C.D.S. - SIMBAD4 rel 1.7 - 2021.06.17CEST02:03:06

2013A&A...550A.108V - Astronomy and Astrophysics, volume 550A, 108-108 (2013/2-1)

The VLT-FLAMES Tarantula Survey. IX. The interstellar medium seen through diffuse interstellar bands and neutral sodium.


Abstract (from CDS):

The Tarantula Nebula (a.k.a. 30 Dor) is a spectacular star-forming region in the Large Magellanic Cloud (LMC), seen through gas in the Galactic disc and halo. Diffuse interstellar bands (DIBs) offer a unique probe of the diffuse, cool-warm gas in these regions. The aim is to use DIBs as diagnostics of the local interstellar conditions, whilst at the same time deriving properties of the yet-unknown carriers of these enigmatic spectral features. Spectra of over 800 early-type stars from the Very Large Telescope Flames Tarantula Survey (VFTS) were analysed. Maps were created, separately, for the Galactic and LMC absorption in the DIBs at 4428 and 6614Å and - in a smaller region near the central cluster R136 - neutral sodium (the Na iD doublet); we also measured the DIBs at 5780 and 5797Å. The maps show strong 4428 and 6614Å DIBs in the quiescent cloud complex to the south of 30Dor but weak absorption in the harsher environments to the north (bubbles) and near the OB associations. The Na maps show at least five kinematic components in the LMC and a shell-like structure surrounding R136, and small-scale structure in the Milky Way. The strengths of the 4428, 5780, 5797 and 6614Å DIBs are correlated, also with Na absorption and visual extinction. The strong 4428Å DIB is present already at low Na column density but the 6614, 5780 and 5797Å DIBs start to be detectable at subsequently larger Na column densities. The carriers of the 4428, 6614, 5780 and 5797Å DIBs are increasingly prone to removal from irradiated gas. The relative strength of the 5780 and 5797Å DIBs clearly confirm the Tarantula Nebula as well as Galactic high-latitude gas to represent a harsh radiation environment. The resilience of the 4428Å DIB suggests its carrier is large, compact and neutral. Structure is detected in the distribution of cool-warm gas on scales between one and >100pc in the LMC and as little as 0.01pc in the Sun's vicinity. Stellar winds from the central cluster R136 have created an expanding shell; some infalling gas is also detected, reminiscent of a galactic ``fountain''.

Abstract Copyright:

Journal keyword(s): ISM: individual objects: Tarantula Nebula (30 Doradus Nebula) - ISM: molecules - ISM: kinematics and dynamics - ISM: lines and bands - ISM: structure - local insterstellar matter

VizieR on-line data: <Available at CDS (J/A+A/550/A108): tablea2.dat tablea3.dat tablea4.dat>

Simbad objects: 864

goto Full paper

goto View the reference in ADS

Number of rows : 864

N Identifier Otype ICRS (J2000)
ICRS (J2000)
Mag U Mag B Mag V Mag R Mag I Sp type #ref
1850 - 2021
1 NAME SMC G 00 52 38.0 -72 48 01   2.79 2.2     ~ 9835 1
2 NAME Magellanic Clouds GrG 03 00 -71.0           ~ 5979 1
3 NAME LMC G 05 23 34.6 -69 45 22     0.4     ~ 15426 1
4 LHA 120-N 51D HII 05 25 17.3 -67 22 47           ~ 108 0
5 VFTS 1 * 05 36 53.390 -69 08 18.29   16.98 16.93     B1.5:V 5 0
6 HD 38029A WR* 05 36 54.633 -69 11 38.08           WC4 54 1
7 HD 38029 ** 05 36 55.17 -69 11 37.7 14.523 11.71 11.56 11.91 11.680 ~ 59 0
8 HD 38029B s*b 05 36 55.178 -69 11 37.47           B1Ia+ 54 1
9 VFTS 4 * 05 36 58.450 -69 06 47.26   17.03 16.87     B2V 5 0
10 VFTS 5 * 05 37 01.7367724164 -69 08 16.284819322   16.27 16.25     B2V(n) 6 0
11 VFTS 7 * 05 37 02.960 -69 02 04.17   16.77 16.74     B1-2V 5 0
12 VFTS 8 * 05 37 03.1001315064 -69 08 22.612558065   16.99 16.92     B0.5:V(n) 6 0
13 VFTS 9 * 05 37 04.2568358115 -69 08 05.717971465   16.29 16.18     B1-1.5V 5 0
14 VFTS 10 * 05 37 04.720 -69 08 56.65   16.83 16.79     B2V 6 0
15 VFTS 12 * 05 37 05.6363641442 -69 09 12.432147655   15.98 15.83     O9.5IIIn 4 0
16 VFTS 13 * 05 37 06.2895104665 -69 04 41.366199384   16.49 16.36     B1.5V 5 0
17 2MASS J05370761-6905062 SB* 05 37 07.619 -69 05 06.22           O8.5Vz 7 0
18 VFTS 15 * 05 37 08.5509209460 -69 05 10.022519990   16.24 16.20     B0.5V 5 0
19 NAME 30 Dor 016 * 05 37 08.8775810516 -69 07 20.377571697 12.623 13.584 13.546   13.816 O2IIIf* 39 0
20 2MASS J05371136-6905041 SB* 05 37 11.365 -69 05 04.19           B0V 6 0
21 VFTS 18 * 05 37 11.4521761460 -69 10 30.927986741   16.79 16.62     B1.5V 5 0
22 Brey 69 WR* 05 37 11.4812136852 -69 07 38.184555289 15.959 16.427 16.301   15.936 WN3o 22 0
23 VFTS 20 * 05 37 14.1012760434 -69 04 02.721499522   16.76 16.70     B2.5:V(n) 5 0
24 VFTS 21 * 05 37 14.3725271022 -69 06 32.515230613   15.66 15.57     O9.5IV 6 0
25 2MASS J05371503-6908428 LP* 05 37 15.032 -69 08 42.81   17.22 16.67 15.534   B0-0.5V-IIIe 4 0
26 VFTS 24 * 05 37 16.6758817755 -69 08 50.339913047   16.39 16.02     B0.2III-II 5 0
27 VFTS 25 * 05 37 16.970 -69 07 54.36   16.24 16.18     B1-1.5V 5 0
28 VFTS 27 EB* 05 37 17.3636429474 -69 07 48.063966311   14.8 14.71   14.639 B1III-II 8 0
29 BI 250 s*b 05 37 17.8520282746 -69 09 46.207896376 13.00 13.72 13.48     B0.7IaNwk 9 0
30 VFTS 29 * 05 37 18.2873655931 -69 03 04.582737152   16.71 16.73     B1V 6 0
31 VFTS 30 * 05 37 18.7977160439 -69 02 13.036303579   16.44 16.34     B3-5e_sh 3 0
32 VFTS 31 * 05 37 20.4859951866 -68 59 52.219157087   16.41 16.41     B1.5V 5 0
33 VFTS 33 * 05 37 22.0435001553 -69 07 55.153736560   16.27 16.20     B1-1.5V 5 0
34 VFTS 34 * 05 37 22.3082262613 -69 07 16.087193127   16.27 16.14     B1.5Ve 5 0
35 VFTS 35 * 05 37 22.7534775747 -69 12 09.795030201   17.08 16.91     O9.5IIIn 5 0
36 VFTS 36 * 05 37 23.6153737335 -69 04 29.749030627   16.71 16.61     B1:Vn 5 0
37 VFTS 37 * 05 37 23.9359505631 -69 12 21.200695261   15.85 15.79     B2III: 5 0
38 VFTS 38 * 05 37 24.3308833099 -69 07 17.117931310   16.6 16.54     B1.5V 5 0
39 AL 367 Em* 05 37 24.6408544022 -69 09 52.872808392   14.548 14.27 14.38   B0:e 6 0
40 [ST92] 1-2 * 05 37 24.76 -69 08 28.9   16.95 17.0     B1V 7 0
41 VFTS 41 * 05 37 24.8794998347 -69 04 15.725167993   17.08 16.94     B2:V 5 0
42 2MASS J05372494-6907427 SB* 05 37 25.1169022477 -69 07 42.611198737   14.54 14.66     O9.5III((n)) 6 0
43 VFTS 43 * 05 37 25.840 -69 07 28.49   16.43 16.49     B2V(n) 5 0
44 VFTS 44 * 05 37 26.060 -69 07 29.29   16.55 16.62     B2V 6 0
45 [M2002] LMC 168287 * 05 37 26.1754497549 -69 09 53.018510811   14.78 14.9     O9.7II((n)) 9 0
46 UCAC2 1803179 SB* 05 37 26.1798604407 -69 08 56.515642421   15.68 15.5 15.48   O9.7Ib-IINwk 6 0
47 IRSF J05372654-6910406 SB* 05 37 26.550 -69 10 40.78   17.19 16.91     O9V+O9.5V 6 0
48 VFTS 48 * 05 37 26.5521683909 -69 07 01.761797032   16.86 16.72     B1V 5 0
49 2MASS J05372687-6903444 SB* 05 37 26.9077410175 -69 03 44.116865143   16.18 16.07     O9.7V:+B 4 0
50 VFTS 50 * 05 37 27.430 -69 10 40.15   16.95 16.77     B0V 6 0
51 UCAC2 1803186 * 05 37 27.8245058582 -69 08 02.849851232 15.043 15.982 15.718 16.06 14.976 B1: 9 0
52 VFTS 52 * 05 37 28.8622095561 -69 07 06.454491428   14.48 14.55     B0.2III-II 6 0
53 VFTS 53 * 05 37 28.9083793951 -69 06 52.793901380   15.37 15.28     B1III 6 0
54 VFTS 54 * 05 37 29.0645615976 -69 13 03.882989195   16.81 16.60     B0V 5 0
55 2MASS J05372905-6903445 SB* 05 37 29.0649794024 -69 03 44.469906289   15.79 15.56     O8.5V+O9.5IV 6 0
56 2MASS J05372909-6908414 SB* 05 37 29.10 -69 08 41.4 15.786 16.517 16.238   15.519 O6.5V+O6.5V 6 0
57 UCAC2 1803197 SB* 05 37 30.0901841856 -69 09 50.929291312 14.946 15.692 15.578 16.09 15.403 O8.5:V+B 6 0
58 2MASS J05373039-6910004 SB* 05 37 30.3847505132 -69 10 00.470878704 15.681 16.443 16.333   16.191 O9.5III: 6 0
59 VFTS 60 * 05 37 30.610 -69 09 12.94   16.74 16.12     B1.5II-Ib((n)) 6 0
60 [M2002] LMC 168477 SB* 05 37 30.7458642427 -69 05 17.474716723   15.49 15.35 15.30 15.28 O8.5V+O9V 11 0
61 VFTS 62 * 05 37 30.8121194243 -69 03 21.863278164   16.42 16.27     B3III 5 0
62 OGLE LMC-ECL-20909 SB* 05 37 30.8749749079 -69 11 48.474333892   14.23 14.4 14.16 14.022 O5III(n)(fc)+sec 10 0
63 OGLE BRIGHT-LMC-ECL-14 SB* 05 37 30.9164810811 -69 11 06.997098192 14.193 14.840 14.621 14.49 13.915 O7.5II(f) 12 0
64 VFTS 65 * 05 37 32.6127502123 -69 06 40.693285237   16.05 15.99     O8V(n) 8 0
65 2MASS J05373309-6904343 SB* 05 37 33.093 -69 04 34.33   15.64 15.54     O9.5III(n) 8 0
66 VFTS 67 * 05 37 33.360 -69 02 47.57   16.99 16.83     O9.5Vz 7 0
67 2MASS J05373352-6907140 LP* 05 37 33.524 -69 07 14.10   16.42 16.114 13.999 13.960 B1-1.5e 7 0
68 [ST92] 1-17 * 05 37 33.7548686891 -69 08 13.188843831 13.069 13.832 13.616 13.52 12.990 B0.7Ib-Iab 8 0
69 VFTS 70 * 05 37 33.8838149800 -69 08 58.256780996   17.13 16.85     O9.7II 9 0
70 VFTS 71 * 05 37 34.2025443866 -69 06 39.241920874   16.68 16.65     B1:V 5 0
71 2MASS J05373447-6909095 SB* 05 37 34.4576022840 -69 09 09.406322196   16.52 16.3     O9.5III 7 0
72 BI 253 * 05 37 34.4596743399 -69 01 10.179743278 12.765 13.650 13.669   13.742 O2V(f*) 41 0
73 [M2002] LMC 168648 * 05 37 34.5461720448 -69 10 10.197419402 15.788 16.563 16.386   16.255 O9Vn 9 0
74 VFTS 75 * 05 37 34.6780574035 -69 07 13.291645057   16.96 16.93     B1V 6 0
75 UCAC2 1803216 * 05 37 34.7984164810 -69 08 01.273228649   15.43 15.4 15.50   O9.2III 8 0
76 2MASS6X J05373512-6909411 * 05 37 35.1304003120 -69 09 41.198254581 16.016 16.729 16.635   16.552 O9.5:IIIn 10 0
77 VFTS 78 * 05 37 35.4289094285 -69 07 57.087228542   16.84 16.63     B1V 5 0
78 Brey 70a WR* 05 37 35.7057107734 -69 08 40.253264123 17.387 17.957 16.924   16.324 WN4b/WCE 26 0
79 [ST92] 1-23 * 05 37 35.7370178256 -69 08 07.471520536 15.739 16.528 16.297   15.927 O9.7II-III((n)) 12 0
80 RM 1-703 s*r 05 37 35.9783425353 -69 12 29.805752180   15.68 13.732   11.695 K4Iab-Ib 16 0
81 VFTS 82 * 05 37 36.0825500860 -69 06 44.944003146   13.55 13.61     B0.5Ib-Iab 6 0
82 VFTS 83 * 05 37 36.3290709834 -69 05 01.108701455   16.01 15.91     B1.5V 5 0
83 VFTS 84 * 05 37 36.5077859660 -69 09 59.263061463   17.02 16.84     B1.5V 5 0
84 VFTS 85 * 05 37 36.5130011349 -69 01 41.311528923   16.4 16.48     B1.5V 5 0
85 2MASS J05373664-6907318 SB* 05 37 36.6555370496 -69 07 31.828176761   13.44 13.58     O9.7Ib-II 9 0
86 SSTISAGE1C J053736.75-690633.4 * 05 37 36.8143238316 -69 06 33.183179396   15.18 15.24     B 6 0
87 [ST92] 1-25 * 05 37 36.8661763345 -69 08 22.752540834 15.542 16.367 16.193   15.842 O6.5V((f))zNstr 11 0
88 2MASS J05373714-6910181 SB* 05 37 37.1420500124 -69 10 18.088475333 15.240 15.965 16.044   15.485 O9.5V 6 0
89 [ST92] 1-27 * 05 37 37.5281291158 -69 08 20.457303894 15.424 16.202 16.068   15.692 O9.5IIIn 10 0
90 2MASS J05373778-6905455 SB* 05 37 37.7975947472 -69 05 45.491593342   15.13 15.03     O9.2III-IV 9 0
91 [ST92] 1-28 LP* 05 37 37.9621434487 -69 10 14.737501051 13.515 14.211 14.161   13.713 O3.5Inf*p+sec? 13 0
92 2MASS J05373854-6910199 SB* 05 37 38.5064292313 -69 10 19.870778041 12.875 13.744 13.710   13.555 O6V((n))((fc))z 9 0
93 VFTS 95 * 05 37 38.5124917194 -69 06 04.426311096   16.04 16.06     B0.2V 7 0
94 [ST92] 1-31 * 05 37 38.7396708212 -69 10 27.579390150   16.37 16.4     B0IV 8 0
95 OGLE LMC-ECL-20975 SB* 05 37 38.80 -69 08 08.5   15.22 15.4 15.18 14.853 O9III(n) 7 0
96 VFTS 99 * 05 37 38.800 -68 58 31.83   16.75 16.78     B2-2.5V 3 0
97 VFTS 100 * 05 37 38.9112809099 -69 10 08.247752360   16.9 16.68     B1.5V 5 0
98 [ST92] 1-33 * 05 37 39.19 -69 08 40.9 16.025 16.832 16.528   15.907 B1V 7 0
99 UCAC2 1803231 * 05 37 39.2305260100 -69 09 51.024963212 15.220 16.099 15.806 16.07 15.118 O9:Vnnne+ 23 0
100 VFTS 103 * 05 37 39.2477510688 -69 11 34.348875553   16.67 16.20     O8.5III((f)) 7 0
101 IRSF J05373989-6905468 * 05 37 40.036 -69 05 47.41   16.19 16.20     O9.7II-III((n)) 9 0
102 VFTS 106 * 05 37 40.2049772409 -69 04 12.051302981   16.48 16.43     B0.2V 5 0
103 OGLE LMC-ECL-20987 SB* 05 37 40.248 -69 10 46.35 14.544 14.845 15.227   14.641 O8:Vz+O9-B0 8 0
104 VFTS 107 * 05 37 40.3965038535 -69 05 54.047088994   16.74 16.68     B1:V 5 0
105 HD 269883 WR* 05 37 40.494 -69 07 57.71 13.454 14.184 14.077 14.03 13.492 WN7h 41 0
106 VFTS 109 * 05 37 40.6000 -69 07 59.993   16.53 16.6     O9.7II:n 10 0
107 VFTS 111 * 05 37 40.8633270666 -69 00 04.143096596   14.32 14.40     B2III 6 0
108 VFTS 110 * 05 37 40.870 -69 10 48.44   15.76 15.7     O6V((n))z 8 0
109 OGLE LMC-ECL-20994 EB* 05 37 40.8757038855 -69 04 41.464767873   16.27 16.19 16.18 15.905 B+B 8 0
110 2MASS J05374092-6908442 SB* 05 37 40.8981993449 -69 08 44.203046852 16.052 16.829 16.633   16.491 O9/B0 12 0
111 2MASS J05374112-6910378 SB* 05 37 41.13 -69 10 37.8 14.871 15.761 15.368   15.383 O8.5IV+sec 8 0
112 2MASS J05374144-6909191 SB* 05 37 41.4445661429 -69 09 19.132364333 15.904 16.542 16.534   16.165 O9.7:V:+B0:V: 8 0
113 VFTS 117 * 05 37 41.470 -69 10 46.96   16.82 16.64     O6:Vz 7 0
114 VFTS 118 * 05 37 41.5900279378 -69 08 08.655780594   16.41 16.21     B1IV 5 0
115 VFTS 119 * 05 37 41.7166252359 -69 07 28.144290769   16.43 16.36     B0.7V 7 0
116 OGLE LMC517.01.010105 SB* 05 37 41.9528744107 -69 08 33.394506505 14.195 14.985 14.917 15.09 14.749 O9.5IV: 8 0
117 VFTS 121 * 05 37 42.2247337008 -69 07 14.320602098   16.02 15.96     B1IV 6 0
118 VFTS 123 * 05 37 42.4415181413 -69 12 21.453948635   15.88 15.78     O6.5Vz 8 0
119 [ST92] 1-46 * 05 37 42.59 -69 09 18.9 16.253 16.778 16.634   16.375 B2.5III 8 0
120 VFTS 122 Y*O 05 37 42.63 -69 09 43.6   16.77 16.53     B1.5V 8 0
121 VFTS 125 * 05 37 42.950 -69 10 35.12   16.87 16.6     F5 9 0
122 VFTS 126 * 05 37 42.960 -69 01 05.34   16.71 16.78     B1V 6 0
123 VFTS 127 * 05 37 43.370 -69 10 45.91   17 16.93     B2:V(n) 5 0
124 [M2002] LMC 169061 * 05 37 43.4022399966 -69 09 58.997881295   16.32 16.5     O9.5III:((n)) 11 0
125 VFTS 130 * 05 37 43.680 -69 10 50.47   16.83 16.67     O8.5V((n)) 7 0
126 VFTS 131 * 05 37 43.7432639772 -69 10 22.135175385   16.88 16.77     O9.7 8 0
127 [M2002] LMC 169093 * 05 37 43.9490933033 -69 09 39.023613174 14.784 15.983 15.780   15.890 O9.5Vz 9 0
128 VFTS 133 * 05 37 43.980 -69 06 34.41   16.01 16.03     B0.5V 5 0
129 VFTS 134 * 05 37 44.0698837937 -69 05 26.987223472   16.87 16.85     B1V(n) 5 0
130 VFTS 135 * 05 37 44.210 -69 06 37.29   16.02 16.01     B1:V-IIIne 5 0
131 HD 269888 WR* 05 37 44.6347648981 -69 14 25.676649551 14.413 14.772 14.628 14.81 14.761 WR 41 0
132 [ST92] 1-55 * 05 37 44.7095198093 -69 09 18.233711663   16.96 17.1     B1V 7 0
133 VFTS 138 * 05 37 45.0366544692 -69 02 29.576476757   15.54 15.63     O9Vn 7 0
134 [M2002] LMC 169159 SB* 05 37 45.2307 -69 10 13.587 15.506 16.145 15.898   15.762 O8.5Vz 8 0
135 [ST92] 1-60 SB* 05 37 45.4999 -69 11 09.507   15.55 15.6     O3.5V((fc)) 6 0
136 VFTS 141 * 05 37 45.740 -69 09 13.33   15.36 15.32     O9.5II-III((n)) 11 0
137 [ST92] 1-58 * 05 37 45.8912237038 -69 10 21.982633284 15.790 16.327 16.167   15.944 O6:V 9 0
138 VFTS 144 * 05 37 46.080 -69 09 14.37   16.81 16.81     B0.7:V 5 0
139 VFTS 145 SB* 05 37 46.080 -69 09 08.85   14.49 14.30     O8fp 8 0
140 IRSF J05374609-6906349 * 05 37 46.089 -69 06 34.79   16.49 16.24     B2:V 5 0
141 VFTS 148 SB* 05 37 46.2767616619 -69 00 06.216749239   16 16.04     O9.7II-III(n) 6 0
142 [M2002] LMC 169203 * 05 37 46.3024834822 -69 08 20.687131983 15.863 16.667 16.570   16.316 O9.5V 10 0
143 Brey 73 WR* 05 37 46.3440 -69 09 09.360   12.222 12.11     WN6(h) 34 1
144 IRSF J05374638-6909120 SB* 05 37 46.410 -69 09 12.15   15.42 15.30     O9.5III 4 0
145 VFTS 151 SB* 05 37 46.520 -69 09 08.79           O6.5II(f)p 10 0
146 VFTS 152 * 05 37 46.6908854903 -69 06 19.531902312   15.57 15.32     B2IIIe 7 0
147 IRSF J05374670-6909112 ** 05 37 46.710 -69 09 11.27   15.36 15.30     O9III((n)) 8 0
148 VFTS 154 SB* 05 37 47.090 -69 09 07.70   14.99 14.94     O8.5V 8 0
149 VFTS 155 * 05 37 47.1690302282 -69 13 13.496672869   17.03 16.95     B0.7:V 5 0
150 [ST92] 1-64 * 05 37 47.187 -69 09 03.11 16.026 16.714 16.517   18.408 B1-1.5V-IIIe+ 7 0
151 OGLE LMC-ECL-21035 EB* 05 37 47.2294693661 -68 58 49.176940639   16.61 16.69   16.897 B2V 7 0
152 VFTS 158 * 05 37 47.4234169897 -69 04 12.670769331   15.53 15.33     B1-1.5Ve+ 5 0
153 VFTS 159 * 05 37 47.6641028553 -69 00 35.018580997   15.58 15.61     B2.5III 5 0
154 [ST92] 1-65 SB* 05 37 47.800 -69 09 14.86   14.2 14.3     O9.5III((n)) 8 0
155 VFTS 161 * 05 37 47.910 -69 10 41.13   16.93 16.69     B1V 5 0
156 VFTS 163 * 05 37 48.0573157328 -69 09 26.307061839   16.74 16.21     O8.5IV 5 0
157 VFTS 162 * 05 37 48.060 -69 09 59.88   16.56 16.49     B0.7V 5 0
158 [ST92] 1-67 * 05 37 48.1970376991 -69 09 31.482911263 16.419 17.330 16.931   15.845 B1: 7 0
159 [M2002] LMC 169297 s*b 05 37 48.330 -69 09 15.22   13.79 13.8     O9.7Iab 5 0
160 IRSF J05374838-6902376 * 05 37 48.372 -69 02 37.90   17.09 16.93     B 5 0
161 VFTS 167 * 05 37 48.810 -69 09 15.88   16.08 16.07     B1V 7 0
162 VFTS 168 * 05 37 49.5087828811 -69 12 33.067114953   15.54 15.46     O8.5Vz 7 0
163 [M2002] LMC 169366 * 05 37 49.9182694477 -69 10 27.884729986 13.649 14.619 14.437   14.224 O2.5V(n)((f*)) 11 0
164 VFTS 170 * 05 37 49.9923827002 -69 07 42.090301068   16.18 16.03     B1IV 6 0
165 UCAC2 1803283 SB* 05 37 50.011 -69 09 59.99 13.096 13.699 13.840 14.11 13.900 O7-8III((f)) 12 0
166 VFTS 172 SB* 05 37 50.130 -69 10 01.58           O9III((f)) 7 0
167 OGLE LMC-ECL-21065 SB* 05 37 50.40 -69 08 54.4 15.945 16.541 16.499   15.698 B0V 8 0
168 2MASS J05375064-6908483 SB* 05 37 50.6499097901 -69 08 48.340456080   15.75 15.7     O8V+B0:V: 8 0
169 UCAC2 1803287 * 05 37 50.7795126057 -69 11 35.489054102   16.3 16.2 16.34   ~ 3 0
170 [ST92] 1-77 SB* 05 37 50.9569218135 -69 11 00.205866528   14.81 15.0   14.570 O6V:((f))+O9.5:V: 12 0
171 VFTS 177 * 05 37 51.0239394073 -69 06 10.525166335   14.87 14.63     O7n(f)p 7 0
172 TYC 9163-983-1 s*b 05 37 51.0379769443 -69 09 33.879108515   12.46 12.77 12.89   O9.7Iab 14 0
173 VFTS 179 * 05 37 51.180 -69 09 37.44   17.02 16.93     B1V 5 0
174 Brey 74a WR* 05 37 51.3383720439 -69 09 46.692195685 12.483 13.474 13.446 13.62 13.278 O3If* 31 0
175 VFTS 181 * 05 37 51.3821288112 -69 12 40.706777737   16.39 16.24     B0.5V 5 0
176 NGC 2060 SNR 05 37 51.4470067818 -69 10 23.957283532   9.69 9.59     ~ 328 2
177 VFTS 183 * 05 37 51.4944491998 -69 11 25.473911030   16.89 16.51     B0IV 7 0
178 2MASS J05375180-6904248 SB* 05 37 51.8211995480 -69 04 24.745865750   15.29 15.38     O6.5Vnz 5 0
179 [M2002] LMC 169451 * 05 37 51.9316690463 -69 09 20.755689402   14.52 14.7     O7.5III((f)) 9 0
180 VFTS 186 * 05 37 52.0289699793 -69 04 39.796642056   15.9 15.79     B1IV 5 0
181 UCAC2 1803297 SB* 05 37 52.1756884488 -69 11 31.275148158   16.03 16.0 15.87   O9IV:+B0:V: 8 0
182 VFTS 188 * 05 37 52.3994305420 -69 10 51.202380930   17.12 16.82     O9.7:III: 9 0
183 [ST92] 1-82 EB* 05 37 52.8501638204 -69 09 45.759084753   16.41 16.5 16.31 16.082 B2V 11 0
184 VFTS 190 * 05 37 53.2933486132 -69 12 57.236724964   14.63 14.67     O7Vnn((f))p 5 0
185 UCAC2 1803301 SB* 05 37 53.4140506894 -69 10 23.411038336   15.86 14.1 16.10   O9.5V 6 0
186 [ST92] 1-85 * 05 37 53.6407 -69 10 12.488   16.22 16.3     O9/B0 11 0
187 VFTS 194 * 05 37 54.200 -69 05 46.18   16.2 16.08     B2V-IIIe+ 5 0
188 VFTS 195 * 05 37 54.2147981249 -69 05 17.800874912   16.92 16.86     B0.5V 5 0
189 VFTS 196 * 05 37 54.2671432603 -69 01 44.555891871   15.63 15.58     B2IIIe+ 5 0
190 UCAC2 1803303 SB* 05 37 54.4519440873 -69 09 41.529691040 12.897 13.591 13.702 13.92 13.631 O9III 10 0
191 VFTS 199 * 05 37 54.780 -69 00 24.99   16.9 16.91     B+B 4 0
192 [ST92] 1-89 * 05 37 54.9500252780 -69 10 12.504966618 14.265 14.944 14.634 15.00 14.599 B1/1.5IIIe+ 7 0
193 VFTS 203 * 05 37 55.010 -69 04 00.52   16.75 16.77     B1-1.5V 5 0
194 IRSF J05375503-6907022 * 05 37 55.043 -69 07 02.23   16.44 16.13     B2III 5 0
195 2MASS J05375504-6911323 SB* 05 37 55.047 -69 11 32.31   16.59 16.43     O9.7V+sec 6 0
196 2MASS J05375509-6908549 * 05 37 55.10 -69 08 55.0   16.29 16.4     B2V 8 0
197 [M2002] LMC 169602 * 05 37 55.3907310444 -69 10 20.796212803   15.9 16.1     O9/B0 11 0
198 OGLE LMC-DPV-105 EB* 05 37 55.4367478849 -68 57 06.899350507   15.14 15.019   14.841 B3III: 7 0
199 [M2002] LMC 169636 * 05 37 56.0837949249 -69 10 38.931397722   16.31 16.4     O9.7II((n)) 11 0
200 [ST92] 1-93 SB* 05 37 56.2195544699 -69 11 50.772424631 14.388 15.069 14.798 14.72 14.239 O6Iafnp 13 0
201 VFTS 209 * 05 37 56.5906930029 -69 03 48.569988685   16.27 16.33     B1V 6 0
202 UCAC2 1803310 * 05 37 56.9565885355 -69 08 21.163171095   15.6 15.8 15.95   O9.7II-III((n)) 10 0
203 VFTS 211 * 05 37 57.340 -68 58 41.89   16.44 16.56     B1V 5 0
204 OGLE LMC517.01.010101 EB* 05 37 57.8772973559 -69 08 48.779123870 14.469 15.276 15.288 15.73 15.310 B1III 8 0
205 UCAC2 1803313 * 05 37 57.9544316446 -69 09 54.010152327 14.442 15.385 15.182 15.98 15.422 B2V 7 0
206 VFTS 214 * 05 37 58.0062355460 -69 13 09.484263042   16.11 15.84     B0IV-III 7 0
207 OGLE LMC-ECL-21128 EB* 05 37 58.0421098473 -69 02 23.423532845   16.55 16.58   16.612 B1.5V 7 0
208 UCAC2 1803316 * 05 37 59.0527809170 -69 11 56.711100412 13.935 14.655 14.389 14.49 14.035 O4V((fc)) 10 0
209 [ST92] 1-98 SB* 05 37 59.4836329909 -69 09 01.667220015   13.68 13.744 13.90 13.711 O4V((fc)):+O5V((fc)): 16 0
210 UCAC2 1803321 * 05 37 59.7132361991 -69 11 14.200558949   16.01 15.8 16.01   B1.5V 6 0
211 VFTS 219 * 05 37 59.8090659901 -69 03 35.401843443   16.97 16.93     B3-5V-III 6 0
212 NAME 30 Dor Region reg 05 38.0 -69 06           ~ 189 0
213 VFTS 220 * 05 38 00.400 -69 08 27.90   16.69 16.66     B0.7V 5 0
214 VFTS 221 * 05 38 00.4168922677 -69 03 45.691049184   16.19 16.27     B1V 5 0
215 UCAC2 1803324 SB* 05 38 00.6041607699 -69 08 41.809910332   14.72 14.8 15.15   O9.5IV 9 0
216 VFTS 224 * 05 38 00.8256574100 -69 03 59.693884690   16.13 16.02     B1-2V-IIIe+ 5 0
217 VFTS 225 * 05 38 00.9586957543 -68 57 23.173262684   15.06 15.07     B0.7-1III-II 6 0
218 VFTS 226 * 05 38 00.9961404318 -69 14 21.677187154   15.89 15.92     O9.7III 9 0
219 VFTS 227 * 05 38 01.310 -69 03 13.91   16.42 16.51     B2V 5 0
220 VFTS 228 * 05 38 01.6937228042 -69 01 34.769243308   16.42 16.46     B0.7V 5 0
221 VFTS 229 * 05 38 02.9495236668 -69 02 19.111394170   16.48 16.48     B1.5Vn 5 0
222 VFTS 230 * 05 38 04.4216971516 -69 07 57.827898084   17.03 16.59     B1.5III 5 0
223 2MASS J05380470-6908530 SB* 05 38 04.7039786617 -69 08 52.880748571   16.29 16.4     O9.7IV:(n)+sec 7 0
224 [ST92] 1-104 s*b 05 38 04.7672847132 -69 09 05.433628539 14.473 14.945 14.598 14.55 13.882 B3Ia 8 0
225 VFTS 233 * 05 38 04.8184442057 -69 11 22.389058890   16.63 16.40     B1-2V-IIIe 5 0
226 VFTS 234 * 05 38 06.2859709763 -69 06 52.893105198   16.33 16.22     B1.5V 5 0
227 VFTS 235 * 05 38 06.3510038981 -69 05 14.267115138   15.42 15.48     O9.7III 6 0
228 IRSF J05380673-6909324 * 05 38 06.539 -69 09 32.75   16.43 16.41     B1V 5 0
229 VFTS 237 * 05 38 06.630 -69 14 06.96   15.99 15.93     B1-1.5V-IVe 6 0
230 VFTS 238 * 05 38 06.6729621130 -69 03 59.112298443   16.83 16.84     B2.5V 5 0
231 OGLE LMC-ECL-21179 EB* 05 38 06.773 -69 06 08.62   15.86 15.85   16.208 B1-2V(SB2) 7 0
232 VFTS 241 * 05 38 07.090 -69 04 14.77   16.62 16.65     B0IV 7 0
233 VFTS 242 * 05 38 07.8303202055 -69 00 57.008581773   16.86 16.82     B0IV 7 0
234 2MASS J05380840-6909190 SB* 05 38 08.4068133697 -69 09 18.976365899   15.47 15.26     O7V(n)((f)) 5 0
235 2MASS J05380840-6905446 SB* 05 38 08.4090067772 -69 05 44.490335058   13.94 14.04     O5III(n)(fc) 7 0
236 VFTS 246 * 05 38 08.8553014381 -69 10 39.930128798   17.28 16.83     B1III 5 0
237 VFTS 247 * 05 38 08.8961980982 -69 08 16.837668484   16.9 16.88     B2V 5 0
238 OGLE LMC-ECL-21192 EB* 05 38 09.3074070932 -69 10 14.204321860   16.49 16.49   16.406 B2:V 7 0
239 VFTS 249 * 05 38 09.5610508731 -69 06 53.960362645   15.49 15.52     O8Vn 7 0
240 2MASS J05380995-6902310 * 05 38 09.957 -69 02 31.06   15.33 15.46     O8.5Vz 8 0
241 VFTS 251 * 05 38 10.2342746020 -69 05 04.692326355   15.57 15.62     O9.5IV 6 0
242 VFTS 250 * 05 38 10.2365259214 -69 08 56.390148553   15.76 15.74     O9.2V((n)) 7 0
243 VFTS 253 * 05 38 10.3769069968 -69 14 33.698340576   15.22 15.18     O9.5II 6 0
244 VFTS 254 * 05 38 10.410 -69 05 17.67   16.93 16.90     B1-2Ve 5 0
245 OGLE LMC-ECL-21204 EB* 05 38 11.05 -69 07 19.6   16.7 16.68   16.345 B2:V 7 0
246 2MASS J05381132-6904492 SB* 05 38 11.3068646981 -69 04 49.218759483   14.92 15.02     O7.5-8V((n))z 5 0
247 VFTS 257 * 05 38 11.3938786340 -69 14 24.571248318   16.66 16.70     B0.7-1.5V 5 0
248 VFTS 258 * 05 38 11.5678436913 -69 11 42.339526508   16.44 16.34     B1.5V 5 0
249 VFTS 259 s*b 05 38 12.0223961940 -69 06 34.169823523   13.86 13.65     O6Iaf 9 0
250 TYC 9163-958-1 s*b 05 38 12.3342083548 -69 00 57.322124591   12.32 12.52     B5Ia 7 0
251 VFTS 263 * 05 38 12.5487047593 -69 03 51.780132116   16.85 16.80     B 5 0
252 VFTS 265 * 05 38 12.9281122817 -69 05 14.684694166   16.23 16.05     ~ 2 0
253 VFTS 266 * 05 38 13.2873287973 -69 11 18.913864321   15.5 15.38     O8V((f))z 7 0
254 2MASS J05381396-6907477 SB* 05 38 13.9611988165 -69 07 47.730724200   13.44 13.49     O3III-I(n)f* 13 0
255 OGLE LMC-LPV-76162 LP* 05 38 14.733 -69 03 29.51   16.76 17.122   15.408 B1.5Ve+ 8 0
256 RMC 132 s*b 05 38 14.8988360599 -69 03 48.519323602   12.95 12.90 13.00 12.66 B0.5Ia 20 1
257 [HBC93] 256 * 05 38 15.140 -69 04 01.18   14.28 14.35     B3Ib 10 0
258 VFTS 272 Be* 05 38 15.590 -69 04 02.22   15.99 16.00     B3:IIIe+_sh? 5 0
259 VFTS 273 * 05 38 15.6092778925 -69 12 12.079858118   16.77 16.74     B2.5V 6 0
260 VFTS 274 * 05 38 15.8586527621 -69 09 31.482325865   16.93 16.94     B1V(n) 5 0
261 H88 301 Cl* 05 38 16 -69 04.0   11.18 10.89     ~ 66 0
262 VFTS 276 Be* 05 38 16.000 -69 03 54.72   15.71 15.84     B1.5V 6 0
263 2MASS J05381611-6909168 SB* 05 38 16.0997624628 -69 09 16.671395276   15.05 15.04     O9V 5 0
264 VFTS 278 * 05 38 16.210 -69 04 04.01   16.75 16.82     B2.5V 5 0
265 VFTS 279 Be* 05 38 16.440 -69 03 51.15   16.78 16.73     B2:Ve+ 6 0
266 VFTS 280 * 05 38 16.5482428946 -69 04 53.196251802   15.4 15.40     O9V((n)) 7 0
267 [GC2000] Be7 Be* 05 38 16.840 -69 03 57.17   16.05 16.11     B3-5III(n)e 6 0
268 VFTS 283 Be* 05 38 16.9995 -69 03 49.010   15.3 15.31     B1.5V-III(n)e 12 0
269 IRSF J05381724-6909110 * 05 38 17.195 -69 09 11.82   16.82 16.84     B1V 6 0
270 IRSF J05381734-6904479 * 05 38 17.333 -69 04 47.81   15.75 15.83     B0.7V 5 0
271 VFTS 285 * 05 38 17.340 -69 05 42.14   15.57 15.63     O7.5Vnnn 13 0
272 VFTS 287 Be* 05 38 17.350 -69 03 56.48   16.5 16.58     B2.5Vne 6 0
273 VFTS 288 * 05 38 17.5830180322 -69 07 24.154139517   16.71 16.58     B2.5III:n 5 0
274 VFTS 290 * 05 38 17.720 -69 05 45.88   15.71 15.67     O9.5IV 7 0
275 [HBC93] 275 * 05 38 17.7213338758 -69 03 38.551991647   14.97 14.85     B5II-Ib 10 0
276 VFTS 292 * 05 38 17.780 -69 03 55.90   16.33 16.47     B2.5V(n) 5 0
277 [HBC93] 250 Be* 05 38 17.9993 -69 04 07.989   14.91 14.731   14.488 B2III-II(n)e 11 0
278 VFTS 295 * 05 38 18.2434398064 -68 57 26.184766643   16.26 16.33     B0-0.5V 5 0
279 VFTS 296 * 05 38 18.2696199611 -69 11 06.342536177   15.44 15.45     B2III 5 0
280 IRSF J05381841-6903517 * 05 38 18.370 -69 03 52.03   16.68 16.64     B1.5V 6 0
281 VFTS 298 * 05 38 18.4797469337 -69 09 20.405203462   16.92 16.68     B1-2V-IIIe+ 5 0
282 VFTS 299 * 05 38 18.5115904106 -69 12 28.016997372   16.31 16.36     B0.5V 5 0
283 VFTS 300 * 05 38 18.5766385621 -69 01 51.907902407   16.38 16.41     B1-2Vn 5 0
284 VFTS 301 Be* 05 38 18.840 -69 03 59.64           B2:Ve+ 7 0
285 VFTS 302 * 05 38 18.9941251578 -69 11 12.709802948   15.85 15.53     B1.5Ib 6 0
286 2MASS J05381905-6906346 ** 05 38 19.058 -69 06 34.68   15.39 15.39     O9.5IV 7 0
287 VFTS 304 * 05 38 19.1153586615 -69 04 58.123926600   15.86 15.94     O9.7III 6 0
288 VFTS 305 * 05 38 19.2138395915 -68 57 37.383968417   16.49 16.59     B2:V 5 0
289 Cl* NGC 2070 MEL 80 * 05 38 19.2536195732 -69 06 00.532645934   14.11 14.08     O8.5II((f)) 10 0
290 SK -68 136 * 05 38 19.2963563516 -68 57 15.702297201   13.5 13.6     B1II-Ib 8 0
291 VFTS 308 * 05 38 19.400 -69 04 03.10   15.87 15.88     B2V 6 0
292 2MASS J05381969-6904104 * 05 38 19.69 -69 04 10.4   16.19 16.19     B2V-III 6 0
293 VFTS 310 * 05 38 19.8430565602 -69 03 52.376323244   16.94 16.91     O9.7V: 7 0
294 VFTS 313 * 05 38 20.3763922076 -69 06 22.761624858   16.39 16.32     B0IV 8 0
295 OGLE LMC-ECL-21259 SB* 05 38 20.4178621741 -69 03 10.353287183   16.09 16.06   15.972 O9.7IV:(n)+sec: 8 0
296 VFTS 315 * 05 38 20.5975604268 -69 15 37.810022469   14.84 14.81     B1Ib 7 0
297 VFTS 316 * 05 38 20.870 -69 06 17.24   16.05 15.97     O9.7V: 6 0
298 VFTS 318 SB* 05 38 20.9276575392 -69 12 00.115231415   16.49 16.56     O((n))p 5 0
299 2MASS J05382113-6906169 * 05 38 21.131 -69 06 17.00   16.34 16.11     B1-2V-IIIe+ 7 0
300 VFTS 321 * 05 38 21.3282915001 -69 07 51.175566437   16.86 16.89     B1:V 5 0
301 [P93] 6 * 05 38 21.605 -69 03 14.27   16.93 16.76     B1.5-2Ve+ 5 0
302 VFTS 324 * 05 38 21.8849054070 -69 12 48.009352488   15.4 15.53     B0.2V 5 0
303 OGLE LMC-ECL-21273 EB* 05 38 21.9703198508 -69 06 00.005927102   16.81 16.84   16.772 B1V 8 0
304 VFTS 326 * 05 38 22.2688299353 -69 08 07.863574390   16.47 16.53     B1-2Vn 5 0
305 2MASS J05382227-6907508 SB* 05 38 22.2708418262 -69 07 50.816473388   15.34 15.33     O8.5V(n)+sec 11 0
306 VFTS 328 * 05 38 22.3265603628 -69 13 15.222824718   15.79 15.90     O9.5III(n) 9 0
307 2MASS J05382240-6905216 SB* 05 38 22.409 -69 05 21.62   15.55 15.55     O9.7II-III(n) 5 0
308 VFTS 330 * 05 38 22.7048375353 -69 09 41.803301545   16.32 16.14     B2III(n)e 5 0
309 VFTS 331 * 05 38 23.2784157952 -69 12 54.019416453   16.65 16.71     B1.5V 6 0
310 Cl* NGC 2070 MEL 70 SB* 05 38 23.3084133972 -69 07 16.085330832 13.332 14.261 14.169   14.051 O9.2II-III 16 0
311 RMC 133 SB* 05 38 23.7091310171 -69 05 03.565883616   12.43 12.49     O7/8II 28 0
312 VFTS 334 * 05 38 24.020 -69 05 23.99   16.2 16.26     B0.7V 5 0
313 VFTS 335 * 05 38 24.2993069974 -69 06 28.105911751   16.47 16.29     B2.5III 5 0
314 OGLE LMC-ECL-21300 EB* 05 38 25.5872046004 -69 06 09.241705416   15.92 15.92   15.882 B1V 8 0
315 [P93] 76 * 05 38 25.6086801967 -69 06 04.314726123 15.263 16.167 16.142   15.750 O9?V: 6 0
316 VFTS 338 * 05 38 26.2018655678 -69 03 38.777816501   17.3 16.82     ~ 2 0
317 2MASS J05382624-6905019 * 05 38 26.2230109292 -69 05 01.820560677 13.996 14.810 14.826   14.992 O9.5IV(n) 8 0
318 VFTS 340 * 05 38 26.5675434013 -69 05 31.621586494   17.13 16.89     B0.7V 5 0
319 VFTS 342 * 05 38 26.8736835479 -69 04 17.849801827   16.9 16.94     B1V 6 0
320 VFTS 343 * 05 38 27.040 -69 04 46.63   16.49 16.45     B1-1.5V 5 0
321 2MASS J05382742-6908094 SB* 05 38 27.4122612037 -69 08 09.394775363   15.54 15.57     O9.7III(n) 6 0
322 VFTS 346 * 05 38 27.7586473142 -69 06 06.725267960   16.37 16.30     O9.7III 9 0
323 VFTS 347 * 05 38 27.8036115242 -69 05 27.233127879   16.69 16.68     B0V 7 0
324 [P93] 118 * 05 38 27.821 -69 03 36.29   16.31 16.27     B0.7V 5 0
325 VFTS 349 * 05 38 27.9985718191 -69 04 09.394595794   16.47 16.50     B1V 5 0
326 2MASS J05382805-6906290 SB* 05 38 28.0596468216 -69 06 29.062174035   15.07 14.95     O8V 12 0
327 VFTS 351 * 05 38 28.4037578806 -69 06 40.910352173   16.06 15.98     B0.5V 5 0
328 OGLE BRIGHT-LMC-ECL-9 SB* 05 38 28.4557395709 -69 11 19.134790412   14.28 14.485   14.385 O4.5V(n)((fc)):z:+O5.5V(n)((fc)):z: 23 0
329 VFTS 353 * 05 38 28.5416529345 -69 07 51.193291964   16.73 16.60     B2V-III 6 0
330 VFTS 354 * 05 38 28.550 -69 04 32.52   15.91 15.91     B0.5:Vn 5 0
331 2MASS J05382913-6857393 SB* 05 38 29.1463015987 -68 57 39.329312287   13.93 14.12     O4V((n))((fc))z 7 0
332 VFTS 356 * 05 38 29.2078948089 -69 09 13.769395840   16.03 15.87     O6:V(n)z 7 0
333 [P93] 158 * 05 38 29.3787014713 -69 08 50.459291904   16.87 16.87     B0.5:V 6 0
334 VFTS 359 * 05 38 29.390 -69 05 59.19   16.33 16.30     B0.5V 5 0
335 Cl* NGC 2070 SMB 107 * 05 38 29.4293104885 -69 05 21.209866080   14.99 14.80     O9.7 11 0
336 Cl* NGC 2070 SMB 216 * 05 38 29.53 -69 06 20.6   15.84 15.82     O8.5V 12 0
337 VFTS 362 * 05 38 29.540 -69 05 30.88   17.42 16.98     B1-3V-III 3 0
338 2MASS J05382998-6859331 Y*? 05 38 29.99 -68 59 33.2   16.22 16.24     B2V 6 0
339 Cl* NGC 2070 MEL 60 * 05 38 29.9912513694 -69 05 05.220379525   14.81 14.88     B0.2III-II 11 0
340 OGLE LMC-ECL-21330 EB* 05 38 30.08 -69 08 27.6   16.85 16.82   16.702 B2.5:V 7 0
341 VFTS 366 * 05 38 30.110 -69 04 44.55   16.81 16.83     B1-1.5V 5 0
342 [P93] 207 * 05 38 30.2787472794 -69 03 52.790073096   15.88 15.92     B1-2Vn 6 0
343 OGLE LMC-ECL-21335 EB* 05 38 30.40 -69 05 29.6   16.69 16.68   16.495 B1-3V 7 0
344 VFTS 369 * 05 38 30.610 -69 08 24.44   16.81 16.66     O9.7V 8 0
345 [P93] 222 * 05 38 30.740 -69 08 27.13   15.69 15.74     O9.7III 11 0
346 2MASS J05383107-6904271 SB* 05 38 31.0491001416 -69 04 27.116315045   15.44 15.47     O9.5V(n)+sec 5 0
347 [PVL2015] 5 * 05 38 31.2265237225 -69 05 53.039689529   15.34 15.25     O9.5n 11 0
348 OGLE LMC553.25.029379 EB* 05 38 31.26 -69 05 57.0   16.55 16.36   15.991 B0V(n) 6 0
349 Cl* NGC 2070 SMB 275 * 05 38 31.650 -69 05 27.06   16.22 16.20   16.32 B0.5:V 6 0
350 Cl* NGC 2070 SMB 297 * 05 38 31.660 -69 05 48.99   16.37 16.33   16.40 B1:V 9 0
351 Cl* NGC 2070 SMB 418 * 05 38 31.780 -69 05 56.73   16.94 16.83   16.87 B0-0.5V 6 0
352 VFTS 378 * 05 38 31.9039831775 -69 05 32.742354238   17.24 16.98     B1.5:V 3 0
353 IRSF J05383202-6902525 * 05 38 32.001 -69 02 52.43   16.22 16.18     O6-7Vz 7 0
354 [P93] 280 * 05 38 32.120 -69 04 31.83   16.18 16.11     B1.5V 6 0
355 Cl* NGC 2070 SMB 226 * 05 38 32.280 -69 05 44.57   16.02 15.88   15.74 O4-5V((fc))z 9 0
356 [P93] 284 * 05 38 32.3208847158 -69 07 32.234563809   16.3 16.10     B0.5:V 6 0
357 [P93] 287 * 05 38 32.3257393285 -69 07 35.924911627   17.21 16.72     B0V-III 7 0
358 Cl* NGC 2070 SMB 84 SB* 05 38 32.34 -69 05 23.7   14.65 14.65   14.79 O4-5V((n))((fc)) 14 0
359 Cl* NGC 2070 MEL 58b SB* 05 38 32.540 -69 04 32.02   14.95 14.75     O9IV(n) 9 0
360 IRSF J05383262-6857140 * 05 38 32.600 -68 57 13.86   15.68 15.58     B1-2IIIe+ 5 0
361 Cl* NGC 2070 MEL 58 * 05 38 32.600 -69 04 32.27 12.123 13.084 12.916   13.727 O9.5IV 13 0
362 [P93] 305 * 05 38 32.6375387309 -69 03 55.978690229   16.48 16.42     B0.5V 8 0
363 2MASS J05383279-6903195 SB* 05 38 32.7926565731 -69 03 19.554064083   15.63 15.49     O5-6V(n)((fc))z 9 0
364 Cl* NGC 2070 SMB 287 * 05 38 32.800 -69 05 24.92   16.3 16.32   16.48 B0.5:V 6 0
365 Cl* NGC 2070 SMB 268 * 05 38 32.830 -69 05 44.60   16.23 16.10   15.91 O6-7V((f))z 9 0
366 Cl* NGC 2070 SMB 131 * 05 38 33.0048 -69 05 13.083   15.2 15.26   15.47 O9.5(n) 11 0
367 VFTS 394 * 05 38 33.020 -69 02 43.09   16.9 16.93     B0.7V 5 0
368 VFTS 395 * 05 38 33.200 -69 04 51.36   16.77 16.95     B1:e 3 0
369 VFTS 396 * 05 38 33.2744656935 -69 10 23.965604899   16.43 16.32     B0.5V 5 0
370 [P93] 338 * 05 38 33.3548882163 -69 04 17.073385288   16.69 16.68     B1-2V 6 0
371 Cl* NGC 2070 MEL 59a SB* 05 38 33.3923398035 -69 04 38.332530075   14.37 14.40     O5.5V((n))((f))z 10 0
372 VFTS 399 * 05 38 33.410 -69 11 59.05   15.91 15.83     O9IIIn 10 0
373 OGLE LMC553.25.029400 EB* 05 38 33.54 -69 05 21.7   15.99 16.03   15.915 O9.7 11 0
374 VFTS 401 * 05 38 33.5936602828 -68 56 05.788975854   15.65 15.48     B1-2IIIe+ 5 0
375 RMC 135 WR* 05 38 33.62 -69 04 50.4   12.63 13.48     WN7h+OB 56 0
376 VFTS 403 * 05 38 33.820 -69 04 36.17   17.31 17.12     B1-2V 5 0
377 2MASS J05383381-6909569 SB* 05 38 33.8291172711 -69 09 57.074730811   14.16 14.14     O3.5V(n)((fc)) 6 0
378 Cl* NGC 2070 SMB 401 * 05 38 33.840 -69 05 51.80   16.87 16.74   16.63 O9.5:n 9 0
379 Cl* NGC 2070 MEL 55 * 05 38 33.977 -69 04 21.12 13.198 14.245 14.274   13.858 O6Vnn 12 0
380 Cl* NGC 2070 SMB 466 * 05 38 34.460 -69 06 14.49   17.05 16.97   16.33 B0.5:V 5 0
381 VFTS 408 * 05 38 34.460 -69 01 39.67   16.34 16.32     B 5 0
382 Cl* NGC 2070 SMB 228 SB* 05 38 34.580 -69 06 52.76   16.34 15.75   15.23 O4V((f))z 7 0
383 2MASS J05383469-6906061 Y*O 05 38 34.5978198118 -69 06 05.904057601   16.79 16.03   15.49 O7-8V 15 0
384 OGLE LMC-LPV-76549 LP* 05 38 34.76 -69 04 50.3   16.93 17.039   15.316 O9.7 11 0
385 VFTS 411 * 05 38 34.7822187124 -69 05 00.557755941   16.84 16.93     B1-3V-III 3 0
386 VFTS 413 * 05 38 34.8998447891 -68 58 45.411322690   16.5 16.48     B2V 5 0
387 Cl* NGC 2070 SMB 430 * 05 38 35.2332650596 -69 05 12.203485814   16.92 16.89   16.97 B1-3V-III 6 0
388 [P93] 466 SB* 05 38 35.4822 -69 04 57.620   15.38 15.48     O9.5V 6 0
389 Cl* NGC 2070 SMB 93 * 05 38 35.590 -69 06 06.58   14.77 14.67   14.29 ~ 3 0
390 Cl* NGC 2070 SMB 204 * 05 38 35.6590693538 -69 06 17.506292431   15.85 15.51   14.82 B2Ib 7 0
391 [P93] 473 * 05 38 35.7404005460 -69 08 19.742550432   16.33 16.12     O5V((n))((fc))z 8 0
392 Cl* NGC 2070 SMB 158 * 05 38 35.84 -69 05 34.8   15.49 15.40   15.44 O9:V(n) 15 0
393 Cl* NGC 2070 MEL 54 s*b 05 38 35.9491 -69 06 09.195   13.27 13.02   12.60 B0.5IaNwk 14 0
394 Cl* NGC 2070 SMB 140 SB* 05 38 35.9957434003 -69 06 16.947945379   15.38 15.14   14.58 O4III(f) 8 0
395 VFTS 421 * 05 38 35.9964800371 -69 04 20.713200029   16.38 16.42     B2:V 5 0
396 NAME 30 Dor Nebula SFR 05 38 36.0 -69 05 11           ~ 1069 2
397 Cl* NGC 2070 MEL 52 * 05 38 36.0548685122 -69 06 46.548806125   13.94 13.51   12.95 B1Ia:Nwk 13 0
398 RMC 138 sg* 05 38 36.1319623810 -69 05 57.970666081   12.07 11.74   11.45 A0Ia 28 0
399 [P93] 511 * 05 38 36.165 -69 04 48.69   17.1 17.04     B1.5V 5 0
400 OGLE LMC553.25.029502 EB* 05 38 36.18 -69 06 05.8   16.56 16.50   16.165 B0.5:V 7 0
401 Brey 81 WR* 05 38 36.4069267803 -69 06 57.535480245   14.02 13.76   12.80 WN8 29 0
402 2MASS J05383650-6903509 * 05 38 36.50 -69 03 51.0   16.2 16.19     B0.5V 6 0
403 Cl* NGC 2070 MEL 57 SB* 05 38 36.8563558756 -69 04 58.322800555   14.58 14.69     O7.5-8V 13 0
404 [P93] 538 s*b 05 38 36.8577952445 -69 06 46.155190958   15.75 15.11   14.19 B0.5Ia+((n))Nwk 11 0
405 RMC 137 s*b 05 38 36.9620682844 -69 05 07.877452894   12.12 12.02   12.05 B1Ia 29 0
406 Cl* NGC 2070 SMB 214 * 05 38 37.0294 -69 06 50.696   15.9 15.65   15.21 O8-9V(n)((f)) 10 0
407 VFTS 433 * 05 38 37.090 -69 05 48.84   16.92 16.87     B1-3V-III 3 0
408 [P93] 566 * 05 38 37.115 -69 07 05.22   17.39 16.86     O7-8V 5 0
409 VFTS 434 * 05 38 37.2297951545 -69 04 26.091295960   16.29 16.13     B1.5:V 4 0
410 Cl* NGC 2070 SMB 209 * 05 38 37.360 -69 05 21.23   15.87 15.92   16.30 O7-8V 8 0
411 [P93] 591 * 05 38 37.395 -69 04 37.32   17.06 16.99     B1-3V 3 0
412 Cl* NGC 2070 MEL 47 * 05 38 37.718 -69 05 20.97 11.913 12.764 12.046   12.344 O6-6.5II(f) 18 0
413 VFTS 441 SB* 05 38 37.810 -69 03 28.93   15 15.07     O9.5V 10 0
414 VFTS 442 * 05 38 37.890 -69 03 36.76   16.74 16.66     B1-2V 4 0
415 Cl* NGC 2070 SMB 97 SB* 05 38 37.93 -69 05 42.9   14.85 14.75   14.69 O3-4V:((fc)):+O4-7V:((fc)): 12 0
416 Cl* NGC 2070 SMB 208 SB* 05 38 37.9834 -69 06 15.183   15.89 15.71   15.17 O7:V(n):+O7:V(n): 8 0
417 Cl* NGC 2070 SMB 233 * 05 38 38.020 -69 05 08.58   16.04 16.13   16.41 O9.7 11 0
418 Cl* NGC 2070 SMB 194 * 05 38 38.260 -69 06 17.29   15.82 15.47   15.00 OV((f))nn 9 0
419 IRSF J05383834-6902275 * 05 38 38.287 -69 02 27.85   15.64 15.79     B2V 7 0
420 Cl* NGC 2070 SMB 886 * 05 38 38.340 -69 06 44.96   17.18 16.85   16.74 B1-3V 6 0
421 Cl* NGC 2070 SMB 428 * 05 38 38.360 -69 05 08.07   16.94 16.91   17.22 B1-2V 7 0
422 Cl* NGC 2070 MEL 50 SB* 05 38 38.4788662377 -69 06 22.019253248   13.80 13.655   13.314 O9.7III:+O7:: 22 0
423 Cl* NGC 2070 SMB 346 * 05 38 38.520 -69 06 29.92   16.62 16.25   15.54 O9:III:(n) 12 0
424 VFTS 452 * 05 38 38.7319030100 -69 12 32.713485520   16.4 16.44     B1-2V 5 0
425 OGLE LMC175.3 24041 SB* 05 38 38.75 -69 06 13.1   14.99 14.84   14.549 O5:V:n 15 0
426 [P93] 668 * 05 38 38.7646125810 -69 04 12.396696399   15.28 15.31     B0.5V 9 0
427 OGLE LMC175.4 54 EB* 05 38 38.82 -69 05 25.5   15.59 15.46   15.123 Onn 11 0
428 BAT99 97 WR* 05 38 38.8398291702 -69 06 49.549647180   14.23 13.74   13.20 O3.5If*/WN7 25 0
429 HTR 13 s*b 05 38 38.8642013122 -69 08 14.584792044 12.623 13.114 12.516 12.10 10.440 BN6Iap 16 0
430 [P93] 684 * 05 38 38.940 -69 03 12.10   16.4 16.39     B2V 8 0
431 Cl* NGC 2070 SMB 278 SB* 05 38 38.99 -69 06 58.9   16.3 15.86   15.11 O7.5V+O7.5V 9 0
432 Cl* NGC 2070 SMB 303 * 05 38 39.150 -69 05 05.75   16.25 16.83   16.79 B1.5V 6 0
433 OGLE LMC-ECL-21405 EB* 05 38 39.229 -69 01 40.69   15.75 16.27 16.20 16.048 B0.5/0.7V 8 0
434 Cl* NGC 2070 MH 13 * 05 38 39.250 -69 06 01.13   16.89 16.92   16.66 B0.7-1.5V 7 0
435 Cl* NGC 2070 SMB 365 * 05 38 39.2700464659 -69 06 39.028168376   16.92 16.38   15.36 O5:Vn 13 0
436 [P93] 702 * 05 38 39.280 -69 05 52.69   16.78 16.80     O9.5: 8 0
437 [P93] 696 * 05 38 39.2823074974 -69 07 52.995900051 15.253 15.843 15.567   15.039 O9III 10 0
438 OGLE LMC-RRLYR-20781 RR* 05 38 39.33 -69 15 35.0   17.29 16.971   16.376 B1-2Ve+ 7 0
439 Cl* NGC 2070 MH 17 * 05 38 39.3750 -69 06 06.312   14.63 14.59   13.92 O2V((f*))+OB 20 0
440 VFTS 469 * 05 38 39.4163285355 -69 03 07.723365646   16.09 16.09     B0V 6 0
441 VFTS 471 * 05 38 39.490 -69 02 30.84   16.26 16.36     B1V 5 0
442 2MASS J05383950-6904383 * 05 38 39.5046403462 -69 04 38.703188795   15.38 15.46     O6:V((f))z 11 0
443 [P93] 712 * 05 38 39.5562809299 -69 07 05.362378419   16.65 16.39     O6Vz 9 0
444 VFTS 473 * 05 38 39.580 -69 04 56.73   16.83 16.85     B2:V 5 0
445 VFTS 474 * 05 38 39.7085434612 -69 09 27.782000188   16.74 16.67     B0.5:V(n) 5 0
446 [P93] 722 SB* 05 38 39.7364398723 -69 07 56.095339628   16.8 16.43     O9.7III 6 0
447 Cl* NGC 2070 SMB 455 * 05 38 39.750 -69 05 50.55   17.15 16.95     O((n)) 8 0
448 Cl* NGC 2070 SMB 206 * 05 38 39.750 -69 05 39.21 15.104 15.88 15.67   15.42 O((n)) 12 0
449 2MASS J05383981-6903413 SB* 05 38 39.82 -69 03 41.3   16.04 15.90     O4-5V((fc))z 9 0
450 [P93] 738 * 05 38 39.8246835618 -69 07 10.952177713   17.04 16.72     B0.7V-III 7 0
451 Cl* NGC 2070 SMB 340 * 05 38 40.150 -69 05 13.41   17.37 16.94   17.03 B0.5:V 6 0
452 2MASS J05384016-6901122 SB* 05 38 40.1816523902 -69 01 12.366770968 12.901 14.010 13.905   14.010 O8.5III 8 0
453 Cl* NGC 2070 MH 57 * 05 38 40.230 -69 05 59.76   12.97 13.0   12.91 O3If*/WN6-A 35 1
454 Cl* NGC 2070 SMB 309 * 05 38 40.240 -69 05 30.78   16.5 16.38     O9V 8 0
455 Cl* NGC 2070 SMB 124 * 05 38 40.360 -69 05 43.76   15.21 15.07   15.00 O6-7V((n)) 12 0
456 Brey 75 WR* 05 38 40.53 -69 05 57.2   12.84 12.75   12.34 WN6h 59 0
457 VFTS 485 * 05 38 40.580 -69 05 11.28   16.85 16.90     B1.5V 5 0
458 VFTS 486 * 05 38 40.600 -69 04 56.03   15.76 15.48     B1-2ne+ 5 0
459 Cl* NGC 2070 MH 77 * 05 38 40.646 -69 06 05.73   16.54 16.40   16.56 O9.5III/V 6 0
460 Cl* NGC 2070 SMB 441 SB* 05 38 40.710 -69 05 25.98   17 16.88     O6.5:IV:((f)):+O6.5:IV:((f)): 6 0
461 2MASS J05384074-6908249 * 05 38 40.7229732227 -69 08 24.934774483 15.347 16.015 15.808   15.458 O6V((f))z 12 0
462 VFTS 489 * 05 38 40.750 -69 01 48.87   16.47 16.54     B1Vn 5 0
463 Cl* NGC 2070 MH 85 Be? 05 38 40.779 -69 06 03.37   16.33 16.10   16.10 B[e]? 6 0
464 Cl* NGC 2070 MH 95 * 05 38 40.848 -69 06 04.51   15.77 15.38   16.53 O9.5III/V 5 0
465 Cl* NGC 2070 SMB 213 * 05 38 40.86 -69 06 57.5   15.91 15.62   15.10 O6V((fc)) 13 0
466 Cl* NGC 2070 SMB 330 * 05 38 40.977 -69 06 08.33   16.6 16.48   16.38 ~ 3 0
467 IRSF J05384106-6906599 * 05 38 41.040 -69 06 59.90   17.15 16.73   16.13 O8V(n) 10 0
468 Cl* NGC 2070 MH 123 * 05 38 41.040 -69 06 16.71   17.07 16.74   17.53 O9V 11 0
469 Cl* NGC 2070 MEL 21 SB* 05 38 41.0504 -69 04 24.798   14.05 14.16     O8V+O9.5:V 9 0
470 Cl* NGC 2070 MH 127 * 05 38 41.066 -69 06 15.16   17.17 16.11   15.47 O6.5III/V 6 0
471 Cl* NGC 2070 MH 129 * 05 38 41.077 -69 06 01.74   14.85 14.68   14.85 O6.5III/V 8 0
472 2MASS J05384109-6901458 * 05 38 41.093 -69 01 45.88 14.684 15.333 15.556   15.477 O9.7II-IIIn 10 0
473 OGLE LMC175.3 24178 EB* 05 38 41.0974908793 -69 06 51.598593432   16.88 16.66   16.244 B0Vn 9 0
474 Cl* NGC 2070 SMB 347 * 05 38 41.098 -69 06 35.01   16.64 16.45   16.10 O9.5V 12 0
475 Cl* NGC 2070 MH 134 * 05 38 41.108 -69 05 58.33   15.78 14.63   16.46 ON6.5I/II 5 0
476 Cl* NGC 2070 SMB 81 * 05 38 41.130 -69 05 13.14   14.6 14.66   14.96 O3.5V((f))z+OB 6 0
477 Cl* NGC 2070 MH 141 * 05 38 41.163 -69 06 02.83   15.48 15.44   16.63 O6.5III/V 5 0
478 [P93] 848 * 05 38 41.190 -69 04 06.31   16.83 16.77     B0.7V 6 0
479 [M2002] LMC 171520 SB* 05 38 41.227 -69 02 58.31   14.11 14.19 14.28 13.941 O6.5IV((fc))+O6.5V((fc)) 15 0
480 [P93] 849 * 05 38 41.2398699555 -69 04 14.301842355   15.82 15.74     B0.5V 6 0
481 Cl* NGC 2070 MH 156 * 05 38 41.268 -69 06 16.94   15.74 15.53   15.16 O7III/V 5 0
482 Cl* NGC 2070 MEL 27 SB* 05 38 41.2976 -69 05 32.391   13.83 13.76   13.56 O9.7II 14 0
483 Cl* NGC 2070 MH 166 * 05 38 41.355 -69 06 13.96   15.7 15.35   14.85 ~ 4 0
484 Cl* NGC 2070 MEL 27b SB* 05 38 41.380 -69 05 32.54   14.87 14.87     O9III 8 0
485 Cl* NGC 2070 MH 178 * 05 38 41.386 -69 06 02.49   16.2 16.06     O9III/V 4 0
486 VFTS 504 * 05 38 41.390 -69 03 00.89   16.88 16.27     B0.7V 9 0
487 Cl* NGC 2070 MH 181 * 05 38 41.417 -69 06 09.34   16.68 16.36   16.63 ~ 4 0
488 Cl* NGC 2070 SMB 265 * 05 38 41.490 -69 05 34.52   16.22 16.24   16.51 O9.5V/III 9 0
489 Cl* NGC 2070 MH 203 * 05 38 41.515 -69 06 00.83   14.28 13.67     O3V 11 0
490 Cl* NGC 2070 MEL 25 SB* 05 38 41.5495267078 -69 05 19.506347564   13.33 13.31   13.36 ON2V((n))((f*)) 24 0
491 RMC 140b WR* 05 38 41.5650 -69 05 15.500   12.61 12.66   12.54 WN6 27 0
492 [P93] 872 SB* 05 38 41.600 -69 07 02.40   16.15 15.98     O9.5V 8 0
493 RMC 140a WR* 05 38 41.600 -69 05 13.39   12.18 12.12   12.40 WN4+WC5 32 0
494 Cl* NGC 2070 SMB 187 * 05 38 41.650 -69 06 03.17   15.8 15.38   16.21 ~ 4 0
495 VFTS 510 SB* 05 38 41.680 -69 06 18.48   16.55 16.28     O8.5V 4 0
496 Cl* NGC 2070 SMB 143 SB* 05 38 41.730 -69 06 28.06   15.4 15.28   15.05 O5V((n))((fc))z 13 0
497 Cl* NGC 2070 SMB 68 SB* 05 38 41.750 -69 06 24.94   14.48 14.28   13.89 O2V-III((f*)) 16 0
498 Cl* NGC 2070 SMB 154 * 05 38 41.766 -69 06 18.98   15.5 15.30   14.61 ~ 4 0
499 IRSF J05384189-6909229 * 05 38 41.784 -69 09 23.35   16.64 16.61     B1.5V 5 0
500 Cl* NGC 2070 SMB 266 * 05 38 41.810 -69 05 31.91   16.26 16.20     O6-7II(f) 8 0
501 Cl* NGC 2070 SMB 434 * 05 38 41.860 -69 05 32.40   17.02 16.94   15.70 O8-9p 9 0
502 2MASS J05384185-6901590 SB* 05 38 41.8611540532 -69 01 58.900139606 14.912 15.675 15.759   15.943 O9.7III 6 0
503 Cl* NGC 2070 SMB 88 * 05 38 41.88 -69 06 14.4   14.77 14.50   14.82 ~ 17 1
504 Cl* NGC 2070 MH 290 * 05 38 41.887 -69 06 12.45   14.62 14.34   14.15 O2-4.5 10 0
505 VFTS 517 * 05 38 41.920 -69 04 38.75   14.64 14.72     O9.5V-III((n)) 6 0
506 Cl* NGC 2070 SMB 138 SB* 05 38 41.940 -69 06 29.62   15.38 15.11   14.69 O3.5III(f*) 14 0
507 Cl* NGC 2070 SMB 55 SB* 05 38 41.940 -69 05 13.00   14.14 14.11   14.55 O3-4((f))+OB+WN 8 0
508 Cl* NGC 2070 SMB 397 * 05 38 41.990 -69 06 53.46   16.77 16.69   16.52 B1:V(SB2?) 7 0
509 VFTS 521 ** 05 38 42.0154 -69 07 04.979   15.51 15.34     O9V(n) 14 0
510 Cl* NGC 2070 MH 320 * 05 38 42.016 -69 06 07.51   14.56 14.34   14.19 ~ 7 0
511 Cl* NGC 2070 MH 314 * 05 38 42.023 -69 06 16.75   15.66 15.51   15.42 O3-4 7 0
512 Cl* NGC 2070 SMB 25 * 05 38 42.068 -69 06 14.19   13.52 13.31   13.09 ~ 6 0
513 [P93] 921 SB* 05 38 42.09 -69 05 45.5   15.3 15.22   14.938 O6II-Iab(fc)+O5.5V((fc)): 11 0
514 VFTS 523 * 05 38 42.120 -69 04 32.93   17.06 17.05     B1-3V-III 5 0
515 [P93] 930 s*b 05 38 42.2168 -69 06 25.538   13.92 13.76   13.62 B0Ia 18 0
516 [P93] 925 s*b 05 38 42.2376916871 -69 08 32.357401634 15.124 15.572 15.185   14.128 O8.5I((n))fp 8 0
517 RMC 139 WR* 05 38 42.3548071421 -69 04 58.201053806   12.04 11.94     O6.5Iafc+O6Iaf 86 0
518 [P93] 956 * 05 38 42.3779 -69 04 24.743   15.58 15.58     O9.7(n) 13 0
519 OGLE LMC-ECL-21435 EB* 05 38 42.38 -69 04 43.1   16.01 15.94   15.889 O9.5(n) 12 0
520 RMC 136 Cl* 05 38 42.396 -69 06 03.36           ~ 1800 1
521 2MASS J05384240-6903041 SB* 05 38 42.402 -69 03 04.19   16.26 16.28     O9.5III:nn 5 0
522 Cl* NGC 2070 MH 493 * 05 38 42.407 -69 06 15.01   13.69 13.44   13.07 ~ 6 0
523 Cl* NGC 2070 MH 591 * 05 38 42.631 -69 06 10.91   15.41 15.26   15.30 O8III/V 6 0
524 OGLE LMC-ECL-21439 SB* 05 38 42.65 -69 04 13.5   14.39 14.50   14.568 O9.5III:nn 12 0
525 OGLE LMC-ECL-21440 EB* 05 38 42.66 -69 06 35.8   14.96 14.76   14.447 O3V(n)((f*))z+OB 16 0
526 Cl* NGC 2070 MH 623 * 05 38 42.685 -69 06 07.03   15.5 15.20   15.36 O8.5III/V 6 0
527 RMC 142 s*b 05 38 42.7362758069 -69 05 42.617393261   12.11 11.82   11.59 B0Ia 28 0
528 VFTS 534 * 05 38 42.7922087810 -69 15 40.272869245   15.87 15.66     B0IV 5 0
529 VFTS 535 * 05 38 42.800 -69 04 31.50   16.87 16.53     B1-2V-III 6 0
530 Cl* NGC 2070 SMB 295 * 05 38 42.820 -69 06 32.43   16.44 16.21   15.87 O6Vz 10 0
531 VFTS 1025 * 05 38 42.935 -69 06 04.98           ~ 8 0
532 MH 12 SB* 05 38 43.026 -69 04 13.15   13.96 13.99     ON9Ia:+O7.5:I:(f): 17 0
533 2MASS J05384305-6903447 * 05 38 43.0354520985 -69 03 44.875335682   16.06 15.99     O5V((fc))z 11 0
534 Cl* NGC 2070 MH 716 * 05 38 43.0737 -69 06 11.255   14.40 14.26   14.10 O2-4.5 21 0
535 Cl* NGC 2070 SMB 372 * 05 38 43.080 -69 06 36.88   16.78 16.55   16.42 B0V 9 0
536 [P93] 9024 s*b 05 38 43.0825617715 -69 01 32.560447951 12.393 13.284 13.246   12.424 B0.5Ia 6 0
537 [P93] 1012 * 05 38 43.1030 -69 07 02.095   16.28 16.14     O9.5(n) 11 0
538 BAT99 113 WR* 05 38 43.12 -69 05 46.8   13.56 13.47   13.44 O2If*/WN5 38 0
539 BAT99 114 WR* 05 38 43.20 -69 06 14.6   13.52 13.40   13.31 O2If*/WN5 33 0
540 Cl* NGC 2070 SMB 152 SB* 05 38 43.200 -69 05 27.46   15.43 15.41   15.60 O9IV+O9.7:V 12 0
541 Cl* NGC 2070 MH 748 * 05 38 43.210 -69 05 42.46   14.74 14.74   15.03 ~ 6 0
542 Cl* NGC 2070 MH 749 * 05 38 43.2715 -69 06 16.529   13.86 13.82   13.78 O3.5-4.5 20 0
543 Cl* NGC 2070 MH 764 * 05 38 43.351 -69 05 47.47   14.71 14.68   15.61 ~ 5 0
544 [P93] 1052 * 05 38 43.3868 -69 04 46.386   15.4 15.36     O8-9III:((n)) 10 0
545 VFTS 1030 * 05 38 43.427 -69 05 41.95   16.55 16.45     ~ 2 0
546 Cl* NGC 2070 SMB 240 * 05 38 43.560 -69 05 29.31   16.11 16.13   16.19 B0-0.5V 6 0
547 [P93] 9026 * 05 38 43.587 -69 01 58.76   16.82 16.79     B3-5V-III 5 0
548 2MASS J05384358-6907516 * 05 38 43.5871898616 -69 07 51.928524330   16.86 16.51     O6.5Vz 10 0
549 [P93] 1077 * 05 38 43.600 -69 04 42.46   15.34 15.25     O5V((fc))z 7 0
550 Cl* NGC 2070 SMB 416 * 05 38 43.660 -69 06 18.86   16.95 16.82   16.88 B1V 6 0
551 Cl* NGC 2070 MH 815 * 05 38 43.6890 -69 05 47.855   13.89 13.89   13.99 O3.5 11 0
552 Cl* NGC 2070 MH 804 SB* 05 38 43.690 -69 06 16.57   16.47 16.16   16.65 O8.5III:+B 6 0
553 Cl* NGC 2070 SMB 450 * 05 38 43.730 -69 06 27.18   17.06 17.00   16.87 B1V 7 0
554 Cl* NGC 2070 SMB 343 * 05 38 43.790 -69 05 38.70   16.65 16.61   16.72 O9.7V 11 0
555 2MASS J05384388-6903164 SB* 05 38 43.9084683151 -69 03 16.382483656   15.96 15.88     O9.5Vz 9 0
556 VFTS 556 * 05 38 44.000 -69 04 48.25   16.92 16.88     B1.5-2V 5 0
557 OGLE LMC-ECL-21453 SB* 05 38 44.06 -69 04 59.5   16.69 16.57   16.046 On 6 0
558 Cl* NGC 2070 MH 863 * 05 38 44.076 -69 05 44.77   14.96 14.67   14.76 ~ 5 0
559 OGLE LMC553.25.008126 EB* 05 38 44.16 -69 05 42.2   14.85 14.53   14.422 ~ 9 0
560 Cl* NGC 2070 MH 878 * 05 38 44.2200 -69 05 46.976   13.48 13.36   13.17 O8II 14 1
561 2MASS J05384423-6900274 * 05 38 44.237 -69 00 27.49 15.650 16.602 16.051   16.202 B3III 4 0
562 [P93] 1133 * 05 38 44.2861419515 -69 07 16.634244315   16.71 16.49     O9.7(n) 10 0
563 Cl* NGC 2070 MH 888 * 05 38 44.321 -69 05 45.05   15.62 15.53   20.22 O8.5I/II 8 0
564 Cl* NGC 2070 SMB 350 * 05 38 44.350 -69 06 40.73   16.64 16.59   16.57 O9.5V 15 0
565 Cl* NGC 2070 SMB 168 SB* 05 38 44.370 -69 05 14.34   15.53 15.46   15.53 O9:(n) 8 0
566 Cl* NGC 2070 MEL 26 * 05 38 44.4177 -69 05 36.154   13.75 13.66   13.59 O4III(f) 15 0
567 Cl* NGC 2070 SMB 237 SB* 05 38 44.540 -69 06 28.73   16.1 15.91   15.77 O9.7III:+B0:V: 11 0
568 Cl* NGC 2070 SMB 253 * 05 38 44.560 -69 05 12.31   16.19 16.02   16.16 O6-8V((f)) 7 0
569 VFTS 565 * 05 38 44.560 -69 04 55.09   16.6 16.55     O9.5: 10 0
570 MH 31 * 05 38 44.5648836224 -69 04 51.261031936   14.11 14.05     O3III(f*) 22 0
571 OGLE LMC-ECL-21458 EB* 05 38 44.6121691885 -69 07 56.704055552   16.53 16.29   15.928 B1V(n) 8 0
572 OGLE LMC553.25.008565 EB* 05 38 44.6723900107 -69 04 24.980554331   16.94 16.79   16.594 B0.5:V 6 0
573 Cl* NGC 2070 SMB 259 * 05 38 44.6850 -69 05 13.907   16.16 16.09   16.52 O9.2III: 13 0
574 Cl* NGC 2070 MH 916 SB* 05 38 44.700 -69 05 45.13   15.73 15.42   14.64 O9.5ne+ 8 0
575 Cl* NGC 2070 MH 917 * 05 38 44.700 -69 05 41.01   17.1 16.92   17.09 O9.5II-III(n) 11 0
576 2MASS J05384477-6908569 * 05 38 44.7272436540 -69 08 57.160918978   16.53 16.38     B1V 7 0
577 Cl* NGC 2070 SMB 440 * 05 38 44.770 -69 06 57.55   16.97 16.94   16.92 B0-0.5V 6 0
578 Cl* NGC 2070 MH 920 * 05 38 44.820 -69 05 43.62   16.53 16.41   17.92 ~ 4 0
579 VFTS 574 * 05 38 44.8250043019 -68 57 34.602413050   15.77 15.89     O9.5IIIn 9 0
580 Cl* NGC 2070 SMB 128 * 05 38 44.910 -69 05 33.10   15.13 15.11   15.17 B0.7III 11 0
581 VFTS 576 s*b 05 38 44.9366094527 -69 15 11.393198749   16.45 15.67     B1IaNwk 5 0
582 W61 7-5 s*b 05 38 44.9625142398 -69 08 06.767852744 14.203 14.657 14.205   13.773 B1Ia 10 0
583 Cl* NGC 2070 SMB 171 * 05 38 44.970 -69 05 07.69   15.51 15.51   15.61 O9:((n)) 16 0
584 IRSF J05384494-6907046 * 05 38 44.997 -69 07 04.21   17.04 16.64     O6V((fc))z 8 0
585 [P93] 1217 * 05 38 45.030 -69 03 19.32   16.67 16.62     B0-0.5Vn 6 0
586 Cl* NGC 2070 MH 935 * 05 38 45.095 -69 05 42.81   16.65 16.51   16.76 ~ 4 0
587 2MASS J05384509-6904157 * 05 38 45.095 -69 04 15.76   16.25 16.07     O4-5V((fc)) 11 0
588 Cl* NGC 2070 SMB 414 * 05 38 45.190 -69 05 37.43   16.99 16.83   17.71 O9.5V((n)) 9 0
589 Cl* NGC 2070 MH 939 SB* 05 38 45.220 -69 05 48.39   14.99 14.93   15.33 O8V+O8.5V 6 0
590 Cl* NGC 2070 SMB 443 * 05 38 45.250 -69 06 54.84   17 16.95   16.71 B1.5V 6 0
591 Cl* NGC 2070 MH 943 SB* 05 38 45.280 -69 05 46.47   13.77 13.65   13.78 O7V(n) 10 0
592 Cl* NGC 2070 SMB 293 * 05 38 45.380 -69 05 24.44   16.38 16.38   16.55 O9.7: 11 0
593 2MASS J05384539-6902514 pA? 05 38 45.3898786434 -69 02 51.451734273 13.564 14.574 14.491 13.97 14.826 O4V((n))((fc))z 15 0
594 Cl* NGC 2070 SMB 356 SB* 05 38 45.400 -69 05 39.76   16.67 16.53   17.61 O9.5 6 0
595 [P93] 1247 * 05 38 45.57 -69 07 34.6   15.98 15.83     B0.5V(SB2?) 11 0
596 RMC 141 s*b 05 38 45.5859 -69 05 47.772   12.71 12.49   12.36 BN0.5Ia 28 0
597 Cl* NGC 2070 SMB 318 * 05 38 45.690 -69 06 15.33   16.54 16.40   16.39 O9.5Vn 10 0
598 CPD-69 457 s*b 05 38 45.706536 -69 06 22.48020 11.233 12.094 11.996 12.419 10.066 B0.5Ia 17 0
599 VFTS 593 * 05 38 45.7085142396 -69 09 40.156162019   16.93 16.84     B2.5V 6 0
600 Cl* NGC 2070 SMB 267 * 05 38 45.760 -69 05 13.29   16.23 16.16   16.25 O9.7 9 0
601 Cl* NGC 2070 SMB 175 ** 05 38 46.0657 -69 06 56.245   15.59 15.56   15.62 O8-9V(n) 13 0
602 Cl* NGC 2070 SMB 137 SB* 05 38 46.070 -69 06 15.51   15.26 15.23   15.02 O7-8V((n)) 7 0
603 VFTS 598 * 05 38 46.130 -69 06 23.51   17.28 16.94     B0.2V 6 0
604 W61 7-7 SB* 05 38 46.1994 -69 06 16.007   13.88 13.80   13.73 O3III(f*) 22 0
605 VFTS 600 * 05 38 46.2514947481 -69 10 14.754839555   16.36 16.40     B0.5V(n) 5 0
606 Cl* NGC 2070 MH 986 * 05 38 46.287 -69 05 59.28   14.78 14.69   14.62 O5-6V((n))z 22 0
607 VFTS 602 * 05 38 46.3552322027 -69 04 33.556691438   16.8 16.71     B0.7V 5 0
608 Cl* NGC 2070 MEL 10 SB* 05 38 46.5347438136 -69 04 28.047040946   14.03 13.99     O4III(fc) 15 0
609 Cl* NGC 2070 SMB 110 * 05 38 46.5839 -69 05 37.116   14.98 14.94   15.06 O8.5V 9 0
610 Cl* NGC 2070 SMB 357 * 05 38 46.710 -69 05 38.78   16.66 16.60   16.90 B0-0.5V(n) 7 0
611 OGLE LMC-ECL-21479 EB* 05 38 46.72 -69 02 40.5   16.72 16.85   16.824 B1-2V 9 0
612 Cl* NGC 2070 SMB 294 * 05 38 46.760 -69 05 48.75   16.42 16.34   16.40 O9.7III 13 0
613 Cl* NGC 2070 MH 999 SB* 05 38 46.7862775696 -69 06 03.189762532   14.38 14.22   14.03 O4III(f) 23 0
614 Cl* NGC 2070 SMB 408 * 05 38 46.800 -69 06 26.31   16.9 16.73   15.83 B0Vn 7 0
615 Cl* NGC 2070 SMB 384 * 05 38 46.870 -69 05 20.07   16.75 16.76   16.64 O9-9.5V-III 8 0
616 Cl* NGC 2070 MH 1003 * 05 38 46.900 -69 05 58.71   16.29 16.16   16.16 O8V(n) 12 0
617 Cl* NGC 2070 SMB 362 * 05 38 47.150 -69 06 35.81   16.73 16.53   16.35 B0.5-0.7V 6 0
618 Cl* NGC 2070 MH 1005 * 05 38 47.170 -69 05 54.40   15.94 15.78   15.67 O8.5Vz 9 0
619 Cl* NGC 2070 SMB 218 * 05 38 47.330 -69 06 17.70   15.91 15.89   15.89 O9.5IIInn 11 0
620 [P93] 1389 * 05 38 47.4627924167 -69 07 13.489575093   16.57 16.48     B0.5:V 9 0
621 HD 269926 WR* 05 38 47.5177886261 -69 00 25.287665455 11.953 12.974 13.116 13.16 12.926 WN4+OB 63 0
622 VFTS 618 * 05 38 47.6013403122 -69 07 05.954098346   17.08 16.70     B1-3V 3 0
623 Cl* NGC 2070 SMB 234 SB* 05 38 47.7174367570 -69 06 45.045045220   16.1 15.98   15.92 O7-8V(n) 9 0
624 [P93] 1416 * 05 38 47.9176164478 -69 05 32.963356648   16.64 16.61   16.90 O9.7III(n) 12 0
625 Cl* NGC 2070 SMB 333 SB* 05 38 48.024 -69 06 12.27   16.61 16.56   16.63 O9.7III 11 0
626 NAME Walborn 2 ** 05 38 48.1018 -69 04 42.239   15.66 15.39     O2V((f*))z 27 0
627 Cl* NGC 2070 SMB 453 * 05 38 48.130 -69 06 04.80   17.09 16.98   16.74 B0.2-0.5Vn 7 0
628 2MASS J05384814-6907415 * 05 38 48.1362189672 -69 07 41.601771699 15.250 15.874 15.516   15.772 B0.2V 11 0
629 VFTS 625 * 05 38 48.1746791257 -69 08 34.152460916   17.02 16.91     B1.5V 6 0
630 W61 7-9 * 05 38 48.1964014921 -69 08 10.920332276 14.384 15.051 15.197   14.490 O5-6n(f)p 13 0
631 [P93] 9034 * 05 38 48.4029397230 -68 59 49.922792322 14.379 15.246 15.339   15.591 O9.7V 10 0
632 Cl* NGC 2070 SMB 378 * 05 38 48.458 -69 06 36.44   16.73 16.64   16.58 B0.5:V 6 0
633 Cl* NGC 2070 SMB 404 * 05 38 48.510 -69 05 40.32   16.85 16.78   16.21 B1-2Ve+ 6 0
634 [P93] 1455 * 05 38 48.650 -69 04 58.89   16.38 16.21     O9.7V-III 5 0
635 2MASS J05384889-6908279 SB* 05 38 48.8703684847 -69 08 28.118817048 15.549 16.260 16.281   15.802 O9.7III(n) 11 0
636 OGLE LMC553.25.008162 EB* 05 38 48.8923652900 -69 08 55.354992317   16.09 15.97   15.855 B2Vn 8 0
637 VFTS 633 * 05 38 48.9479766258 -69 08 12.478847700   16.69 16.50     B1V 5 0
638 VFTS 634 ** 05 38 49.010 -69 04 10.60   16.81 16.50     OV 6 0
639 Cl* NGC 2070 SMB 174 SB* 05 38 49.0408786306 -69 06 19.665747648   15.59 15.52   15.54 O9.5IV 12 0
640 [P93] 10008 * 05 38 49.1928714750 -69 10 04.471264551   16.59 16.53     B0Vn 7 0
641 Cl* NGC 2070 SMB 359 * 05 38 49.400 -69 06 15.28   16.65 16.61   16.73 B1-2V+B 6 0
642 VFTS 638 * 05 38 49.5107058118 -69 02 30.333558677   15.49 15.63     O8.5Vz 7 0
643 [P93] 10002 * 05 38 49.6308201243 -69 09 24.106294192   15.4 15.41     O9.7V 10 0
644 VFTS 640 * 05 38 49.6603896850 -69 08 54.849965972   16.98 16.82     B2V 5 0
645 W61 7-10 Y*? 05 38 49.7232575612 -69 06 43.062431007   13.25 13.09   12.97 B0.5:I 17 0
646 2MASS J05384990-6910428 SB* 05 38 49.8975553717 -69 10 42.851428193   16.41 16.03     O5Vz:+O8Vz: 7 0
647 VFTS 643 * 05 38 49.970 -69 07 05.34   16.54 16.41     B1.5V 5 0
648 Cl* NGC 2070 SMB 391 * 05 38 50.0336531987 -69 06 52.030174530   16.77 16.62   16.16 B1-2Ve 6 0
649 2MASS J05385022-6907450 SB* 05 38 50.2020717003 -69 07 45.280503130   16.45 16.29     O9.5V((n)) 6 0
650 W61 7-11 * 05 38 50.2644154995 -69 06 04.473076653 14.370 14.988 15.182   14.536 B0.5III(n) 13 0
651 VFTS 647 * 05 38 50.3410130805 -69 05 02.792838201   16.39 16.29     O8:V: 6 0
652 W61 7-12 SB* 05 38 50.4026084938 -69 05 38.268607222   14.24 14.16   14.17 O5.5IV(f) 19 0
653 Cl* NGC 2070 SMB 239 SB* 05 38 50.620 -69 05 54.56   16.12 16.07   16.12 O9.5V 10 0
654 VFTS 650 * 05 38 50.690 -68 57 55.47   16.88 16.98     B1.5V 6 0
655 W61 7-13 SB* 05 38 51.00 -69 05 54.7   14.78 14.70   14.71 O7V(n)z 15 0
656 W61 7-14 SB* 05 38 51.0429425948 -69 06 20.499807370 13.350 14.202 13.835   13.633 B2Ip+O9III: 22 0
657 OGLE LMC175.3 24231 EB* 05 38 51.08 -69 06 48.6   16.85 16.63   16.078 B0-0.5V 9 0
658 Cl* NGC 2070 SMB 200 SB* 05 38 51.1608264733 -69 05 41.913360693   15.76 15.71   15.77 O9Vnn 7 0
659 W61 7-16 * 05 38 51.1992728162 -69 05 59.388687363   14.3 14.24   14.30 O7.5III(n)((f))p 18 0
660 2MASS J05385131-6904084 SB* 05 38 51.319 -69 04 08.48 14.264 15.263 14.368   14.376 O7-8II(f) 6 0
661 Cl* NGC 2070 SMB 229 * 05 38 51.7582936643 -69 06 01.242724913   16 15.96   16.03 B0-0.5V(n) 11 0
662 Cl* NGC 2070 SMB 224 * 05 38 51.8138512466 -69 05 46.961743631   15.95 15.92   15.96 O9.5Vnn 13 0
663 OGLE LMC175.4 95 SB* 05 38 52.0517211868 -69 05 33.885563389   15.21 15.13   15.017 O6.5V(n)+O9.7:V: 11 0
664 VFTS 662 * 05 38 52.5537557234 -69 02 20.404484730   16.2 16.12     B3-5III: 6 0
665 VFTS 663 * 05 38 52.7112895068 -69 10 14.839616558   16.75 16.52     O8.5V 6 0
666 W61 7-19 * 05 38 52.7232784086 -69 06 43.254812978 13.481 14.132 13.937   13.702 O7II(f) 21 0
667 2MASS J05385270-6907286 * 05 38 52.7392526538 -69 07 28.763565625   16.54 16.43     B0.5V 8 0
668 VFTS 666 * 05 38 52.7985860387 -69 01 38.143282322   16.34 16.42     B0.5V 6 0
669 Cl* NGC 2070 SMB 118 * 05 38 52.8329319147 -69 06 12.123203793   15.1 15.03   15.09 O6V((f)) 11 0
670 VFTS 668 * 05 38 52.8628419981 -69 07 36.090005924   16.7 16.60     B0.7V 6 0
671 W61 7-18 SB* 05 38 52.9703182884 -69 07 45.407479068 13.795 14.467 14.242   13.848 O8Ib(f) 15 0
672 2MASS J05385308-6908248 * 05 38 53.0560358812 -69 08 24.910499608 15.687 16.376 16.516   15.908 B0.7V 8 0
673 VFTS 671 * 05 38 53.2232526399 -69 02 40.967539808   16.32 16.43     B0.7V 5 0
674 W61 7-21 * 05 38 54.0953001184 -69 08 07.722424333 14.032 14.713 14.579   14.020 B0.7IINwk? 11 0
675 VFTS 673 * 05 38 54.1275454573 -69 06 53.062771797   17.01 16.98     B1V 6 0
676 W61 7-20 s*b 05 38 54.4347280802 -69 08 00.528683871 14.144 14.861 14.660   14.027 B1IabNwk 10 0
677 VFTS 676 * 05 38 54.620 -69 04 54.79   16.59 16.52     B0.7V 6 0
678 [P93] 1696 ** 05 38 54.730 -69 03 48.85   17.08 16.68     O9.5V 7 0
679 [P93] 1689 * 05 38 54.797 -69 07 50.08   17.36 16.95     B1:V 5 0
680 VFTS 679 * 05 38 54.850 -69 03 50.22   16.98 16.73     O9.5V 8 0
681 VFTS 681 * 05 38 55.220 -69 05 56.70   16.61 16.55     B0.7V 6 0
682 UCAC4 105-014417 WR* 05 38 55.5218836143 -69 04 26.810760074   16.66 16.08   14.89 WN5h 53 0
683 VFTS 683 * 05 38 55.5555187658 -68 58 56.189338327   16.23 16.33     B2Ve 5 0
684 [P93] 10004 * 05 38 55.5588738312 -69 09 37.833373040   16.85 16.64     B1-3V-IIIe+ 7 0
685 [P93] 1722 * 05 38 55.570 -69 08 28.67   17.04 16.91     B1-1.5V 5 0
686 [P93] 1729 * 05 38 55.6326926899 -69 07 23.843307930 14.514 15.112 15.022   14.717 B0.7III 11 0
687 W61 7-24 * 05 38 55.841 -69 08 22.32 13.930 14.529 14.398   13.908 B1.5Ib((n))Nwk 11 0
688 2MASS J05385604-6905540 SB* 05 38 56.0595674564 -69 05 54.143775556   15.71 15.60     O9.7III 6 0
689 VFTS 689 * 05 38 56.380 -69 08 22.62   16.59 16.51     B3:e_sh 4 0
690 VFTS 690 * 05 38 56.6256709885 -69 07 19.717885673   16.55 16.46     B0.2V 5 0
691 [P93] 1786 * 05 38 56.859 -69 06 38.47   16.22 16.17     B0.2V 8 0
692 HD 269928 WR* 05 38 57.0668705166 -69 06 05.660972436   12.02 11.94 12.00 11.58 WN6/7 122 0
693 [P93] 1799 * 05 38 57.162 -69 03 42.12   16.73 16.55     B1-2Ve 5 0
694 SK -68 140 Em* 05 38 57.1718920252 -68 56 53.152675540   12.81 12.71 12.89   B0.7Ib-IabNwk 31 0
695 W61 7-27 s*b 05 38 57.3147296670 -69 07 09.775903205 14.514 13.891 14.134 13.98 12.884 B3Ia 19 0
696 VFTS 699 * 05 38 57.4908267979 -69 03 48.507920697   16.14 16.19     B0.2-0.5Vn 5 0
697 [P93] 1820 * 05 38 58.183 -69 04 58.50   16.86 16.60     B0.7V 5 0
698 2MASS J05385838-6904350 Y*O 05 38 58.3916180060 -69 04 35.209104333   16.64 16.31   15.768 O8V(n) 13 0
699 2MASS J05385855-6907524 SB* 05 38 58.5596562267 -69 07 52.598717969   17.21 16.91     O7:V:+O8:V: 5 0
700 VFTS 704 * 05 38 58.700 -69 02 44.74   16.69 16.76     O9.2V(n) 7 0
701 VFTS 705 * 05 38 58.710 -69 06 47.10   16.5 16.43     B0.7V 6 0
702 [P93] 1838 * 05 38 58.7686820398 -69 05 23.987403884   15.91 15.77     O6-7Vnnz 10 0
703 OGLE LMC-ECL-21573 EB* 05 38 58.9078065019 -69 06 42.179103516   15.66 15.59   15.459 B0.5V 11 0
704 VFTS 709 * 05 38 59.010 -69 00 20.41   16.51 16.58     B2.5:V 5 0
705 VFTS 710 * 05 38 59.1390943112 -69 06 24.325981367   16.12 16.14     O9.5IV 7 0
706 VFTS 711 * 05 38 59.2771592434 -69 08 12.372093642   16.79 16.48     O9.7III 8 0
707 VFTS 712 * 05 38 59.4578819354 -69 05 49.593010845   16.34 16.13     B1V 8 0
708 VFTS 713 * 05 38 59.8951830145 -69 08 14.787911835   16.93 16.68     B2:V 5 0
709 [P93] 1875 * 05 38 59.9407256655 -69 05 41.997285299 14.987 15.559 14.835   14.758 B1Ia:Nwk 6 0
710 VFTS 715 * 05 39 00.0269943843 -69 01 39.873198960   16.54 16.64     B1V 5 0
711 2MASS J05390040-6903305 SB* 05 39 00.3946555781 -69 03 30.577007476   15.97 15.91     O9.5IV 7 0
712 2MASS J05390080-6907132 * 05 39 00.804 -69 07 13.22 15.301 15.945 15.709   15.314 O9IV 9 0
713 VFTS 718 * 05 39 00.8954114851 -68 57 29.735789273   15.93 15.99     B2.5III 5 0
714 [P93] 1898 * 05 39 00.9216071473 -69 06 29.200919891   17.08 17.00     B1V 5 0
715 VFTS 720 * 05 39 01.0568114794 -68 59 05.888261119   16.68 16.74     B2V 5 0
716 VFTS 722 * 05 39 02.7923596478 -68 57 07.876127752   14.91 15.04     O7Vnnz 8 0
717 VFTS 723 * 05 39 02.8622130075 -69 05 26.417092072   16.35 16.19     B0.5V 5 0
718 VFTS 724 * 05 39 02.950 -69 15 00.08   17.23 16.80     O7Vnnz 7 0
719 VFTS 725 * 05 39 03.2219306150 -69 08 18.353742682   15.95 15.84     B0.7III 11 0
720 VFTS 726 * 05 39 03.3040898915 -69 09 32.003696564   16.43 16.40     B1-2V 5 0
721 VFTS 727 * 05 39 03.3253581115 -69 10 39.725332252   16.92 16.74     B3III 6 0
722 2MASS J05390342-6906345 SB* 05 39 03.4291958522 -69 06 34.666641895 14.824 15.549 15.522   15.624 O9.7II-III((n)) 9 0
723 [P93] 1969 * 05 39 03.5946915122 -69 07 16.942319212 14.531 15.268 15.088   14.618 B0.2III 10 0
724 SSTISAGEMC J053903.63-690019.2 * 05 39 03.6194512714 -69 00 19.070728087 14.607 15.394 15.510   15.468 B1.5V 6 0
725 Brey 90a WR* 05 39 03.7772881811 -69 03 46.561252441 16.190 15.895 15.834   15.533 WC5 23 0
726 W61 7-29 s*b 05 39 04.7712590119 -69 04 09.923266718 12.403 13.154 12.756     B1Ia 17 0
727 W61 7-28 SB* 05 39 04.8728779559 -69 05 40.479038802 13.507 14.355 14.240   13.891 B0.5V 14 0
728 OGLE LMC-ECL-21604 EB* 05 39 04.9301789639 -69 05 35.399063901   16.46 16.31   15.972 B0.7V 7 0
729 VFTS 735 * 05 39 05.0253730364 -69 13 29.692366917   16.73 16.30     B1-2IIIe+ 5 0
730 [P93] 1998 * 05 39 05.3053336247 -69 04 16.175007646   15.9 15.85     O9.5V 7 0
731 [P93] 2000 * 05 39 05.3876814135 -69 04 31.159972613   15.83 15.70     O9V 7 0
732 VFTS 738 * 05 39 05.4234453186 -68 57 37.364682749   14.57 14.55     B0.5IIIe+ 5 0
733 SK -69 250 * 05 39 05.9303047254 -69 16 26.772019096   12.53 12.14     B7I 12 0
734 VFTS 740 * 05 39 06.0209479938 -69 15 41.641515525   16.85 16.50     B0.7III 6 0
735 VFTS 741 * 05 39 06.0330722047 -69 09 58.521084534   17.26 16.97     B2V 5 0
736 VFTS 742 * 05 39 06.410 -68 56 58.70   16.91 16.93     B2V 4 0
737 2MASS J05390692-6900165 SB* 05 39 06.9188615721 -69 00 16.537811844   14.87 15.04     O9.5V((n)) 5 0
738 VFTS 746 * 05 39 07.3238549996 -69 07 46.080909172   15.5 15.38     O6Vnn 7 0
739 VFTS 745 * 05 39 07.3255536860 -69 02 36.566093801   16.87 16.59     B2.5II-Ib 5 0
740 [P93] 2022 * 05 39 07.6286363313 -69 06 25.000507119 14.568 15.288 15.132   14.794 B0.5V 6 0
741 VFTS 748 * 05 39 07.9490909555 -69 06 02.699483810   16.94 16.78     B0.7V 6 0
742 OGLE LMC553.25.008476 EB* 05 39 08.1621966318 -69 05 55.966586296   16.89 16.76   16.548 B0.7V 6 0
743 2MASS J05390833-6900575 SB* 05 39 08.3604664647 -69 00 57.586014139   15.32 15.43     O9.5IV 5 0
744 2MASS J05390900-6901291 * 05 39 08.9950080818 -69 01 29.330785394   16.47 16.32     O7-8Vnnz 9 0
745 VFTS 752 * 05 39 09.1311392222 -68 57 47.370385318   16.36 16.48     B2V 5 0
746 IRSF J05390915-6912104 * 05 39 09.145 -69 12 10.45   16.88 16.46     O9.7II-III 10 0
747 VFTS 754 * 05 39 10.0591173378 -69 06 21.509391860   16.81 16.55     B1.5V 5 0
748 SSTISAGEMC J053910.91-690613.2 * 05 39 10.9162873098 -69 06 13.739889801 14.314 15.101 15.011   14.676 O3Vn((f*)) 9 0
749 AL 382 Em* 05 39 10.9428717960 -68 56 46.841140480   14.74 14.58 14.69   B0.5IIIe+ 9 0
750 VFTS 757 * 05 39 11.1453376468 -69 02 59.124159284   17.04 16.78     B3III(n) 5 0
751 HD 38344 WR* 05 39 11.3191294608 -69 02 01.572235036 12.323 13.04 12.993 13.07 12.574 WN5h 67 0
752 VFTS 761 * 05 39 12.7301601887 -68 58 47.421401248   15.22 15.35     O6.5V((n))((f))zNstr 8 0
753 VFTS 762 * 05 39 13.2757997929 -69 09 27.581911056   16.68 16.46     B1.5V 5 0
754 CPD-69 470 s*b 05 39 14.5236869748 -69 16 42.471472434   12.35 12.26     O9.7IaNstr 14 0
755 VFTS 766 * 05 39 15.2041896708 -68 58 51.603176593   15.27 15.34     B5-8e 4 0
756 VFTS 768 * 05 39 16.2307396624 -69 01 20.392031182   16.3 16.10     O8Vn 7 0
757 2MASS J05391668-6907030 SB* 05 39 16.6946581019 -69 07 03.118686899   15.91 15.83     O9.7II-III 5 0
758 IRSF J05391675-6903276 * 05 39 16.872 -69 03 27.69   15.87 15.79     O7Vnn 7 0
759 2MASS J05391738-6906098 SB* 05 39 17.3877657725 -69 06 09.913498559 15.087 15.721 15.603   15.338 O9.7III:(n) 7 0
760 VFTS 772 * 05 39 17.8122633434 -68 57 33.774980508   16.88 16.89     B3-5V-III 6 0
761 2MASS J05391867-6907472 SB* 05 39 18.6748994770 -69 07 47.358124230   17.38 16.89     O7.5IVp+O8.5:V: 5 0
762 VFTS 775 * 05 39 18.8728685419 -69 14 19.468148615   17.14 16.85     O9.2V 7 0
763 VFTS 777 * 05 39 19.8944373060 -69 01 12.870203949   15.68 15.30     O9.2II 7 0
764 IRSF J05392077-6902118 * 05 39 20.782 -69 02 11.73   16.78 16.64     O9.5V 7 0
765 VFTS 779 * 05 39 21.5357995532 -69 03 18.463904309   15.65 15.46     B1II-Ib 6 0
766 VFTS 780 * 05 39 21.6632235420 -68 57 01.643589170   16.62 16.73     B1.5V 5 0
767 VFTS 781 * 05 39 22.4425380402 -69 15 18.437527619   15.98 15.66     B 5 0
768 VFTS 782 * 05 39 23.8019503436 -69 10 54.526502602   15.83 15.47     O8.5III 7 0
769 [P93] 2151 * 05 39 24.222 -69 06 11.45   17.02 16.83     B1:V 5 0
770 VFTS 786 * 05 39 24.7103602053 -69 12 39.583496887   16.8 16.53     B1-2IIIe+ 5 0
771 VFTS 787 SB* 05 39 24.7892052504 -69 05 51.614562760   16.68 16.53     O9.7III 8 0
772 VFTS 788 * 05 39 25.1056041140 -69 01 30.802143712   16.24 16.15     B1III 5 0
773 VFTS 789 * 05 39 25.6717577361 -69 12 45.468128588   17.09 16.88     B0.5-2V 5 0
774 VFTS 792 * 05 39 28.0900972791 -68 56 58.957874892   15.9 15.96     B2V 5 0
775 VFTS 794 * 05 39 29.1622034843 -68 58 05.065413205   15.84 15.80     B1-2V-IIIe+ 5 0
776 VFTS 795 * 05 39 29.4501649547 -69 09 22.909349422   16.76 16.35     B1III 5 0
777 [RP2006] 268 Em* 05 39 30.10 -68 58 57.7 16.23 16.92 16.90     B1-2Ve+ 11 0
778 VFTS 797 * 05 39 30.6377599724 -69 09 26.351856484   14.73 14.68     O3.5V((n))((fc)) 7 0
779 VFTS 798 * 05 39 30.8804402375 -69 13 17.729371591   17.15 16.71     B1V 5 0
780 VFTS 799 * 05 39 31.1320588024 -69 04 36.863587847   16.96 16.86     B0.5-0.7V 6 0
781 VFTS 800 * 05 39 31.450 -69 12 11.41   16.13 15.89     B1-2IIIe+ 5 0
782 VFTS 801 * 05 39 31.6545481850 -68 59 47.472410403   15.87 15.94     B1.5V 6 0
783 BI 258 SB* 05 39 32.5799314471 -69 00 02.553807381 12.94 13.95 14.14     O7.5Vz 8 0
784 VFTS 804 * 05 39 33.7681100788 -69 01 01.994497374   17.08 17.03     B2:V 5 0
785 BI 259 SB* 05 39 34.8740103895 -68 59 48.649761897 12.88 13.89 14.06     O5.5V((fc)):z+O7Vz: 9 0
786 VFTS 807 * 05 39 35.140 -69 10 30.73   16.93 16.37     O9.5IIINstr 8 0
787 2MASS J05393576-6907081 SB* 05 39 35.7995205287 -69 07 08.159513570   16.43 16.36     O9.7V+B1:V: 6 0
788 VFTS 811 * 05 39 35.8588687237 -68 59 02.805507572   16.48 16.56     B2V 5 0
789 2MASS J05393611-6904591 SB* 05 39 36.1194956625 -69 04 59.133812304 13.618 14.469 14.319   14.326 O4-5V((fc)) 6 0
790 VFTS 813 * 05 39 36.2064834360 -68 57 29.647575710   16.48 16.54     B2.5Ve 5 0
791 VFTS 814 * 05 39 36.4038250366 -69 01 07.825846625   16.86 16.81     B2.5V 5 0
792 VFTS 815 * 05 39 36.490 -69 12 00.32   16.87 16.68     B1.5V 5 0
793 [P93] 2252 * 05 39 37.2089 -69 04 04.254   15.7 15.53     B1II/III 6 0
794 VFTS 819 * 05 39 37.8338337731 -69 13 33.026593390   17.19 16.79     ON8III((f)) 8 0
795 VFTS 821 * 05 39 38.4367610039 -68 58 36.082362811   15.89 16.03     B0V-IV 4 0
796 2MASS J05393847-6909004 Y*? 05 39 38.4779780084 -69 09 00.523741514 15.395 16.028 15.433   14.926 -lateB[e] 5 0
797 [SL63] 639 As* 05 39 39 -69 12.1   12.13 11.53     ~ 22 0
798 VFTS 823 * 05 39 39.060 -69 11 51.61   16.23 16.06     B2-3III:e 5 0
799 VFTS 824 * 05 39 39.170 -69 11 55.29   16.72 16.36     B1.5-2Ve 5 0
800 VFTS 825 * 05 39 39.210 -69 11 41.72   16.53 16.20     B1.5-2V-IIIe 5 0
801 VFTS 826 * 05 39 39.250 -69 11 45.95   15.02 14.85     B1IIn 6 0
802 VFTS 827 * 05 39 39.270 -69 11 44.20   15.65 15.34     B1.5Ib 6 0
803 VFTS 829 * 05 39 39.640 -69 12 01.33   15.54 15.13     B1.5-2II 6 0
804 2MASS J05393973-6904302 SB* 05 39 39.7464881638 -69 04 30.309553414   15.36 15.39     O5-6V(n)((f)) 7 0
805 VFTS 831 s*b 05 39 39.8654813384 -69 12 04.337186210   13.33 13.04     B5Ia 6 0
806 VFTS 832 * 05 39 39.960 -69 11 55.54   16.87 16.50     B1V 5 0
807 VFTS 833 * 05 39 40.1469599159 -69 09 02.230971997   17.18 16.96     B1-3V 5 0
808 VFTS 834 * 05 39 40.320 -69 11 43.84   15.52 15.19     B1.5III 5 0
809 VFTS 835 * 05 39 40.840 -69 11 52.41           B1Ve 6 0
810 VFTS 836 * 05 39 40.940 -69 11 53.62   15.89 15.71     B1.5IIIe 5 0
811 VFTS 837 * 05 39 41.2537326717 -68 59 37.973121225   15.98 16.07     B1V 5 0
812 VFTS 838 * 05 39 41.760 -69 09 32.44   16.09 15.81     B1:II(n) 7 0
813 VFTS 840 * 05 39 42.170 -69 11 48.87   16.98 16.74     B1.5:Ve 5 0
814 VFTS 841 s*b 05 39 42.2474151610 -69 13 28.426183439   16.72 15.83     B2.5Ia 5 0
815 2MASS J05394267-6911512 Y*? 05 39 42.679 -69 11 51.28   16.62 16.29     B1-2IIIe+ 6 0
816 VFTS 843 * 05 39 43.3792130201 -69 01 22.371080276   15.83 15.88     O9.5IIIn 9 0
817 [P93] 2305 * 05 39 43.7983885536 -69 05 49.698681995 14.765 15.340 15.196   14.888 B1III 7 0
818 VFTS 846 * 05 39 44.6271147818 -69 14 19.480937214   16.89 16.78     B2.5V 5 0
819 [P93] 2313 * 05 39 45.5830401057 -69 04 26.246227846 14.780 15.474 15.387   15.376 B0.7-1IIIne 6 0
820 2MASS J05394565-6912082 Y*? 05 39 45.6689884334 -69 12 08.255547413   15.79 16.193   15.685 B1.5IIIe+ 6 0
821 VFTS 849 * 05 39 47.3672382974 -68 59 22.032043314   15.06 15.14     O7Vz 8 0
822 VFTS 850 * 05 39 51.1598334172 -69 11 53.610732592   16.33 16.15     B1III 5 0
823 IRSF J05395154-6902226 * 05 39 51.533 -69 02 22.66   15.74 15.83     B2III 6 0
824 IRSF J05395251-6907387 * 05 39 52.489 -69 07 38.79   17.11 16.78     B1-2Ve+ 5 0
825 VFTS 854 * 05 39 52.6429017814 -69 00 19.868428275   16.38 16.28     B1-3V-IIIe+ 5 0
826 VFTS 855 * 05 39 53.5478999218 -69 11 31.064561487   15.61 15.34     B3Ib 5 0
827 OGLE LMC-ECL-21898 EB* 05 39 53.7249159005 -69 11 02.283333036   16.43 16.26   16.060 B1.5V 7 0
828 VFTS 859 SB* 05 39 54.5912927547 -69 06 40.150993615   15.69 15.66     O9.5IV+sec 3 0
829 VFTS 860 * 05 39 55.1228303545 -69 11 22.130537349   16.8 16.67     B1.5V 6 0
830 VFTS 864 * 05 39 56.8177868343 -69 01 23.085201796   16.59 16.64     B1.5V 6 0
831 VFTS 866 * 05 40 00.4100912940 -69 01 16.311829857   16.12 16.24     B1.5V 5 0
832 BI 261 * 05 40 01.3302066127 -69 07 59.545234545 13.74 14.76 14.63     B1IbNwk 8 0
833 VFTS 868 * 05 40 04.2949732576 -69 11 02.940531738   16.92 16.65     B2V 6 0
834 VFTS 869 * 05 40 05.5380424779 -69 02 44.985579612   16.81 16.76     B1-1.5V 5 0
835 VFTS 872 * 05 40 07.6248132875 -69 03 23.974600129   16.02 16.09     B0V-IV 6 0
836 VFTS 873 * 05 40 07.6570265628 -69 06 43.946156456   15.28 15.07     ~ 2 0
837 2MASS J05401032-6903050 V* 05 40 10.3314937161 -69 03 04.965677825   15.39 15.37     B1.5IIIe+ 6 0
838 VFTS 875 * 05 40 11.760 -69 00 37.85   16.44 16.46     B2V 5 0
839 IRSF J05401249-6903582 * 05 40 12.438 -69 03 57.88   16.3 16.30     B3-5III(n)e 5 0
840 VFTS 877 * 05 40 12.7996699416 -69 09 10.283150269   16.54 16.36     B1-3V-IIIe+ 5 0
841 VFTS 879 * 05 40 13.6907304260 -69 05 09.761026685   16.84 16.73     B3V-III 6 0
842 IRSF J05401479-6901044 * 05 40 14.842 -69 01 04.49   16.72 16.66     B1-2Ve_sh 5 0
843 VFTS 881 * 05 40 17.2454106478 -69 06 27.077275907   15.6 15.66     B0.5III 6 0
844 IRSF J05401796-6904171 * 05 40 17.932 -69 04 16.97   15.86 15.96     B0V(n) 5 0
845 OGLE LMC-ECL-22070 EB* 05 40 18.0225951203 -69 08 36.030397546   16.62 16.49   16.280 B0.5V 7 0
846 IRSF J05402029-6903119 * 05 40 20.279 -69 03 12.01   15.91 15.90     B1.5V 6 0
847 VFTS 886 * 05 40 21.1904150067 -69 03 29.588526456   16.78 16.82     B1V 6 0
848 2MASS J05402153-6904237 SB* 05 40 21.5348656943 -69 04 23.680600490   14.9 14.96     O9.5II-IIIn 5 0
849 VFTS 888 * 05 40 22.6201900974 -69 04 06.071806981   16.11 16.18     B0.5V 5 0
850 VFTS 889 * 05 40 23.6628949366 -69 05 14.342281364   16.93 16.56     B1-2Ve 5 0
851 VFTS 890 * 05 40 24.8552706988 -69 09 44.108258140   16.15 16.13     B2V 5 0
852 IRSF J05402573-6906308 * 05 40 25.744 -69 06 30.43   16.55 16.48     B2V 5 0
853 VFTS 892 * 05 40 25.9852558004 -69 07 58.149256187   15.74 15.69     O9V 7 0
854 HD 62542 * 07 42 37.2148100663 -42 13 47.830173869   8.21 8.03     B3V 134 0
855 GUM 29 HII 10 24 14.6 -57 46 58           ~ 195 0
856 * eta Car Em* 10 45 03.545808 -59 41 03.95124 6.37 7.03 6.48 4.90 4.41 OBepec 2274 0
857 Cl Trumpler 16 OpC 10 45 10 -59 43.0   5.35 5.0     ~ 442 0
858 NGC 3603 OpC 11 15 18.6 -61 15 26           ~ 983 1
859 NGC 5139 GlC 13 26 47.28 -47 28 46.1   6.12 5.33     ~ 3114 0
860 NAME Upper Sco Association As* 16 12 -23.4           ~ 1104 1
861 NAME Ophiuchus Molecular Cloud SFR 16 28 06 -24 32.5           ~ 3186 1
862 NAME Cepheus Bubble PoC 21 44 +61.7           ~ 33 0
863 NAME Local Bubble ISM ~ ~           ~ 738 0
864 NAME Local Group GrG ~ ~           ~ 7291 0

    Equat.    Gal    SGal    Ecl

To bookmark this query, right click on this link: simbad:objects in 2013A&A...550A.108V and select 'bookmark this link' or equivalent in the popup menu


© Université de Strasbourg/CNRS

    • Contact